From d21686263574e95cb3e9e9b0496f968b1b897fdb Mon Sep 17 00:00:00 2001 From: Stefan Roese Date: Thu, 19 Apr 2007 09:53:52 +0200 Subject: [PATCH 01/47] ppc4xx: Fix chip select timing for SysACE access on AMCC Katmai Previous versions used full wait states for the chip select #1 which is connected to the Xilinix SystemACE controller on the AMCC Katmai evaluation board. This leads to really slow access and therefore low performance. This patch now sets up the chip select a lot faster resulting in much better read/write performance of the Linux driver. Signed-off-by: Stefan Roese --- include/configs/katmai.h | 14 +++++++++++++- 1 file changed, 13 insertions(+), 1 deletion(-) diff --git a/include/configs/katmai.h b/include/configs/katmai.h index 7f55366ca..cc47a168e 100644 --- a/include/configs/katmai.h +++ b/include/configs/katmai.h @@ -360,7 +360,19 @@ EBC_BXCR_BW_16BIT) /* Memory Bank 1 (Xilinx System ACE controller) initialization */ -#define CFG_EBC_PB1AP 0x7F8FFE80 +#define CFG_EBC_PB1AP (EBC_BXAP_BME_DISABLED | \ + EBC_BXAP_TWT_ENCODE(4) | \ + EBC_BXAP_BCE_DISABLE | \ + EBC_BXAP_BCT_2TRANS | \ + EBC_BXAP_CSN_ENCODE(0) | \ + EBC_BXAP_OEN_ENCODE(0) | \ + EBC_BXAP_WBN_ENCODE(0) | \ + EBC_BXAP_WBF_ENCODE(0) | \ + EBC_BXAP_TH_ENCODE(0) | \ + EBC_BXAP_RE_DISABLED | \ + EBC_BXAP_SOR_NONDELAYED | \ + EBC_BXAP_BEM_WRITEONLY | \ + EBC_BXAP_PEN_DISABLED) #define CFG_EBC_PB1CR (EBC_BXCR_BAS_ENCODE(CFG_ACE_BASE) | \ EBC_BXCR_BS_1MB | \ EBC_BXCR_BU_RW | \ From 7dbdf28b8bd855a8530dc3292e4982575a197060 Mon Sep 17 00:00:00 2001 From: Jon Loeliger Date: Fri, 20 Apr 2007 14:11:38 -0500 Subject: [PATCH 02/47] mpc86xx: protect memcpy to bad address if a mac-address is missing from dt Signed-off-by: Kim Phillips Signed-off-by: Jon Loeliger --- cpu/mpc86xx/cpu.c | 12 ++++++++---- 1 file changed, 8 insertions(+), 4 deletions(-) diff --git a/cpu/mpc86xx/cpu.c b/cpu/mpc86xx/cpu.c index 84f5bef50..73de8cb4a 100644 --- a/cpu/mpc86xx/cpu.c +++ b/cpu/mpc86xx/cpu.c @@ -280,22 +280,26 @@ ft_cpu_setup(void *blob, bd_t *bd) #if defined(CONFIG_MPC86XX_TSEC1) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/mac-address", &len); - memcpy(p, bd->bi_enetaddr, 6); + if (p != NULL) + memcpy(p, bd->bi_enetaddr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC2) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/mac-address", &len); - memcpy(p, bd->bi_enet1addr, 6); + if (p != NULL) + memcpy(p, bd->bi_enet1addr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC3) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/mac-address", &len); - memcpy(p, bd->bi_enet2addr, 6); + if (p != NULL) + memcpy(p, bd->bi_enet2addr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC4) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/mac-address", &len); - memcpy(p, bd->bi_enet3addr, 6); + if (p != NULL) + memcpy(p, bd->bi_enet3addr, 6); #endif } From bd7851ce1e1f140665b520026abf1042968b1102 Mon Sep 17 00:00:00 2001 From: Jon Loeliger Date: Fri, 20 Apr 2007 14:12:26 -0500 Subject: [PATCH 03/47] mpc86xx; Write MAC address to mac-address and local-mac-address Some device trees have a mac-address property, some have local-mac-address, and some have both. To support all of these device trees, ftp_cpu_setup() should write the MAC address to mac-address and local-mac-address, if they exist. Signed-off-by: Timur Tabi Signed-off-by: Jon Loeliger --- cpu/mpc86xx/cpu.c | 12 ++++++++++++ 1 file changed, 12 insertions(+) diff --git a/cpu/mpc86xx/cpu.c b/cpu/mpc86xx/cpu.c index 73de8cb4a..a33acfec4 100644 --- a/cpu/mpc86xx/cpu.c +++ b/cpu/mpc86xx/cpu.c @@ -282,24 +282,36 @@ ft_cpu_setup(void *blob, bd_t *bd) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/mac-address", &len); if (p != NULL) memcpy(p, bd->bi_enetaddr, 6); + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/local-mac-address", &len); + if (p) + memcpy(p, bd->bi_enetaddr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC2) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/mac-address", &len); if (p != NULL) memcpy(p, bd->bi_enet1addr, 6); + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/local-mac-address", &len); + if (p != NULL) + memcpy(p, bd->bi_enet1addr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC3) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/mac-address", &len); if (p != NULL) memcpy(p, bd->bi_enet2addr, 6); + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/local-mac-address", &len); + if (p != NULL) + memcpy(p, bd->bi_enet2addr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC4) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/mac-address", &len); if (p != NULL) memcpy(p, bd->bi_enet3addr, 6); + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/local-mac-address", &len); + if (p != NULL) + memcpy(p, bd->bi_enet3addr, 6); #endif } From 79cb47391eebef85acadb3f6961ef6c55cace6ac Mon Sep 17 00:00:00 2001 From: Zhang Wei Date: Fri, 19 Jan 2007 10:42:37 +0800 Subject: [PATCH 04/47] Enable LAWs for MPC8641 PCI-Ex2. Signed-off-by: Zhang Wei Signed-off-by: Jon Loeliger --- board/mpc8641hpcn/init.S | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/board/mpc8641hpcn/init.S b/board/mpc8641hpcn/init.S index 6b3e2d275..c7d12e793 100644 --- a/board/mpc8641hpcn/init.S +++ b/board/mpc8641hpcn/init.S @@ -59,7 +59,7 @@ #define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M)) #define LAWBAR3 ((CFG_PCI2_MEM_BASE>>12) & 0xffffff) -#define LAWAR3 (~LAWAR_EN & (LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M))) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M)) /* * This is not so much the SDRAM map as it is the whole localbus map. @@ -71,7 +71,7 @@ #define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M)) #define LAWBAR6 ((CFG_PCI2_IO_BASE>>12) & 0xffffff) -#define LAWAR6 (~LAWAR_EN &( LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M))) +#define LAWAR6 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M)) #define LAWBAR7 ((0xfe000000 >>12) & 0xffffff) #define LAWAR7 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_32M)) From 2e343b9a57f32e1bd08c35c9976910333fb4e13d Mon Sep 17 00:00:00 2001 From: Ed Swarthout Date: Wed, 28 Feb 2007 05:37:29 -0600 Subject: [PATCH 05/47] mpc8641hpcn: Fix LAW and TLB setup to use the IO_PHYS #defines. Signed-off-by: Ed Swarthout --- board/mpc8641hpcn/init.S | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/board/mpc8641hpcn/init.S b/board/mpc8641hpcn/init.S index c7d12e793..cb21ba6a7 100644 --- a/board/mpc8641hpcn/init.S +++ b/board/mpc8641hpcn/init.S @@ -67,10 +67,10 @@ #define LAWBAR4 ((0xf8100000>>12) & 0xffffff) #define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_2M)) -#define LAWBAR5 ((CFG_PCI1_IO_BASE>>12) & 0xffffff) +#define LAWBAR5 ((CFG_PCI1_IO_PHYS>>12) & 0xffffff) #define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M)) -#define LAWBAR6 ((CFG_PCI2_IO_BASE>>12) & 0xffffff) +#define LAWBAR6 ((CFG_PCI2_IO_PHYS>>12) & 0xffffff) #define LAWAR6 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M)) #define LAWBAR7 ((0xfe000000 >>12) & 0xffffff) @@ -84,7 +84,7 @@ #define LAWAR8 ((LAWAR_TRGT_IF_DDR2 | (LAWAR_SIZE & LAWAR_SIZE_512M)) & ~LAWAR_EN) #endif -#define LAWBAR9 ((CFG_RIO_MEM_BASE>>12) & 0xfffff) +#define LAWBAR9 ((CFG_RIO_MEM_PHYS>>12) & 0xfffff) #define LAWAR9 (LAWAR_EN | LAWAR_TRGT_IF_RIO | (LAWAR_SIZE & LAWAR_SIZE_512M)) .section .bootpg, "ax" From 323bfa8f436dc3bc57187c9b1488bc3146ff1522 Mon Sep 17 00:00:00 2001 From: Stefan Roese Date: Mon, 23 Apr 2007 12:00:22 +0200 Subject: [PATCH 06/47] Remove BOARDLIBS usage completely Signed-off-by: Stefan Roese --- Makefile | 4 +++- board/ixdp425/config.mk | 3 --- board/mpc8360emds/config.mk | 5 ----- board/nc650/config.mk | 1 - board/prodrive/pdnb3/config.mk | 3 --- cpu/ixp/npe/Makefile | 2 +- doc/README.nand | 7 +------ include/configs/delta.h | 1 - include/configs/zylonite.h | 1 - 9 files changed, 5 insertions(+), 22 deletions(-) diff --git a/Makefile b/Makefile index 9a27bc2f8..15dec1749 100644 --- a/Makefile +++ b/Makefile @@ -197,6 +197,9 @@ LIBS += cpu/$(CPU)/lib$(CPU).a ifdef SOC LIBS += cpu/$(CPU)/$(SOC)/lib$(SOC).a endif +ifeq ($(CPU),ixp) +LIBS += cpu/ixp/npe/libnpe.a +endif LIBS += lib_$(ARCH)/lib$(ARCH).a LIBS += fs/cramfs/libcramfs.a fs/fat/libfat.a fs/fdos/libfdos.a fs/jffs2/libjffs2.a \ fs/reiserfs/libreiserfs.a fs/ext2/libext2fs.a @@ -219,7 +222,6 @@ LIBS += $(shell if [ -d post/cpu/$(CPU) ]; then echo \ LIBS += $(shell if [ -d post/board/$(BOARDDIR) ]; then echo \ "post/board/$(BOARDDIR)/libpost$(BOARD).a"; fi) LIBS += common/libcommon.a -LIBS += $(BOARDLIBS) LIBS := $(addprefix $(obj),$(LIBS)) .PHONY : $(LIBS) diff --git a/board/ixdp425/config.mk b/board/ixdp425/config.mk index d49c0e7e6..0436c5b78 100644 --- a/board/ixdp425/config.mk +++ b/board/ixdp425/config.mk @@ -1,4 +1 @@ TEXT_BASE = 0x00f80000 - -# include NPE ethernet driver -BOARDLIBS = $(obj)cpu/ixp/npe/libnpe.a diff --git a/board/mpc8360emds/config.mk b/board/mpc8360emds/config.mk index 5801a5f17..9ace8860c 100644 --- a/board/mpc8360emds/config.mk +++ b/board/mpc8360emds/config.mk @@ -26,8 +26,3 @@ # TEXT_BASE = 0xFE000000 - -# -# Additional board-specific libraries -# -BOARDLIBS = libfdt/libfdt.a diff --git a/board/nc650/config.mk b/board/nc650/config.mk index 52c8ffe35..b5c9df289 100644 --- a/board/nc650/config.mk +++ b/board/nc650/config.mk @@ -27,4 +27,3 @@ # TEXT_BASE = 0x40700000 -BOARDLIBS = $(obj)drivers/nand/libnand.a diff --git a/board/prodrive/pdnb3/config.mk b/board/prodrive/pdnb3/config.mk index 767075884..2f7cc3b96 100644 --- a/board/prodrive/pdnb3/config.mk +++ b/board/prodrive/pdnb3/config.mk @@ -1,4 +1 @@ TEXT_BASE = 0x01f00000 - -# include NPE ethernet driver -BOARDLIBS = $(obj)cpu/ixp/npe/libnpe.a diff --git a/cpu/ixp/npe/Makefile b/cpu/ixp/npe/Makefile index 4de34fd5b..7f020b5d5 100644 --- a/cpu/ixp/npe/Makefile +++ b/cpu/ixp/npe/Makefile @@ -87,7 +87,7 @@ START := $(addprefix $(obj),$(START)) all: $(LIB) -$(LIB): $(obj).depend $(OBJS) +$(LIB): $(OBJS) $(AR) $(ARFLAGS) $@ $(OBJS) ######################################################################### diff --git a/doc/README.nand b/doc/README.nand index b5171f4d4..5c31845a9 100644 --- a/doc/README.nand +++ b/doc/README.nand @@ -192,12 +192,7 @@ The old NAND handling code has been re-factored and is now confined to only board-specific files and - unfortunately - to the DoC code (see below). A new configuration variable has been introduced: CFG_NAND_LEGACY, which has to be defined in the board config file if -that board uses legacy code. If CFG_NAND_LEGACY is defined, the board -specific config.mk file should also have "BOARDLIBS = -drivers/nand_legacy/libnand_legacy.a". For boards using the new NAND -approach (PPChameleon and netstar at the moment) no variable is -necessary, but the config.mk should have "BOARDLIBS = -drivers/nand/libnand.a". +that board uses legacy code. The necessary changes have been made to all affected boards, and no build breakage has been introduced, except for NETTA and NETTA_ISDN diff --git a/include/configs/delta.h b/include/configs/delta.h index 91284fdac..15681208b 100644 --- a/include/configs/delta.h +++ b/include/configs/delta.h @@ -188,7 +188,6 @@ /* * NAND Flash */ -/* Use the new NAND code. (BOARDLIBS = drivers/nand/libnand.a required) */ #undef CFG_NAND_LEGACY #define CFG_NAND0_BASE 0x0 /* 0x43100040 */ /* 0x10000000 */ diff --git a/include/configs/zylonite.h b/include/configs/zylonite.h index c6aa8ece5..1e8ed7abd 100644 --- a/include/configs/zylonite.h +++ b/include/configs/zylonite.h @@ -174,7 +174,6 @@ /* * NAND Flash */ -/* Use the new NAND code. (BOARDLIBS = drivers/nand/libnand.a required) */ #define CONFIG_NEW_NAND_CODE #define CFG_NAND0_BASE 0x0 #undef CFG_NAND1_BASE From 41fb7e0f1ec9b91bdae2565bab5f2e3ee15039c7 Mon Sep 17 00:00:00 2001 From: Zang Roy-r61911 Date: Thu, 14 Dec 2006 14:14:55 +0800 Subject: [PATCH 07/47] u-boot: Enable PCI function and add PEX & rapidio memory map on MPC8548CDS board Enable PCI function and add PEX & rapidio memory map on MPC8548CDS board. Signed-off-by: Roy Zang --- board/cds/mpc8548cds/init.S | 77 +++++++++++++++++++-------------- board/cds/mpc8548cds/u-boot.lds | 1 + include/asm-ppc/mmu.h | 1 + include/configs/MPC8548CDS.h | 28 ++++++++---- 4 files changed, 67 insertions(+), 40 deletions(-) diff --git a/board/cds/mpc8548cds/init.S b/board/cds/mpc8548cds/init.S index 978bda5e4..2c15debd4 100644 --- a/board/cds/mpc8548cds/init.S +++ b/board/cds/mpc8548cds/init.S @@ -64,8 +64,9 @@ tlb1_entry: /* * Number of TLB0 and TLB1 entries in the following table */ - .long 13 + .long (2f-1f)/16 +1: #if (CFG_CCSRBAR_DEFAULT != CFG_CCSRBAR) /* * TLB0 4K Non-cacheable, guarded @@ -134,7 +135,7 @@ tlb1_entry: /* * TLB 1: 256M Non-cacheable, guarded - * 0x80000000 256M PCI1 MEM First half + * 0x80000000 256M PCI1 MEM */ .long TLB1_MAS0(1, 1, 0) .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) @@ -143,40 +144,37 @@ tlb1_entry: /* * TLB 2: 256M Non-cacheable, guarded - * 0x90000000 256M PCI1 MEM Second half + * 0x90000000 256M PCI2 MEM */ .long TLB1_MAS0(1, 2, 0) .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) - .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE + 0x10000000), + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE), 0,0,0,0,1,0,1,0) - .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE + 0x10000000), + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) /* - * TLB 3: 256M Non-cacheable, guarded - * 0xa0000000 256M PCI2 MEM First half + * TLB 3: 1GB Non-cacheable, guarded + * 0xa0000000 256M PEX MEM First half + * 0xb0000000 256M PEX MEM Second half + * 0xc0000000 256M Rapid IO MEM First half + * 0xd0000000 256M Rapid IO MEM Second half */ .long TLB1_MAS0(1, 3, 0) - .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) - .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE), 0,0,0,0,1,0,1,0) - .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1GB) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PEX_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PEX_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) /* - * TLB 4: 256M Non-cacheable, guarded - * 0xb0000000 256M PCI2 MEM Second half + * TLB 4: Reserved for future usage */ - .long TLB1_MAS0(1, 4, 0) - .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) - .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE + 0x10000000), - 0,0,0,0,1,0,1,0) - .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE + 0x10000000), - 0,0,0,0,0,1,0,1,0,1) /* * TLB 5: 64M Non-cacheable, guarded * 0xe000_0000 1M CCSRBAR - * 0xe200_0000 16M PCI1 IO - * 0xe300_0000 16M PCI2 IO + * 0xe200_0000 8M PCI1 IO + * 0xe280_0000 8M PCI2 IO + * 0xe300_0000 16M PEX IO */ .long TLB1_MAS0(1, 5, 0) .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) @@ -200,19 +198,22 @@ tlb1_entry: .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1M) .long TLB1_MAS2(E500_TLB_EPN(CADMUS_BASE_ADDR), 0,0,0,0,1,0,1,0) .long TLB1_MAS3(E500_TLB_RPN(CADMUS_BASE_ADDR), 0,0,0,0,0,1,0,1,0,1) - +2: entry_end /* * LAW(Local Access Window) configuration: * * 0x0000_0000 0x7fff_ffff DDR 2G - * 0x8000_0000 0x9fff_ffff PCI1 MEM 512M - * 0xa000_0000 0xbfff_ffff PCI2 MEM 512M + * 0x8000_0000 0x8fff_ffff PCI1 MEM 256M + * 0x9000_0000 0x9fff_ffff PCI2 MEM 256M + * 0xa000_0000 0xbfff_ffff PEX MEM 512M + * 0xc000_0000 0xdfff_ffff RapidIO 512M * 0xe000_0000 0xe000_ffff CCSR 1M - * 0xe200_0000 0xe20f_ffff PCI1 IO 1M - * 0xe210_0000 0xe21f_ffff PCI2 IO 1M - * 0xf000_0000 0xf7ff_ffff SDRAM 128M + * 0xe200_0000 0xe27f_ffff PCI1 IO 8M + * 0xe280_0000 0xe2ff_ffff PCI2 IO 8M + * 0xe300_0000 0xe3ff_ffff PEX IO 16M + * 0xf000_0000 0xf3ff_ffff SDRAM 64M * 0xf800_0000 0xf80f_ffff NVRAM/CADMUS (*) 1M * 0xff00_0000 0xff7f_ffff FLASH (2nd bank) 8M * 0xff80_0000 0xffff_ffff FLASH (boot bank) 8M @@ -229,27 +230,39 @@ tlb1_entry: #define LAWAR0 ((LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN) #define LAWBAR1 ((CFG_PCI1_MEM_BASE>>12) & 0xfffff) -#define LAWAR1 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M)) +#define LAWAR1 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_256M)) #define LAWBAR2 ((CFG_PCI2_MEM_BASE>>12) & 0xfffff) -#define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M)) +#define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_256M)) #define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) -#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_1M)) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_8M)) #define LAWBAR4 ((CFG_PCI2_IO_PHYS>>12) & 0xfffff) -#define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_1M)) +#define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_8M)) /* LBC window - maps 256M 0xf0000000 -> 0xffffffff */ #define LAWBAR5 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff) #define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) +#define LAWBAR6 ((CFG_PEX_MEM_BASE>>12) & 0xfffff) +#define LAWAR6 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_512M)) + +#define LAWBAR7 ((CFG_PEX_IO_BASE>>12) & 0xfffff) +#define LAWAR7 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_16M)) + +#define LAWBAR8 ((CFG_RIO_MEM_BASE>>12) & 0xfffff) +#define LAWAR8 (LAWAR_EN | LAWAR_TRGT_IF_RIO | (LAWAR_SIZE & LAWAR_SIZE_512M)) + .section .bootpg, "ax" .globl law_entry law_entry: entry_start - .long 6 + .long (4f-3f)/8 +3: .long LAWBAR0,LAWAR0,LAWBAR1,LAWAR1,LAWBAR2,LAWAR2,LAWBAR3,LAWAR3 - .long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5 + .long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5,LAWBAR6,LAWAR6,LAWBAR7,LAWAR7 + .long LAWBAR8,LAWAR8 +4: entry_end diff --git a/board/cds/mpc8548cds/u-boot.lds b/board/cds/mpc8548cds/u-boot.lds index 2c8fe9603..c1f3495d7 100644 --- a/board/cds/mpc8548cds/u-boot.lds +++ b/board/cds/mpc8548cds/u-boot.lds @@ -69,6 +69,7 @@ SECTIONS cpu/mpc85xx/interrupts.o (.text) cpu/mpc85xx/cpu_init.o (.text) cpu/mpc85xx/cpu.o (.text) + drivers/tsec.o (.text) cpu/mpc85xx/speed.o (.text) cpu/mpc85xx/pci.o (.text) common/dlmalloc.o (.text) diff --git a/include/asm-ppc/mmu.h b/include/asm-ppc/mmu.h index b226825ee..67c2c571e 100644 --- a/include/asm-ppc/mmu.h +++ b/include/asm-ppc/mmu.h @@ -413,6 +413,7 @@ extern int write_bat(ppc_bat_t bat, unsigned long upper, unsigned long lower); #define LAWAR_TRGT_IF_PCI1 0x00000000 #define LAWAR_TRGT_IF_PCIX 0x00000000 #define LAWAR_TRGT_IF_PCI2 0x00100000 +#define LAWAR_TRGT_IF_PEX 0x00200000 #define LAWAR_TRGT_IF_LBC 0x00400000 #define LAWAR_TRGT_IF_CCSR 0x00800000 #define LAWAR_TRGT_IF_DDR_INTERLEAVED 0x00B00000 diff --git a/include/configs/MPC8548CDS.h b/include/configs/MPC8548CDS.h index 7c4849fad..bfd316cb9 100644 --- a/include/configs/MPC8548CDS.h +++ b/include/configs/MPC8548CDS.h @@ -36,7 +36,7 @@ #define CONFIG_MPC8548 1 /* MPC8548 specific */ #define CONFIG_MPC8548CDS 1 /* MPC8548CDS board specific */ -#undef CONFIG_PCI +#define CONFIG_PCI #define CONFIG_TSEC_ENET /* tsec ethernet support */ #define CONFIG_ENV_OVERWRITE #define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup*/ @@ -344,18 +344,30 @@ extern unsigned long get_clock_freq(void); */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE -#define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI1_MEM_SIZE 0x10000000 /* 256M */ #define CFG_PCI1_IO_BASE 0x00000000 #define CFG_PCI1_IO_PHYS 0xe2000000 -#define CFG_PCI1_IO_SIZE 0x00100000 /* 1M */ +#define CFG_PCI1_IO_SIZE 0x00800000 /* 8M */ -#define CFG_PCI2_MEM_BASE 0xa0000000 +#define CFG_PCI2_MEM_BASE 0x90000000 #define CFG_PCI2_MEM_PHYS CFG_PCI2_MEM_BASE -#define CFG_PCI2_MEM_SIZE 0x20000000 /* 512M */ -#define CFG_PCI2_IO_BASE 0x00000000 -#define CFG_PCI2_IO_PHYS 0xe2100000 -#define CFG_PCI2_IO_SIZE 0x00100000 /* 1M */ +#define CFG_PCI2_MEM_SIZE 0x10000000 /* 256M */ +#define CFG_PCI2_IO_BASE 0xe2800000 +#define CFG_PCI2_IO_PHYS 0xe2800000 +#define CFG_PCI2_IO_SIZE 0x00800000 /* 8M */ +#define CFG_PEX_MEM_BASE 0xa0000000 +#define CFG_PEX_MEM_PHYS CFG_PEX_MEM_BASE +#define CFG_PEX_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PEX_IO_BASE 0xe3000000 +#define CFG_PEX_IO_PHYS CFG_PEX_IO_BASE +#define CFG_PEX_IO_SIZE 0x1000000 /* 16M */ + +/* + * RapidIO MMU + */ +#define CFG_RIO_MEM_BASE 0xC0000000 +#define CFG_RIO_MEM_SIZE 0x20000000 /* 512M */ #if defined(CONFIG_PCI) From 39b18c4f3e0b6d0dc00f4e68bad2da3766c85f09 Mon Sep 17 00:00:00 2001 From: "ebony.zhu@freescale.com" Date: Mon, 18 Dec 2006 16:25:15 +0800 Subject: [PATCH 08/47] u-boot: Disables MPC8548CDS 2T_TIMING for DDR by default This patch disables MPC8548CDS 2T_TIMING for DDR by default. Signed-off-by:Ebony Zhu --- include/configs/MPC8548CDS.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/include/configs/MPC8548CDS.h b/include/configs/MPC8548CDS.h index bfd316cb9..687fe8485 100644 --- a/include/configs/MPC8548CDS.h +++ b/include/configs/MPC8548CDS.h @@ -41,7 +41,7 @@ #define CONFIG_ENV_OVERWRITE #define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup*/ #define CONFIG_DDR_DLL /* possible DLL fix needed */ -#define CONFIG_DDR_2T_TIMING /* Sets the 2T timing bit */ +#undef CONFIG_DDR_2T_TIMING /* Sets the 2T timing bit */ #define CONFIG_DDR_ECC /* only for ECC DDR module */ #define CONFIG_ECC_INIT_VIA_DDRCONTROLLER /* DDR controller or DMA? */ From 7337b237ffc4aaf1b9467024fe472a880d852598 Mon Sep 17 00:00:00 2001 From: Zang Roy-r61911 Date: Fri, 15 Dec 2006 14:43:31 +0800 Subject: [PATCH 09/47] u-boot: Fix CPU2 errata on MPC8548CDS board This patch apply workaround of CPU2 errata on MPC8548CDS board. Signed-off-by:Ebony Zhu --- board/cds/mpc8548cds/mpc8548cds.c | 7 +++++++ 1 file changed, 7 insertions(+) diff --git a/board/cds/mpc8548cds/mpc8548cds.c b/board/cds/mpc8548cds/mpc8548cds.c index 7433ebf25..0d3fcebfe 100644 --- a/board/cds/mpc8548cds/mpc8548cds.c +++ b/board/cds/mpc8548cds/mpc8548cds.c @@ -51,6 +51,7 @@ int checkboard (void) { volatile immap_t *immap = (immap_t *) CFG_CCSRBAR; volatile ccsr_gur_t *gur = &immap->im_gur; + volatile ccsr_local_ecm_t *ecm = &immap->im_local_ecm; /* PCI slot in USER bits CSR[6:7] by convention. */ uint pci_slot = get_pci_slot (); @@ -89,6 +90,12 @@ int checkboard (void) */ local_bus_init (); + /* + * Fix CPU2 errata: A core hang possible while executing a + * msync instruction and a snoopable transaction from an I/O + * master tagged to make quick forward progress is present. + */ + ecm->eebpcr |= (1 << 16); /* * Hack TSEC 3 and 4 IO voltages. From 0b1934ba12fd408fcc3b8bd9f4b04864c42a42bf Mon Sep 17 00:00:00 2001 From: Zang Roy-r61911 Date: Mon, 18 Dec 2006 17:01:04 +0800 Subject: [PATCH 10/47] u-boot: Fix the 85xxcds tsec bug Fix the 85xxcds tsec bug. When enable PCI, tsec.o should be added to u-boot.lds to make tsec work. Signed-off-by: Roy Zang --- board/cds/mpc8541cds/u-boot.lds | 1 + board/cds/mpc8555cds/u-boot.lds | 1 + 2 files changed, 2 insertions(+) diff --git a/board/cds/mpc8541cds/u-boot.lds b/board/cds/mpc8541cds/u-boot.lds index 1bea0074f..dc87a122a 100644 --- a/board/cds/mpc8541cds/u-boot.lds +++ b/board/cds/mpc8541cds/u-boot.lds @@ -69,6 +69,7 @@ SECTIONS cpu/mpc85xx/interrupts.o (.text) cpu/mpc85xx/cpu_init.o (.text) cpu/mpc85xx/cpu.o (.text) + drivers/tsec.o (.text) cpu/mpc85xx/speed.o (.text) cpu/mpc85xx/pci.o (.text) common/dlmalloc.o (.text) diff --git a/board/cds/mpc8555cds/u-boot.lds b/board/cds/mpc8555cds/u-boot.lds index 2aa2ad78f..9285928dc 100644 --- a/board/cds/mpc8555cds/u-boot.lds +++ b/board/cds/mpc8555cds/u-boot.lds @@ -69,6 +69,7 @@ SECTIONS cpu/mpc85xx/interrupts.o (.text) cpu/mpc85xx/cpu_init.o (.text) cpu/mpc85xx/cpu.o (.text) + drivers/tsec.o (.text) cpu/mpc85xx/speed.o (.text) cpu/mpc85xx/pci.o (.text) common/dlmalloc.o (.text) From 63247a5acd58032e6cf33f525bc3923b467bac88 Mon Sep 17 00:00:00 2001 From: Zang Roy-r61911 Date: Wed, 20 Dec 2006 11:01:00 +0800 Subject: [PATCH 11/47] u-boot: v2: Remove the fixed TLB and LAW entrynubmer Remove the fixed TLB and LAW entry nubmer. Use actually TLB and LAW entry number to control the loop. This can reduce the potential risk for the 85xx processor increasing its TLB adn LAW entry number. Signed-off-by: Swarthout Edward Signed-off-by: Roy Zang --- cpu/mpc85xx/start.S | 16 ++++------------ 1 file changed, 4 insertions(+), 12 deletions(-) diff --git a/cpu/mpc85xx/start.S b/cpu/mpc85xx/start.S index f96a4c3f8..20c7ebc72 100644 --- a/cpu/mpc85xx/start.S +++ b/cpu/mpc85xx/start.S @@ -251,13 +251,10 @@ _start_e500: */ bl tlb1_entry mr r5,r0 - li r1,0x0020 /* max 16 TLB1 plus some TLB0 entries */ - mtctr r1 lwzu r4,0(r5) /* how many TLB1 entries we actually use */ + mtctr r4 -0: cmpwi r4,0 - beq 1f - lwzu r0,4(r5) +0: lwzu r0,4(r5) lwzu r1,4(r5) lwzu r2,4(r5) lwzu r3,4(r5) @@ -269,7 +266,6 @@ _start_e500: msync tlbwe isync - addi r4,r4,-1 bdnz 0b 1: @@ -301,20 +297,16 @@ _start_e500: bl law_entry mr r6,r0 - li r1,0x0007 /* 8 LAWs, but reserve one for boot-over-rio-or-pci */ - mtctr r1 lwzu r5,0(r6) /* how many windows we actually use */ + mtctr r5 li r2,0x0c28 /* the first pair is reserved for boot-over-rio-or-pci */ li r1,0x0c30 -0: cmpwi r5,0 - beq 1f - lwzu r4,4(r6) +0: lwzu r4,4(r6) lwzu r3,4(r6) stwx r4,r7,r2 stwx r3,r7,r1 - addi r5,r5,-1 addi r2,r2,0x0020 addi r1,r1,0x0020 bdnz 0b From 96629cbabdb727d4a5e62542deefc01d498db6dc Mon Sep 17 00:00:00 2001 From: Zang Roy-r61911 Date: Tue, 5 Dec 2006 16:42:30 +0800 Subject: [PATCH 12/47] u-boot: Fix e500 v2 core reset bug The following patch fixes the e500 v2 core reset bug. For e500 v2 core, a new reset control register is added to reset the processor. Signed-off-by: Roy Zang --- cpu/mpc85xx/cpu.c | 21 +++++++++++++++------ 1 file changed, 15 insertions(+), 6 deletions(-) diff --git a/cpu/mpc85xx/cpu.c b/cpu/mpc85xx/cpu.c index 0507c47e6..2fe4f2abb 100644 --- a/cpu/mpc85xx/cpu.c +++ b/cpu/mpc85xx/cpu.c @@ -140,16 +140,25 @@ int checkcpu (void) int do_reset (cmd_tbl_t *cmdtp, bd_t *bd, int flag, int argc, char *argv[]) { + uint pvr; + uint ver; + pvr = get_pvr(); + ver = PVR_VER(pvr); + if (ver & 1){ + /* e500 v2 core has reset control register */ + volatile unsigned int * rstcr; + rstcr = (volatile unsigned int *)(CFG_IMMR + 0xE00B0); + *rstcr = 0x2; /* HRESET_REQ */ + }else{ /* * Initiate hard reset in debug control register DBCR0 * Make sure MSR[DE] = 1 */ - unsigned long val; - - val = mfspr(DBCR0); - val |= 0x70000000; - mtspr(DBCR0,val); - + unsigned long val; + val = mfspr(DBCR0); + val |= 0x70000000; + mtspr(DBCR0,val); + } return 1; } From 362dd83077ac04c0296bca3e824ec2fb3d44d9d6 Mon Sep 17 00:00:00 2001 From: Sergei Shtylyov Date: Wed, 27 Dec 2006 22:07:15 +0300 Subject: [PATCH 13/47] Fix PCI I/O space mapping on Freescale MPC85x0ADS The PCI I/O space mapping for Freescale MPC8540ADS board was broken by commit 52c7a68b8d587ebcf5a6b051b58b3d3ffa377ddc which failed to update the #define's describing the local address window used for the PCI I/O space accesses -- fix this and carry over the necessary changes into the MPC8560ADS code since the PCI I/O space mapping was also broken for this board (by the earlier commit 087454609e47295443af793a282cddcd91a5f49c). Add the comments clarifying how the PCI I/O space must be mapped to all the MPC85xx board config. headers. Signed-off-by: Sergei Shtylyov board/mpc8540ads/init.S | 4 ++-- board/mpc8560ads/init.S | 4 ++-- include/configs/MPC8540ADS.h | 5 ++--- include/configs/MPC8541CDS.h | 2 +- include/configs/MPC8548CDS.h | 2 +- include/configs/MPC8560ADS.h | 8 ++++---- 6 files changed, 12 insertions(+), 13 deletions(-) --- board/mpc8540ads/init.S | 4 ++-- board/mpc8560ads/init.S | 4 ++-- include/configs/MPC8540ADS.h | 5 ++--- include/configs/MPC8541CDS.h | 2 +- include/configs/MPC8548CDS.h | 2 +- include/configs/MPC8560ADS.h | 8 ++++---- 6 files changed, 12 insertions(+), 13 deletions(-) diff --git a/board/mpc8540ads/init.S b/board/mpc8540ads/init.S index 242cb9fbc..544fde94c 100644 --- a/board/mpc8540ads/init.S +++ b/board/mpc8540ads/init.S @@ -260,8 +260,8 @@ tlb1_entry: #define LAWBAR2 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff) #define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) -#define LAWBAR3 ((CFG_PCI1_IO_BASE>>12) & 0xfffff) -#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCIX | (LAWAR_SIZE & LAWAR_SIZE_16M)) +#define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCIX | (LAWAR_SIZE & LAWAR_SIZE_1M)) /* * Rapid IO at 0xc000_0000 for 512 M diff --git a/board/mpc8560ads/init.S b/board/mpc8560ads/init.S index 242cb9fbc..544fde94c 100644 --- a/board/mpc8560ads/init.S +++ b/board/mpc8560ads/init.S @@ -260,8 +260,8 @@ tlb1_entry: #define LAWBAR2 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff) #define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) -#define LAWBAR3 ((CFG_PCI1_IO_BASE>>12) & 0xfffff) -#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCIX | (LAWAR_SIZE & LAWAR_SIZE_16M)) +#define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCIX | (LAWAR_SIZE & LAWAR_SIZE_1M)) /* * Rapid IO at 0xc000_0000 for 512 M diff --git a/include/configs/MPC8540ADS.h b/include/configs/MPC8540ADS.h index 74a84f4e8..5aeea5868 100644 --- a/include/configs/MPC8540ADS.h +++ b/include/configs/MPC8540ADS.h @@ -330,13 +330,12 @@ /* * General PCI - * Addresses are mapped 1-1. + * Memory space is mapped 1-1, but I/O space must start from 0. */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE #define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ - -#define CFG_PCI1_IO_BASE 0x0 +#define CFG_PCI1_IO_BASE 0x00000000 #define CFG_PCI1_IO_PHYS 0xe2000000 #define CFG_PCI1_IO_SIZE 0x100000 /* 1M */ diff --git a/include/configs/MPC8541CDS.h b/include/configs/MPC8541CDS.h index db389cfe6..fb360d282 100644 --- a/include/configs/MPC8541CDS.h +++ b/include/configs/MPC8541CDS.h @@ -334,7 +334,7 @@ extern unsigned long get_clock_freq(void); /* * General PCI - * Addresses are mapped 1-1. + * Memory space is mapped 1-1, but I/O space must start from 0. */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE diff --git a/include/configs/MPC8548CDS.h b/include/configs/MPC8548CDS.h index 687fe8485..14936c28a 100644 --- a/include/configs/MPC8548CDS.h +++ b/include/configs/MPC8548CDS.h @@ -340,7 +340,7 @@ extern unsigned long get_clock_freq(void); /* * General PCI - * Addresses are mapped 1-1. + * Memory space is mapped 1-1, but I/O space must start from 0. */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE diff --git a/include/configs/MPC8560ADS.h b/include/configs/MPC8560ADS.h index 835bf5cb6..21e663768 100644 --- a/include/configs/MPC8560ADS.h +++ b/include/configs/MPC8560ADS.h @@ -320,14 +320,14 @@ /* * General PCI - * Addresses are mapped 1-1. + * Memory space is mapped 1-1, but I/O space must start from 0. */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE #define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ -#define CFG_PCI1_IO_BASE 0xe2000000 -#define CFG_PCI1_IO_PHYS CFG_PCI1_IO_BASE -#define CFG_PCI1_IO_SIZE 0x1000000 /* 16M */ +#define CFG_PCI1_IO_BASE 0x00000000 +#define CFG_PCI1_IO_PHYS 0xe2000000 +#define CFG_PCI1_IO_SIZE 0x100000 /* 1M */ #if defined(CONFIG_PCI) From 0cde4b00fc7393b89f379d83a9d436dcb1334bfa Mon Sep 17 00:00:00 2001 From: Jon Loeliger Date: Wed, 11 Apr 2007 16:50:57 -0500 Subject: [PATCH 14/47] Add MPC8544DS main configuration file. Signed-off-by: Ed Swarthout Signed-off-by: Jon Loeliger --- include/configs/MPC8544DS.h | 591 ++++++++++++++++++++++++++++++++++++ 1 file changed, 591 insertions(+) create mode 100644 include/configs/MPC8544DS.h diff --git a/include/configs/MPC8544DS.h b/include/configs/MPC8544DS.h new file mode 100644 index 000000000..4c3430897 --- /dev/null +++ b/include/configs/MPC8544DS.h @@ -0,0 +1,591 @@ +/* + * Copyright 2007 Freescale Semiconductor, Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +/* + * mpc8544ds board configuration file + * + */ +#ifndef __CONFIG_H +#define __CONFIG_H + +/* High Level Configuration Options */ +#define CONFIG_BOOKE 1 /* BOOKE */ +#define CONFIG_E500 1 /* BOOKE e500 family */ +#define CONFIG_MPC85xx 1 /* MPC8540/60/55/41/48 */ +#define CONFIG_MPC8544 1 +#define CONFIG_MPC8544DS 1 + +#undef CONFIG_PCI /* Enable PCI/PCIE */ +#undef CONFIG_PCI1 /* PCI controller 1 */ +#undef CONFIG_PCIE1 /* PCIE controler 1 (slot 1) */ +#undef CONFIG_PCIE2 /* PCIE controler 2 (slot 2) */ +#undef CONFIG_PCIE3 /* PCIE controler 3 (ULI bridge) */ +#undef CONFIG_FSL_PCI_INIT /* Use common FSL init code */ + +#define CONFIG_TSEC_ENET /* tsec ethernet support */ +#define CONFIG_ENV_OVERWRITE +#define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup */ +#undef CONFIG_DDR_DLL +#define CONFIG_DDR_2T_TIMING /* Sets the 2T timing bit */ + +#define CONFIG_DDR_ECC /* only for ECC DDR module */ +#define CONFIG_ECC_INIT_VIA_DDRCONTROLLER /* DDR controller or DMA? */ +#define CONFIG_MEM_INIT_VALUE 0xDeadBeef + +#define CONFIG_DDR_ECC_CMD + +/* + * When initializing flash, if we cannot find the manufacturer ID, + * assume this is the AMD flash associated with the CDS board. + * This allows booting from a promjet. + */ +#define CONFIG_ASSUME_AMD_FLASH + +#define MPC85xx_DDR_SDRAM_CLK_CNTL /* 85xx has clock control reg */ + +#ifndef __ASSEMBLY__ +extern unsigned long get_board_sys_clk(unsigned long dummy); +#endif +#define CONFIG_SYS_CLK_FREQ get_board_sys_clk(0) /* sysclk for MPC85xx */ + +/* + * These can be toggled for performance analysis, otherwise use default. + */ +#define CONFIG_L2_CACHE /* toggle L2 cache */ +#define CONFIG_BTB /* toggle branch predition */ +#define CONFIG_ADDR_STREAMING /* toggle addr streaming */ +#define CONFIG_CLEAR_LAW0 /* Clear LAW0 in cpu_init_r */ + +/* + * Only possible on E500 Version 2 or newer cores. + */ +#define CONFIG_ENABLE_36BIT_PHYS 1 + +#define CONFIG_BOARD_EARLY_INIT_F 1 /* Call board_pre_init */ + +#undef CFG_DRAM_TEST /* memory test, takes time */ +#define CFG_MEMTEST_START 0x00200000 /* memtest works on */ +#define CFG_MEMTEST_END 0x00400000 +#define CFG_ALT_MEMTEST +#define CONFIG_PANIC_HANG /* do not reset board on panic */ + +/* + * Base addresses -- Note these are effective addresses where the + * actual resources get mapped (not physical addresses) + */ +#define CFG_CCSRBAR_DEFAULT 0xff700000 /* CCSRBAR Default */ +#define CFG_CCSRBAR 0xe0000000 /* relocated CCSRBAR */ +#define CFG_IMMR CFG_CCSRBAR /* PQII uses CFG_IMMR */ + +#define CFG_PCI1_ADDR (CFG_CCSRBAR+0x8000) +#define CFG_PCIE1_ADDR (CFG_CCSRBAR+0xa000) +#define CFG_PCIE2_ADDR (CFG_CCSRBAR+0x9000) +#define CFG_PCIE3_ADDR (CFG_CCSRBAR+0xb000) + +/* + * DDR Setup + */ +#define CFG_DDR_SDRAM_BASE 0x00000000 /* DDR is system memory*/ +#define CFG_SDRAM_BASE CFG_DDR_SDRAM_BASE + +#define SPD_EEPROM_ADDRESS 0x51 /* DDR DIMM */ + +/* + * Make sure required options are set + */ +#ifndef CONFIG_SPD_EEPROM +#error ("CONFIG_SPD_EEPROM is required") +#endif + +#undef CONFIG_CLOCKS_IN_MHZ + +/* + * Memory map + * + * 0x0000_0000 0x7fff_ffff DDR 2G Cacheable + * + * 0x8000_0000 0xbfff_ffff PCI Express Mem 1G non-cacheable + * + * 0xc000_0000 0xdfff_ffff PCI 512M non-cacheable + * + * 0xe000_0000 0xe00f_ffff CCSR 1M non-cacheable + * 0xe100_0000 0xe3ff_ffff PCI IO range 4M non-cacheable + * + * Localbus cacheable + * + * 0xf000_0000 0xf3ff_ffff SDRAM 64M Cacheable + * 0xf401_0000 0xf401_3fff L1 for stack 4K Cacheable TLB0 + * + * Localbus non-cacheable + * + * 0xf800_0000 0xf80f_ffff NVRAM/CADMUS (*) 1M non-cacheable + * 0xff00_0000 0xff7f_ffff FLASH (2nd bank) 8M non-cacheable + * 0xff80_0000 0xffff_ffff FLASH (boot bank) 8M non-cacheable + * + */ + +/* + * Local Bus Definitions + */ +#define CFG_BOOT_BLOCK 0xfc000000 /* boot TLB */ + +#define CFG_LBC_CACHE_BASE 0xf0000000 /* Localbus cacheable */ + +#define CFG_FLASH_BASE 0xff800000 /* start of FLASH 8M */ + +#define CFG_BR0_PRELIM 0xff801001 +#define CFG_BR1_PRELIM 0xfe801001 + +#define CFG_OR0_PRELIM 0xff806e65 +#define CFG_OR1_PRELIM 0xff806e65 + +#define CFG_FLASH_BANKS_LIST {0xfe800000,CFG_FLASH_BASE} + +#define CFG_MAX_FLASH_BANKS 2 /* number of banks */ +#define CFG_MAX_FLASH_SECT 128 /* sectors per device */ +#undef CFG_FLASH_CHECKSUM +#define CFG_FLASH_ERASE_TOUT 60000 /* Flash Erase Timeout (ms) */ +#define CFG_FLASH_WRITE_TOUT 500 /* Flash Write Timeout (ms) */ + +#define CFG_MONITOR_BASE TEXT_BASE /* start of monitor */ + +#define CFG_FLASH_CFI_DRIVER +#define CFG_FLASH_CFI +#define CFG_FLASH_EMPTY_INFO + +#define CFG_LBC_NONCACHE_BASE 0xf8000000 + +#define CFG_BR2_PRELIM 0xf8201001 /* port size 16bit */ +#define CFG_OR2_PRELIM 0xfff06ff7 /* 1MB Compact Flash area*/ + +#define CFG_BR3_PRELIM 0xf8100801 /* port size 8bit */ +#define CFG_OR3_PRELIM 0xfff06ff7 /* 1MB PIXIS area*/ + +#define PIXIS_BASE 0xf8100000 /* PIXIS registers */ +#define PIXIS_ID 0x0 /* Board ID at offset 0 */ +#define PIXIS_VER 0x1 /* Board version at offset 1 */ +#define PIXIS_PVER 0x2 /* PIXIS FPGA version at offset 2 */ +#define PIXIS_RST 0x4 /* PIXIS Reset Control register */ +#define PIXIS_AUX 0x6 /* PIXIS Auxiliary register; Scratch + * register */ +#define PIXIS_SPD 0x7 /* Register for SYSCLK speed */ +#define PIXIS_VCTL 0x10 /* VELA Control Register */ +#define PIXIS_VCFGEN0 0x12 /* VELA Config Enable 0 */ +#define PIXIS_VCFGEN1 0x13 /* VELA Config Enable 1 */ +#define PIXIS_VBOOT 0x16 /* VELA VBOOT Register */ +#define PIXIS_VSPEED0 0x17 /* VELA VSpeed 0 */ +#define PIXIS_VSPEED1 0x18 /* VELA VSpeed 1 */ +#define PIXIS_VCLKH 0x19 /* VELA VCLKH register */ +#define PIXIS_VCLKL 0x1A /* VELA VCLKL register */ + + +/* define to use L1 as initial stack */ +#define CONFIG_L1_INIT_RAM 1 +#define CFG_INIT_L1_LOCK 1 +#define CFG_INIT_L1_ADDR 0xf4010000 /* Initial L1 address */ +#define CFG_INIT_L1_END 0x00004000 /* End of used area in RAM */ + +/* define to use L2SRAM as initial stack */ +#undef CONFIG_L2_INIT_RAM +#define CFG_INIT_L2_ADDR 0xf8fc0000 +#define CFG_INIT_L2_END 0x00040000 /* End of used area in RAM */ + +#ifdef CONFIG_L1_INIT_RAM +#define CFG_INIT_RAM_ADDR CFG_INIT_L1_ADDR +#define CFG_INIT_RAM_END CFG_INIT_L1_END +#else +#define CFG_INIT_RAM_ADDR CFG_INIT_L2_ADDR +#define CFG_INIT_RAM_END CFG_INIT_L2_END +#endif + +#define CFG_GBL_DATA_SIZE 128 /* num bytes initial data */ +#define CFG_GBL_DATA_OFFSET (CFG_INIT_RAM_END - CFG_GBL_DATA_SIZE) +#define CFG_INIT_SP_OFFSET CFG_GBL_DATA_OFFSET + +#define CFG_MONITOR_LEN (256 * 1024) /* Reserve 256 kB for Mon */ +#define CFG_MALLOC_LEN (128 * 1024) /* Reserved for malloc */ + +/* Serial Port - controlled on board with jumper J8 + * open - index 2 + * shorted - index 1 + */ +#define CONFIG_CONS_INDEX 1 +#undef CONFIG_SERIAL_SOFTWARE_FIFO +#define CFG_NS16550 +#define CFG_NS16550_SERIAL +#define CFG_NS16550_REG_SIZE 1 +#define CFG_NS16550_CLK get_bus_freq(0) + +#define CFG_BAUDRATE_TABLE \ + {300, 600, 1200, 2400, 4800, 9600, 19200, 38400,115200} + +#define CFG_NS16550_COM1 (CFG_CCSRBAR+0x4500) +#define CFG_NS16550_COM2 (CFG_CCSRBAR+0x4600) + +/* Use the HUSH parser */ +#define CFG_HUSH_PARSER +#ifdef CFG_HUSH_PARSER +#define CFG_PROMPT_HUSH_PS2 "> " +#endif + +/* pass open firmware flat tree */ +#define CONFIG_OF_FLAT_TREE 1 +#define CONFIG_OF_BOARD_SETUP 1 + +/* maximum size of the flat tree (8K) */ +#define OF_FLAT_TREE_MAX_SIZE 8192 + +#define OF_CPU "PowerPC,8544@0" +#define OF_SOC "soc8544@e0000000" +#define OF_TBCLK (bd->bi_busfreq / 8) +#define OF_STDOUT_PATH "/soc8544@e0000000/serial@4500" + +/* I2C */ +#define CONFIG_FSL_I2C /* Use FSL common I2C driver */ +#define CONFIG_HARD_I2C /* I2C with hardware support */ +#undef CONFIG_SOFT_I2C /* I2C bit-banged */ +#define CFG_I2C_SPEED 400000 /* I2C speed and slave address */ +#define CFG_I2C_EEPROM_ADDR 0x57 +#define CFG_I2C_SLAVE 0x7F +#define CFG_I2C_NOPROBES {0x69} /* Don't probe these addrs */ +#define CFG_I2C_OFFSET 0x3100 + +/* + * General PCI + * Memory space is mapped 1-1, but I/O space must start from 0. + */ +#define CFG_PCIE_PHYS 0x80000000 /* 1G PCIE TLB */ +#define CFG_PCI_PHYS 0xc0000000 /* 512M PCI TLB */ + +#define CFG_PCI1_MEM_BASE 0xc0000000 +#define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE +#define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI1_IO_BASE 0x00000000 +#define CFG_PCI1_IO_PHYS 0xe1000000 +#define CFG_PCI1_IO_SIZE 0x00100000 /* 1M */ + +/* PCI view of System Memory */ +#define CFG_PCI_MEMORY_BUS 0x00000000 +#define CFG_PCI_MEMORY_PHYS 0x00000000 +#define CFG_PCI_MEMORY_SIZE 0x80000000 + +/* controller 2, Slot 1, tgtid 1, Base address 9000 */ +#define CFG_PCIE2_MEM_BASE 0x80000000 +#define CFG_PCIE2_MEM_PHYS CFG_PCIE2_MEM_BASE +#define CFG_PCIE2_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCIE2_IO_BASE 0x00000000 +#define CFG_PCIE2_IO_PHYS 0xe2000000 +#define CFG_PCIE2_IO_SIZE 0x00100000 /* 1M */ + +/* controller 1, Slot 2,tgtid 2, Base address a000 */ +#define CFG_PCIE1_MEM_BASE 0xa0000000 +#define CFG_PCIE1_MEM_PHYS CFG_PCIE1_MEM_BASE +#define CFG_PCIE1_MEM_SIZE 0x08000000 /* 128M */ +#define CFG_PCIE1_MEM_BASE2 0xa8000000 +#define CFG_PCIE1_MEM_PHYS2 CFG_PCIE1_MEM_BASE2 +#define CFG_PCIE1_MEM_SIZE2 0x04000000 /* 64M */ +#define CFG_PCIE1_IO_BASE 0x00000000 /* reuse mem LAW */ +#define CFG_PCIE1_IO_PHYS 0xaf000000 +#define CFG_PCIE1_IO_SIZE 0x00100000 /* 1M */ + +/* controller 3, direct to uli, tgtid 3, Base address b000 */ +#define CFG_PCIE3_MEM_BASE 0xb0000000 +#define CFG_PCIE3_MEM_PHYS CFG_PCIE3_MEM_BASE +#define CFG_PCIE3_MEM_SIZE 0x10000000 /* 256M */ +#define CFG_PCIE3_IO_BASE 0x00000000 +#define CFG_PCIE3_IO_PHYS 0xe3000000 +#define CFG_PCIE3_IO_SIZE 0x00100000 /* 1M */ + +#if defined(CONFIG_PCI) + +#define CONFIG_NET_MULTI +#define CONFIG_PCI_PNP /* do pci plug-and-play */ + +#undef CONFIG_EEPRO100 +#undef CONFIG_TULIP +#define CONFIG_RTL8139 + +#ifdef CONFIG_RTL8139 +/* This macro is used by RTL8139 but not defined in PPC architecture */ +#define KSEG1ADDR(x) (x) +#define _IO_BASE 0x00000000 +#endif + +#ifndef CONFIG_PCI_PNP + #define PCI_ENET0_IOADDR CFG_PCI1_IO_BASE + #define PCI_ENET0_MEMADDR CFG_PCI1_IO_BASE + #define PCI_IDSEL_NUMBER 0x11 /* IDSEL = AD11 */ +#endif + +#define CONFIG_PCI_SCAN_SHOW /* show pci devices on startup */ +#define CONFIG_DOS_PARTITION +#define CONFIG_SCSI_AHCI + +#ifdef CONFIG_SCSI_AHCI +#define CONFIG_SATA_ULI5288 +#define CFG_SCSI_MAX_SCSI_ID 4 +#define CFG_SCSI_MAX_LUN 1 +#define CFG_SCSI_MAX_DEVICE (CFG_SCSI_MAX_SCSI_ID * CFG_SCSI_MAX_LUN) +#define CFG_SCSI_MAXDEVICE CFG_SCSI_MAX_DEVICE +#endif /* SCSCI */ + +#endif /* CONFIG_PCI */ + + +#if defined(CONFIG_TSEC_ENET) + +#ifndef CONFIG_NET_MULTI +#define CONFIG_NET_MULTI 1 +#endif + +#define CONFIG_MII 1 /* MII PHY management */ +#define CONFIG_MII_DEFAULT_TSEC 1 /* Allow unregistered phys */ +#define CONFIG_MPC85XX_TSEC1 1 +#define CONFIG_MPC85XX_TSEC1_NAME "eTSEC1" +#define CONFIG_MPC85XX_TSEC3 1 +#define CONFIG_MPC85XX_TSEC3_NAME "eTSEC3" +#undef CONFIG_MPC85XX_FEC + +#define TSEC1_PHY_ADDR 0 +#define TSEC3_PHY_ADDR 1 + +#define TSEC1_PHYIDX 0 +#define TSEC3_PHYIDX 0 + +#define CONFIG_ETHPRIME "eTSEC1" + +#define CONFIG_PHY_GIGE 1 /* Include GbE speed/duplex detection */ + +#endif /* CONFIG_TSEC_ENET */ + +/* + * Environment + */ +#define CFG_ENV_IS_IN_FLASH 1 +#if CFG_MONITOR_BASE > 0xfff80000 +#define CFG_ENV_ADDR 0xfff80000 +#else +#define CFG_ENV_ADDR (CFG_MONITOR_BASE + 0x40000) +#endif +#define CFG_ENV_SIZE 0x2000 +#define CFG_ENV_SECT_SIZE 0x10000 /* 64K (one sector) */ + +#define CONFIG_LOADS_ECHO 1 /* echo on for serial download */ +#define CFG_LOADS_BAUD_CHANGE 1 /* allow baudrate change */ + +#if defined(CONFIG_PCI) +#define CONFIG_COMMANDS (CONFIG_CMD_DFL \ + | CFG_CMD_PCI \ + | CFG_CMD_PING \ + | CFG_CMD_I2C \ + | CFG_CMD_MII \ + | CFG_CMD_BEDBUG \ + | CFG_CMD_NET) +#else +#define CONFIG_COMMANDS (CONFIG_CMD_DFL \ + | CFG_CMD_PING \ + | CFG_CMD_I2C \ + | CFG_CMD_MII) +#endif +#include + +#undef CONFIG_WATCHDOG /* watchdog disabled */ + +/* + * Miscellaneous configurable options + */ +#define CFG_LONGHELP /* undef to save memory */ +#define CFG_LOAD_ADDR 0x2000000 /* default load address */ +#define CFG_PROMPT "=> " /* Monitor Command Prompt */ +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CBSIZE 1024 /* Console I/O Buffer Size */ +#else +#define CFG_CBSIZE 256 /* Console I/O Buffer Size */ +#endif +#define CFG_PBSIZE (CFG_CBSIZE+sizeof(CFG_PROMPT)+16) /* Print Buffer Size */ +#define CFG_MAXARGS 16 /* max number of command args */ +#define CFG_BARGSIZE CFG_CBSIZE /* Boot Argument Buffer Size */ +#define CFG_HZ 1000 /* decrementer freq: 1ms ticks */ + +/* + * For booting Linux, the board info and command line data + * have to be in the first 8 MB of memory, since this is + * the maximum mapped by the Linux kernel during initialization. + */ +#define CFG_BOOTMAPSZ (8 << 20) /* Initial Memory map for Linux*/ + +/* Cache Configuration */ +#define CFG_DCACHE_SIZE 32768 +#define CFG_CACHELINE_SIZE 32 +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CACHELINE_SHIFT 5 /*log base 2 of the above value*/ +#endif + +/* + * Internal Definitions + * + * Boot Flags + */ +#define BOOTFLAG_COLD 0x01 /* Normal Power-On: Boot from FLASH */ +#define BOOTFLAG_WARM 0x02 /* Software reboot */ + +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CONFIG_KGDB_BAUDRATE 230400 /* speed to run kgdb serial port */ +#define CONFIG_KGDB_SER_INDEX 2 /* which serial port to use */ +#endif + +/* + * Environment Configuration + */ + +/* The mac addresses for all ethernet interface */ +#if defined(CONFIG_TSEC_ENET) +#define CONFIG_ETHADDR 00:E0:0C:02:00:FD +#define CONFIG_HAS_ETH1 +#define CONFIG_ETH1ADDR 00:E0:0C:02:01:FD +#define CONFIG_HAS_ETH2 +#define CONFIG_ETH2ADDR 00:E0:0C:02:02:FD +#define CONFIG_HAS_ETH3 +#define CONFIG_ETH3ADDR 00:E0:0C:02:03:FD +#endif + +#define CONFIG_IPADDR 192.168.1.251 + +#define CONFIG_HOSTNAME 8544ds_unknown +#define CONFIG_ROOTPATH /nfs/mpc85xx +#define CONFIG_BOOTFILE 8544ds_tmt/uImage.uboot + +#define CONFIG_SERVERIP 192.168.0.1 +#define CONFIG_GATEWAYIP 192.168.0.1 +#define CONFIG_NETMASK 255.255.0.0 + +#define CONFIG_LOADADDR 1000000 /*default location for tftp and bootm*/ + +#define CONFIG_BOOTDELAY 10 /* -1 disables auto-boot */ +#undef CONFIG_BOOTARGS /* the boot command will set bootargs*/ + +#define CONFIG_BAUDRATE 115200 + +#if defined(CONFIG_PCIE1) || defined(CONFIG_PCIE2) || defined(CONFIG_PCIE3) +#define PCIE_ENV \ + "pciereg=md ${a}000 6; md ${a}020 4; md ${a}bf8 2; echo o;md ${a}c00 25;" \ + "echo i; md ${a}da0 15; echo e;md ${a}e00 e; echo d; md ${a}f00 c\0" \ + "pcie1regs=setenv a e000a; run pciereg\0" \ + "pcie2regs=setenv a e0009; run pciereg\0" \ + "pcie3regs=setenv a e000b; run pciereg\0" \ + "pcieerr=md ${a}020 1; md ${a}e00;" \ + "pci d.b $b.0 7 1; pci d.w $b.0 1e 1;" \ + "pci d.w $b.0 56 1;" \ + "pci d $b.0 104 1;pci d $b.0 110 1;pci d $b.0 130 1\0" \ + "pcieerrc=mw ${a}020 ffffffff; mw ${a}e00 ffffffff;" \ + "pci w.b $b.0 7 ff; pci w.w $b.0 1e ffff; pci w.w $b.0 56 ffff;" \ + "pci w $b.0 104 ffffffff; pci w $b.0 110 ffffffff;" \ + "pci w $b.0 130 ffffffff\0" \ + "pciecfg=pci d $b.0 0 20; pci d $b.0 100 e; pci d $b.0 400 69\0" \ + "pcie1err=setenv a e000a; run pcieerr\0" \ + "pcie2err=setenv a e0009; run pcieerr\0" \ + "pcie3err=setenv a e000b; run pcieerr\0" \ + "pcie1errc=setenv a e000a; run pcieerrc\0" \ + "pcie2errc=setenv a e0009; run pcieerrc\0" \ + "pcie3errc=setenv a e000b; run pcieerrc\0" +#else +#define PCIE_ENV "" +#endif + +#if defined(CONFIG_PCI1) +#define PCI_ENV \ + "pcireg=md ${a}000 3; echo o;md ${a}c00 25; echo i; md ${a}da0 15;" \ + "echo e;md ${a}e00 9\0" \ + "pci1regs=setenv a e0008; run pcireg\0" \ + "pcierr=md ${a}e00 8; pci d.b $b.0 7 1; pci d.w $b.0 1e 1;" \ + "pci d.w $b.0 56 1\0" \ + "pcierrc=mw ${a}e00 ffffffff; pci w.b $b.0 7 ff; pci w.w $b.0 1e ffff;" \ + "pci w.w $b.0 56 ffff\0" \ + "pci1err=setenv a e0008; run pcierr\0" \ + "pci1errc=setenv a e0008; run pcierrc\0" +#else +#define PCI_ENV "" +#endif + +#if defined(CONFIG_TSEC_ENET) +#define ENET_ENV \ + "enetreg1=md ${a}000 2; md ${a}010 9; md ${a}050 4; md ${a}08c 1;" \ + "md ${a}098 2\0" \ + "enetregt=echo t;md ${a}100 6; md ${a}140 2; md ${a}180 10; md ${a}200 10\0" \ + "enetregr=echo r;md ${a}300 6; md ${a}330 5; md ${a}380 10; md ${a}400 10\0" \ + "enetregm=echo mac;md ${a}500 5; md ${a}520 28;echo fifo;md ${a}a00 1;" \ + "echo mib;md ${a}680 31\0" \ + "enetreg=run enetreg1; run enetregm; run enetregt; run enetregr\0" \ + "enet1regs=setenv a e0024; run enetreg\0" \ + "enet3regs=setenv a e0026; run enetreg\0" +#else +#define ENET_ENV "" +#endif + +#define CONFIG_EXTRA_ENV_SETTINGS \ + "netdev=eth0\0" \ + "consoledev=ttyS0\0" \ + "ramdiskaddr=2000000\0" \ + "ramdiskfile=8544ds_tmt/ramdisk.uboot\0" \ + "fdtaddr=400000\0" \ + "fdtfile=8544ds_tmt/mpc8544ds.dtb\0" \ + "eoi=mw e00400b0 0\0" \ + "iack=md e00400a0 1\0" \ + "ddrreg=md ${a}000 8; md ${a}080 8;md ${a}100 d; md ${a}140 4; md ${a}bf0 4;" \ + "md ${a}e00 3; md ${a}e20 3; md ${a}e40 7; md ${a}f00 5\0" \ + "ddrregs=setenv a e0002; run ddrreg\0" \ + "gureg=md ${a}000 2c; md ${a}0b0 1; md ${a}0c0 1; md ${a}b20 3;" \ + "md ${a}e00 1; md ${a}e60 1; md ${a}ef0 15\0" \ + "guregs=setenv a e00e0; run gureg\0" \ + "ecmreg=md ${a}000 1; md ${a}010 1; md ${a}bf8 2; md ${a}e00 6\0" \ + "ecmregs=setenv a e0001; run ecmreg\0" \ + PCIE_ENV \ + PCI_ENV \ + ENET_ENV + + +#define CONFIG_NFSBOOTCOMMAND \ + "setenv bootargs root=/dev/nfs rw " \ + "nfsroot=$serverip:$rootpath " \ + "ip=$ipaddr:$serverip:$gatewayip:$netmask:$hostname:$netdev:off " \ + "console=$consoledev,$baudrate $othbootargs;" \ + "tftp $loadaddr $bootfile;" \ + "tftp $fdtaddr $fdtfile;" \ + "bootm $loadaddr - $fdtaddr" + + +#define CONFIG_RAMBOOTCOMMAND \ + "setenv bootargs root=/dev/ram rw " \ + "console=$consoledev,$baudrate $othbootargs;" \ + "tftp $ramdiskaddr $ramdiskfile;" \ + "tftp $loadaddr $bootfile;" \ + "tftp $fdtaddr $fdtfile;" \ + "bootm $loadaddr $ramdiskaddr $fdtaddr" + +#define CONFIG_BOOTCOMMAND \ + "setenv bootargs root=/dev/sda3 rw " \ + "console=$consoledev,$baudrate $othbootargs;" \ + "tftp $loadaddr $bootfile;" \ + "tftp $fdtaddr $fdtfile;" \ + "bootm $loadaddr - $fdtaddr" + +#endif /* __CONFIG_H */ From 25d83d7f4ac65727182d8ddaf7ba42fa74cf65ae Mon Sep 17 00:00:00 2001 From: Jon Loeliger Date: Wed, 11 Apr 2007 16:51:02 -0500 Subject: [PATCH 15/47] Add MPC8544DS basic port board files. Add board port under new board/freescale directory structure and reuse existing PIXIS FPGA support there. Signed-off-by: Ed Swarthout Signed-off-by: Jon Loeliger --- board/freescale/mpc8544ds/Makefile | 58 ++++++ board/freescale/mpc8544ds/config.mk | 32 ++++ board/freescale/mpc8544ds/init.S | 243 ++++++++++++++++++++++++++ board/freescale/mpc8544ds/mpc8544ds.c | 205 ++++++++++++++++++++++ board/freescale/mpc8544ds/u-boot.lds | 148 ++++++++++++++++ 5 files changed, 686 insertions(+) create mode 100644 board/freescale/mpc8544ds/Makefile create mode 100644 board/freescale/mpc8544ds/config.mk create mode 100644 board/freescale/mpc8544ds/init.S create mode 100644 board/freescale/mpc8544ds/mpc8544ds.c create mode 100644 board/freescale/mpc8544ds/u-boot.lds diff --git a/board/freescale/mpc8544ds/Makefile b/board/freescale/mpc8544ds/Makefile new file mode 100644 index 000000000..bec216863 --- /dev/null +++ b/board/freescale/mpc8544ds/Makefile @@ -0,0 +1,58 @@ +# +# Copyright 2007 Freescale Semiconductor, Inc. +# (C) Copyright 2001-2006 +# Wolfgang Denk, DENX Software Engineering, wd@denx.de. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +include $(TOPDIR)/config.mk + +# ifneq ($(OBJTREE),$(SRCTREE)) +# $(shell mkdir -p $(obj)./common) +# endif + +LIB = $(obj)lib$(BOARD).a + +COBJS := $(BOARD).o \ + ../common/pixis.o + +SOBJS := init.o + +SRCS := $(SOBJS:.o=.S) $(COBJS:.o=.c) +OBJS := $(addprefix $(obj),$(COBJS)) +SOBJS := $(addprefix $(obj),$(SOBJS)) + +$(LIB): $(obj).depend $(OBJS) $(SOBJS) + $(AR) crv $@ $(OBJS) + +clean: + rm -f $(OBJS) $(SOBJS) + +distclean: clean + rm -f $(LIB) core *.bak .depend + +######################################################################### + +# defines $(obj).depend target +include $(SRCTREE)/rules.mk + +sinclude $(obj).depend + +######################################################################### diff --git a/board/freescale/mpc8544ds/config.mk b/board/freescale/mpc8544ds/config.mk new file mode 100644 index 000000000..85663ef02 --- /dev/null +++ b/board/freescale/mpc8544ds/config.mk @@ -0,0 +1,32 @@ +# +# Copyright 2007 Freescale Semiconductor, Inc. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +# +# mpc8544ds board +# +ifndef TEXT_BASE +TEXT_BASE = 0xfff80000 +endif + +PLATFORM_CPPFLAGS += -DCONFIG_E500=1 +PLATFORM_CPPFLAGS += -DCONFIG_MPC85xx=1 +PLATFORM_CPPFLAGS += -DCONFIG_MPC8544=1 diff --git a/board/freescale/mpc8544ds/init.S b/board/freescale/mpc8544ds/init.S new file mode 100644 index 000000000..296fee5e6 --- /dev/null +++ b/board/freescale/mpc8544ds/init.S @@ -0,0 +1,243 @@ +/* + * Copyright 2007 Freescale Semiconductor, Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include +#include +#include +#include +#include +#include + +#define LAWAR_TRGT_PCI1 0x00000000 +#define LAWAR_TRGT_PCIE1 0x00200000 +#define LAWAR_TRGT_PCIE2 0x00100000 +#define LAWAR_TRGT_PCIE3 0x00300000 +#define LAWAR_TRGT_LBC 0x00400000 +#define LAWAR_TRGT_DDR 0x00f00000 + +/* + * TLB0 and TLB1 Entries + * + * Out of reset, TLB1's Entry 0 maps the highest 4K for CCSRBAR. + * However, CCSRBAR is then relocated to CFG_CCSRBAR right after + * these TLB entries are established. + * + * The TLB entries for DDR are dynamically setup in spd_sdram() + * and use TLB1 Entries 8 through 15 as needed according to the + * size of DDR memory. + * + * MAS0: tlbsel, esel, nv + * MAS1: valid, iprot, tid, ts, tsize + * MAS2: epn, sharen, x0, x1, w, i, m, g, e + * MAS3: rpn, u0-u3, ux, sx, uw, sw, ur, sr + */ + +#define entry_start \ + mflr r1 ; \ + bl 0f ; + +#define entry_end \ +0: mflr r0 ; \ + mtlr r1 ; \ + blr ; + + + .section .bootpg, "ax" + .globl tlb1_entry +tlb1_entry: + entry_start + + /* + * Number of TLB0 and TLB1 entries in the following table + */ + .long (2f-1f)/16 +1: + /* + * TLB0 4K Non-cacheable, guarded + * 0xff700000 4K Initial CCSRBAR mapping + * + * This ends up at a TLB0 Index==0 entry, and must not collide + * with other TLB0 Entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB0 16K Cacheable, guarded + * Temporary Global data for initialization + * + * Use four 4K TLB0 entries. These entries must be cacheable + * as they provide the bootstrap memory before the memory + * controler and real memory have been configured. + * + * These entries end up at TLB0 Indicies 0x10, 0x14, 0x18 and 0x1c, + * and must not collide with other TLB0 entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR), + 0,0,0,0,0,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 4 * 1024), + 0,0,0,0,0,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 4 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024), + 0,0,0,0,0,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 8 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 12 * 1024), + 0,0,0,0,0,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 12 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + + /* + * TLB 0: 64M Non-cacheable, guarded + * 0xfc000000 64M Covers FLASH at 0xFE800000 and 0xFF800000 + * Out of reset this entry is only 4K. + */ + .long TLB1_MAS0(1, 0, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_BOOT_BLOCK), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_BOOT_BLOCK), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 1: 1G Non-cacheable, guarded + * 0x80000000 1G PCIE 8,9,a,b + */ + .long TLB1_MAS0(1, 1, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1G) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCIE_PHYS), + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCIE_PHYS), + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 2: 256M Non-cacheable, guarded + */ + .long TLB1_MAS0(1, 2, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI_PHYS), + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI_PHYS), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 3: 256M Non-cacheable, guarded + */ + .long TLB1_MAS0(1, 3, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI_PHYS + 0x10000000), + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI_PHYS + 0x10000000), + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 4: 64M Non-cacheable, guarded + * 0xe000_0000 1M CCSRBAR + * 0xe100_0000 255M PCI IO range + */ + .long TLB1_MAS0(1, 4, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR), 0,0,0,0,0,1,0,1,0,1) + +#ifdef CFG_LBC_CACHE_BASE + /* + * TLB 5: 64M Cacheable, non-guarded + */ + .long TLB1_MAS0(1, 5, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_CACHE_BASE), 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_CACHE_BASE), 0,0,0,0,0,1,0,1,0,1) +#endif + /* + * TLB 6: 64M Non-cacheable, guarded + * 0xf8000000 64M PIXIS 0xF8000000 - 0xFBFFFFFF + */ + .long TLB1_MAS0(1, 6, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_NONCACHE_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_NONCACHE_BASE), 0,0,0,0,0,1,0,1,0,1) +2: + entry_end + +/* + * LAW(Local Access Window) configuration: + * + * + * Notes: + * CCSRBAR and L2-as-SRAM don't need a configured Local Access Window. + * If flash is 8M at default position (last 8M), no LAW needed. + * + * LAW 0 is reserved for boot mapping + */ + + .section .bootpg, "ax" + .globl law_entry +law_entry: + entry_start + + .long (4f-3f)/8 +3: + .long 0 + .long (LAWAR_TRGT_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN + + .long (CFG_PCI1_MEM_BASE>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M) + + .long (CFG_PCI1_IO_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M) + + .long (CFG_LBC_CACHE_BASE>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M) + + .long (CFG_PCIE1_MEM_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE1 | (LAWAR_SIZE & LAWAR_SIZE_256M) + + /* To keep to 10 LAWs, PCIE1_IO_PHYS must use top of mem region */ + + .long (CFG_PCIE2_MEM_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE2 | (LAWAR_SIZE & LAWAR_SIZE_512M) + + .long (CFG_PCIE2_IO_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE2 | (LAWAR_SIZE & LAWAR_SIZE_16M) + + .long (CFG_PCIE3_MEM_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE3 | (LAWAR_SIZE & LAWAR_SIZE_256M) + + .long (CFG_PCIE3_IO_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE3 | (LAWAR_SIZE & LAWAR_SIZE_16M) +4: + entry_end diff --git a/board/freescale/mpc8544ds/mpc8544ds.c b/board/freescale/mpc8544ds/mpc8544ds.c new file mode 100644 index 000000000..90599348d --- /dev/null +++ b/board/freescale/mpc8544ds/mpc8544ds.c @@ -0,0 +1,205 @@ +/* + * Copyright 2007 Freescale Semiconductor, Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include +#include +#include +#include +#include +#include + +#include "../common/pixis.h" + +#if defined(CONFIG_OF_FLAT_TREE) +#include +extern void ft_cpu_setup(void *blob, bd_t *bd); +#endif + +#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) +extern void ddr_enable_ecc(unsigned int dram_size); +#endif + +extern long int spd_sdram(void); + +void sdram_init(void); + +int board_early_init_f (void) +{ + return 0; +} + +int checkboard (void) +{ + volatile immap_t *immap = (immap_t *) CFG_CCSRBAR; + volatile ccsr_gur_t *gur = &immap->im_gur; + + if ((uint)&gur->porpllsr != 0xe00e0000) { + printf("immap size error %x\n",&gur->porpllsr); + } + printf ("Board: MPC8544DS\n"); + + return 0; +} + +long int +initdram(int board_type) +{ + long dram_size = 0; + + puts("Initializing\n"); + + dram_size = spd_sdram(); + +#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) + /* + * Initialize and enable DDR ECC. + */ + ddr_enable_ecc(dram_size); +#endif + puts(" DDR: "); + return dram_size; +} + + +#if defined(CFG_DRAM_TEST) +int +testdram(void) +{ + uint *pstart = (uint *) CFG_MEMTEST_START; + uint *pend = (uint *) CFG_MEMTEST_END; + uint *p; + + printf("Testing DRAM from 0x%08x to 0x%08x\n", + CFG_MEMTEST_START, + CFG_MEMTEST_END); + + printf("DRAM test phase 1:\n"); + for (p = pstart; p < pend; p++) + *p = 0xaaaaaaaa; + + for (p = pstart; p < pend; p++) { + if (*p != 0xaaaaaaaa) { + printf ("DRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("DRAM test phase 2:\n"); + for (p = pstart; p < pend; p++) + *p = 0x55555555; + + for (p = pstart; p < pend; p++) { + if (*p != 0x55555555) { + printf ("DRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("DRAM test passed.\n"); + return 0; +} +#endif + + + +int last_stage_init(void) +{ + return 0; +} + + +unsigned long +get_board_sys_clk(ulong dummy) +{ + u8 i, go_bit, rd_clks; + ulong val = 0; + + go_bit = in8(PIXIS_BASE + PIXIS_VCTL); + go_bit &= 0x01; + + rd_clks = in8(PIXIS_BASE + PIXIS_VCFGEN0); + rd_clks &= 0x1C; + + /* + * Only if both go bit and the SCLK bit in VCFGEN0 are set + * should we be using the AUX register. Remember, we also set the + * GO bit to boot from the alternate bank on the on-board flash + */ + + if (go_bit) { + if (rd_clks == 0x1c) + i = in8(PIXIS_BASE + PIXIS_AUX); + else + i = in8(PIXIS_BASE + PIXIS_SPD); + } else { + i = in8(PIXIS_BASE + PIXIS_SPD); + } + + i &= 0x07; + + switch (i) { + case 0: + val = 33333333; + break; + case 1: + val = 40000000; + break; + case 2: + val = 50000000; + break; + case 3: + val = 66666666; + break; + case 4: + val = 83000000; + break; + case 5: + val = 100000000; + break; + case 6: + val = 133333333; + break; + case 7: + val = 166666666; + break; + } + + return val; +} + +#if defined(CONFIG_OF_FLAT_TREE) && defined(CONFIG_OF_BOARD_SETUP) +void +ft_board_setup(void *blob, bd_t *bd) +{ + u32 *p; + int len; + + ft_cpu_setup(blob, bd); + + p = ft_get_prop(blob, "/memory/reg", &len); + if (p != NULL) { + *p++ = cpu_to_be32(bd->bi_memstart); + *p = cpu_to_be32(bd->bi_memsize); + } +} +#endif + diff --git a/board/freescale/mpc8544ds/u-boot.lds b/board/freescale/mpc8544ds/u-boot.lds new file mode 100644 index 000000000..1a8aaa905 --- /dev/null +++ b/board/freescale/mpc8544ds/u-boot.lds @@ -0,0 +1,148 @@ +/* + * Copyright 2007 Freescale Semiconductor, Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +OUTPUT_ARCH(powerpc) +SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib); +/* Do we need any of these for elf? + __DYNAMIC = 0; */ +SECTIONS +{ + .resetvec 0xFFFFFFFC : + { + *(.resetvec) + } = 0xffff + + .bootpg 0xFFFFF000 : + { + cpu/mpc85xx/start.o (.bootpg) + board/freescale/mpc8544ds/init.o (.bootpg) + } = 0xffff + + /* Read-only sections, merged into text segment: */ + . = + SIZEOF_HEADERS; + .interp : { *(.interp) } + .hash : { *(.hash) } + .dynsym : { *(.dynsym) } + .dynstr : { *(.dynstr) } + .rel.text : { *(.rel.text) } + .rela.text : { *(.rela.text) } + .rel.data : { *(.rel.data) } + .rela.data : { *(.rela.data) } + .rel.rodata : { *(.rel.rodata) } + .rela.rodata : { *(.rela.rodata) } + .rel.got : { *(.rel.got) } + .rela.got : { *(.rela.got) } + .rel.ctors : { *(.rel.ctors) } + .rela.ctors : { *(.rela.ctors) } + .rel.dtors : { *(.rel.dtors) } + .rela.dtors : { *(.rela.dtors) } + .rel.bss : { *(.rel.bss) } + .rela.bss : { *(.rela.bss) } + .rel.plt : { *(.rel.plt) } + .rela.plt : { *(.rela.plt) } + .init : { *(.init) } + .plt : { *(.plt) } + .text : + { + cpu/mpc85xx/start.o (.text) + board/freescale/mpc8544ds/init.o (.text) + cpu/mpc85xx/traps.o (.text) + cpu/mpc85xx/interrupts.o (.text) + cpu/mpc85xx/cpu_init.o (.text) + cpu/mpc85xx/cpu.o (.text) + cpu/mpc85xx/speed.o (.text) + common/dlmalloc.o (.text) + lib_generic/crc32.o (.text) + lib_ppc/extable.o (.text) + lib_generic/zlib.o (.text) + *(.text) + *(.fixup) + *(.got1) + } + _etext = .; + PROVIDE (etext = .); + .rodata : + { + *(.rodata) + *(.rodata1) + *(.rodata.str1.4) + *(.eh_frame) + } + .fini : { *(.fini) } =0 + .ctors : { *(.ctors) } + .dtors : { *(.dtors) } + + /* Read-write section, merged into data segment: */ + . = (. + 0x00FF) & 0xFFFFFF00; + _erotext = .; + PROVIDE (erotext = .); + .reloc : + { + *(.got) + _GOT2_TABLE_ = .; + *(.got2) + _FIXUP_TABLE_ = .; + *(.fixup) + } + __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2; + __fixup_entries = (. - _FIXUP_TABLE_) >> 2; + + .data : + { + *(.data) + *(.data1) + *(.sdata) + *(.sdata2) + *(.dynamic) + CONSTRUCTORS + } + _edata = .; + PROVIDE (edata = .); + + . = .; + __u_boot_cmd_start = .; + .u_boot_cmd : { *(.u_boot_cmd) } + __u_boot_cmd_end = .; + + . = .; + __start___ex_table = .; + __ex_table : { *(__ex_table) } + __stop___ex_table = .; + + . = ALIGN(256); + __init_begin = .; + .text.init : { *(.text.init) } + .data.init : { *(.data.init) } + . = ALIGN(256); + __init_end = .; + + __bss_start = .; + .bss : + { + *(.sbss) *(.scommon) + *(.dynbss) + *(.bss) + *(COMMON) + } + _end = . ; + PROVIDE (end = .); +} From 151d5d992eab8c497b24c816c73dc1ad8bffb4eb Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Mon, 23 Apr 2007 01:32:22 -0500 Subject: [PATCH 16/47] Add cpu support for the 8544 Recognize new SVR values, and add a few register definitions Signed-off-by: Ed Swarthout Signed-off-by: Jon Loeliger Acked-by: Andy Fleming --- cpu/mpc85xx/cpu.c | 10 ++++++++-- 1 file changed, 8 insertions(+), 2 deletions(-) diff --git a/cpu/mpc85xx/cpu.c b/cpu/mpc85xx/cpu.c index 2fe4f2abb..2fe6bdf4b 100644 --- a/cpu/mpc85xx/cpu.c +++ b/cpu/mpc85xx/cpu.c @@ -1,5 +1,5 @@ /* - * Copyright 2004 Freescale Semiconductor. + * Copyright 2004,2007 Freescale Semiconductor, Inc. * (C) Copyright 2002, 2003 Motorola Inc. * Xianghua Xiao (X.Xiao@motorola.com) * @@ -70,6 +70,12 @@ int checkcpu (void) case SVR_8548_E: puts("8548_E"); break; + case SVR_8544: + puts("8544"); + break; + case SVR_8544_E: + puts("8544_E"); + break; default: puts("Unknown"); break; @@ -112,7 +118,7 @@ int checkcpu (void) #endif clkdiv = lcrr & 0x0f; if (clkdiv == 2 || clkdiv == 4 || clkdiv == 8) { -#ifdef CONFIG_MPC8548 +#if defined(CONFIG_MPC8548) || defined(CONFIG_MPC8544) /* * Yes, the entire PQ38 family use the same * bit-representation for twice the clock divider values. From 03b81b48eec0ad249ec97a4ae16c36fa2e014ff4 Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Mon, 23 Apr 2007 01:44:44 -0500 Subject: [PATCH 17/47] Some 85xx cpu cleanups * Cleaned up the TSR[WIS] clearing * Cleaned up DMA initialization Signed-off-by: Ed Swarthout Signed-off-by: Jon Loeliger Acked-by: Andy Fleming --- cpu/mpc85xx/cpu.c | 11 ++++++++--- 1 file changed, 8 insertions(+), 3 deletions(-) diff --git a/cpu/mpc85xx/cpu.c b/cpu/mpc85xx/cpu.c index 2fe6bdf4b..b701b477b 100644 --- a/cpu/mpc85xx/cpu.c +++ b/cpu/mpc85xx/cpu.c @@ -198,9 +198,9 @@ reset_85xx_watchdog(void) * Clear TSR(WIS) bit by writing 1 */ unsigned long val; - val = mfspr(tsr); - val |= 0x40000000; - mtspr(tsr, val); + val = mfspr(SPRN_TSR); + val |= TSR_WIS; + mtspr(SPRN_TSR, val); } #endif /* CONFIG_WATCHDOG */ @@ -211,6 +211,7 @@ void dma_init(void) { dma->satr0 = 0x02c40000; dma->datr0 = 0x02c40000; + dma->sr0 = 0xfffffff; /* clear any errors */ asm("sync; isync; msync"); return; } @@ -225,6 +226,10 @@ uint dma_check(void) { status = dma->sr0; } + /* clear MR0[CS] channel start bit */ + dma->mr0 &= 0x00000001; + asm("sync;isync;msync"); + if (status != 0) { printf ("DMA Error: status = %x\n", status); } From 85e7c7a45e3dd9c7ce3e722352ba60f8df1a7a4b Mon Sep 17 00:00:00 2001 From: Timur Tabi Date: Mon, 12 Feb 2007 13:34:55 -0600 Subject: [PATCH 18/47] 85xx: write MAC address to mac-address and local-mac-address Some device trees have a mac-address property, some have local-mac-address, and some have both. To support all of these device trees, ftp_cpu_setup() should write the MAC address to mac-address and local-mac-address, if they exist. Signed-off-by: Timur Tabi --- cpu/mpc85xx/cpu.c | 20 ++++++++++++++++++++ 1 file changed, 20 insertions(+) diff --git a/cpu/mpc85xx/cpu.c b/cpu/mpc85xx/cpu.c index b701b477b..d5102dfdd 100644 --- a/cpu/mpc85xx/cpu.c +++ b/cpu/mpc85xx/cpu.c @@ -275,21 +275,41 @@ ft_cpu_setup(void *blob, bd_t *bd) #if defined(CONFIG_MPC85XX_TSEC1) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/mac-address", &len); + if (p) + memcpy(p, bd->bi_enetaddr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/local-mac-address", &len); + if (p) memcpy(p, bd->bi_enetaddr, 6); #endif #if defined(CONFIG_HAS_ETH1) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/mac-address", &len); + if (p) + memcpy(p, bd->bi_enet1addr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/local-mac-address", &len); + if (p) memcpy(p, bd->bi_enet1addr, 6); #endif #if defined(CONFIG_HAS_ETH2) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/mac-address", &len); + if (p) + memcpy(p, bd->bi_enet2addr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/local-mac-address", &len); + if (p) memcpy(p, bd->bi_enet2addr, 6); #endif #if defined(CONFIG_HAS_ETH3) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/mac-address", &len); + if (p) + memcpy(p, bd->bi_enet3addr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/local-mac-address", &len); + if (p) memcpy(p, bd->bi_enet3addr, 6); #endif From 9343dbf85bc03033f2102d8e8543567c2c1ad2d2 Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Sat, 24 Feb 2007 01:16:45 -0600 Subject: [PATCH 19/47] Tweak DDR ECC error counter Enable single-bit error counter when memory was cleared by ddr controller. Signed-off-by: Ed Swarthout Signed-off-by: Andy Fleming --- cpu/mpc85xx/spd_sdram.c | 7 +++++-- 1 file changed, 5 insertions(+), 2 deletions(-) diff --git a/cpu/mpc85xx/spd_sdram.c b/cpu/mpc85xx/spd_sdram.c index 6da5367a7..4b3c4eb70 100644 --- a/cpu/mpc85xx/spd_sdram.c +++ b/cpu/mpc85xx/spd_sdram.c @@ -786,14 +786,17 @@ spd_sdram(void) * Is this an ECC DDR chip? * But don't mess with it if the DDR controller will init mem. */ -#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) +#ifdef CONFIG_DDR_ECC if (spd.config == 0x02) { +#ifndef CONFIG_ECC_INIT_VIA_DDRCONTROLLER ddr->err_disable = 0x0000000d; +#endif ddr->err_sbe = 0x00ff0000; } + debug("DDR: err_disable = 0x%08x\n", ddr->err_disable); debug("DDR: err_sbe = 0x%08x\n", ddr->err_sbe); -#endif +#endif /* CONFIG_DDR_ECC */ asm("sync;isync;msync"); udelay(500); From 1f9a318cea14272edd10d63739e2d326c90f430e Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Fri, 23 Feb 2007 16:28:46 -0600 Subject: [PATCH 20/47] Only set ddrioovcr for 8548 rev1. Signed-off-by: Ed Swarthout Signed-off-by: Andy Fleming --- cpu/mpc85xx/spd_sdram.c | 13 +++++++------ 1 file changed, 7 insertions(+), 6 deletions(-) diff --git a/cpu/mpc85xx/spd_sdram.c b/cpu/mpc85xx/spd_sdram.c index 4b3c4eb70..16a697d40 100644 --- a/cpu/mpc85xx/spd_sdram.c +++ b/cpu/mpc85xx/spd_sdram.c @@ -263,13 +263,14 @@ spd_sdram(void) } /* - * Adjust DDR II IO voltage biasing. It just makes it work. + * Adjust DDR II IO voltage biasing. + * Only 8548 rev 1 needs the fix */ - if (spd.mem_type == SPD_MEMTYPE_DDR2) { - gur->ddrioovcr = (0 - | 0x80000000 /* Enable */ - | 0x10000000 /* VSEL to 1.8V */ - ); + if ((SVR_VER(get_svr()) == SVR_8548_E) && + (SVR_MJREV(get_svr()) == 1) && + (spd.mem_type == SPD_MEMTYPE_DDR2)) { + gur->ddrioovcr = (0x80000000 /* Enable */ + | 0x10000000);/* VSEL to 1.8V */ } /* From 45cef612cc601d2d1c890fbbd7cdc9609a189a46 Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Fri, 23 Feb 2007 17:11:16 -0600 Subject: [PATCH 21/47] Changed BOOKE_PAGESZ_nGB to BOOKE_PAGESZ_nG The other pagesz constants use one letter to specify order of magnitude. Also change the one reference to it in mpc8548cds/init.S Signed-off-by: Andy Fleming --- board/cds/mpc8548cds/init.S | 2 +- include/asm-ppc/mmu.h | 4 ++-- 2 files changed, 3 insertions(+), 3 deletions(-) diff --git a/board/cds/mpc8548cds/init.S b/board/cds/mpc8548cds/init.S index 2c15debd4..34ca711bd 100644 --- a/board/cds/mpc8548cds/init.S +++ b/board/cds/mpc8548cds/init.S @@ -161,7 +161,7 @@ tlb1_entry: * 0xd0000000 256M Rapid IO MEM Second half */ .long TLB1_MAS0(1, 3, 0) - .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1GB) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1G) .long TLB1_MAS2(E500_TLB_EPN(CFG_PEX_MEM_BASE), 0,0,0,0,1,0,1,0) .long TLB1_MAS3(E500_TLB_RPN(CFG_PEX_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) diff --git a/include/asm-ppc/mmu.h b/include/asm-ppc/mmu.h index 67c2c571e..48fd98295 100644 --- a/include/asm-ppc/mmu.h +++ b/include/asm-ppc/mmu.h @@ -396,8 +396,8 @@ extern int write_bat(ppc_bat_t bat, unsigned long upper, unsigned long lower); #define BOOKE_PAGESZ_16M 7 #define BOOKE_PAGESZ_64M 8 #define BOOKE_PAGESZ_256M 9 -#define BOOKE_PAGESZ_1GB 10 -#define BOOKE_PAGESZ_4GB 11 +#define BOOKE_PAGESZ_1G 10 +#define BOOKE_PAGESZ_4G 11 #if defined(CONFIG_MPC86xx) #define LAWBAR_BASE_ADDR 0x00FFFFFF From 0d8c3a2096eaff8d7de89d45e9af4d4b0d4868fe Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Fri, 23 Feb 2007 17:12:25 -0600 Subject: [PATCH 22/47] Support 1G size on 8548 e500v2 and newer cores support 1G page sizes. Signed-off-by: Ed Swarthout Signed-off-by: Andy Fleming --- cpu/mpc85xx/spd_sdram.c | 11 +++++++++-- 1 file changed, 9 insertions(+), 2 deletions(-) diff --git a/cpu/mpc85xx/spd_sdram.c b/cpu/mpc85xx/spd_sdram.c index 16a697d40..3777f49ad 100644 --- a/cpu/mpc85xx/spd_sdram.c +++ b/cpu/mpc85xx/spd_sdram.c @@ -995,17 +995,24 @@ setup_laws_and_tlbs(unsigned int memsize) break; case 256: case 512: + tlb_size = BOOKE_PAGESZ_256M; + break; case 1024: case 2048: - tlb_size = BOOKE_PAGESZ_256M; + if (PVR_VER(get_pvr()) > PVR_VER(PVR_85xx)) + tlb_size = BOOKE_PAGESZ_1G; + else + tlb_size = BOOKE_PAGESZ_256M; break; default: puts("DDR: only 16M,32M,64M,128M,256M,512M,1G and 2G are supported.\n"); /* * The memory was not able to be mapped. + * Default to a small size. */ - return 0; + tlb_size = BOOKE_PAGESZ_64M; + memsize=64; break; } From 81f481ca708ed6a56bf9c410e3191dbad581c565 Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Mon, 23 Apr 2007 02:24:28 -0500 Subject: [PATCH 23/47] Enable 8544 support * Add support to the Makefile * Add 8544 configuration support to the tsec driver * Add 8544 SVR numbers to processor.h Signed-off-by: Ed Swarthout Signed-off-by: Jon Loeliger --- MAKEALL | 8 ++++---- Makefile | 3 +++ drivers/tsec.c | 6 +++++- drivers/tsec.h | 3 ++- include/asm-ppc/processor.h | 11 +++++++++-- 5 files changed, 23 insertions(+), 8 deletions(-) diff --git a/MAKEALL b/MAKEALL index 0f0ec296f..59aec2867 100755 --- a/MAKEALL +++ b/MAKEALL @@ -142,10 +142,10 @@ LIST_83xx=" \ ######################################################################### LIST_85xx=" \ - MPC8540ADS MPC8540EVAL MPC8541CDS MPC8548CDS \ - MPC8555CDS MPC8560ADS PM854 PM856 \ - sbc8540 sbc8560 stxgp3 TQM8540 \ - TQM8541 TQM8555 TQM8560 \ + MPC8540ADS MPC8540EVAL MPC8541CDS MPC8544DS \ + MPC8548CDS MPC8555CDS MPC8560ADS PM854 \ + PM856 sbc8540 sbc8560 stxgp3 \ + TQM8540 TQM8541 TQM8555 TQM8560 \ " ######################################################################### diff --git a/Makefile b/Makefile index 94cda54c7..d447a9610 100644 --- a/Makefile +++ b/Makefile @@ -1730,6 +1730,9 @@ MPC8560ADS_config: unconfig MPC8541CDS_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8541cds cds +MPC8544DS_config: unconfig + @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8544ds freescale + MPC8548CDS_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8548cds cds diff --git a/drivers/tsec.c b/drivers/tsec.c index 3f11eb03b..ed35f227c 100644 --- a/drivers/tsec.c +++ b/drivers/tsec.c @@ -5,7 +5,7 @@ * terms of the GNU Public License, Version 2, incorporated * herein by reference. * - * Copyright 2004 Freescale Semiconductor. + * Copyright 2004, 2007 Freescale Semiconductor, Inc. * (C) Copyright 2003, Motorola, Inc. * author Andy Fleming * @@ -66,7 +66,11 @@ struct tsec_info_struct { */ static struct tsec_info_struct tsec_info[] = { #if defined(CONFIG_MPC85XX_TSEC1) || defined(CONFIG_MPC83XX_TSEC1) +#if defined(CONFIG_MPC8544DS) + {TSEC1_PHY_ADDR, TSEC_GIGABIT | TSEC_REDUCED, TSEC1_PHYIDX}, +#else {TSEC1_PHY_ADDR, TSEC_GIGABIT, TSEC1_PHYIDX}, +#endif #elif defined(CONFIG_MPC86XX_TSEC1) {TSEC1_PHY_ADDR, TSEC_GIGABIT | TSEC_REDUCED, TSEC1_PHYIDX}, #else diff --git a/drivers/tsec.h b/drivers/tsec.h index 422bc6692..7bf3dee2b 100644 --- a/drivers/tsec.h +++ b/drivers/tsec.h @@ -7,7 +7,7 @@ * terms of the GNU Public License, Version 2, incorporated * herein by reference. * - * Copyright 2004 Freescale Semiconductor. + * Copyright 2004, 2007 Freescale Semiconductor, Inc. * (C) Copyright 2003, Motorola, Inc. * maintained by Xianghua Xiao (x.xiao@motorola.com) * author Andy Fleming @@ -65,6 +65,7 @@ #define ECNTRL_INIT_SETTINGS 0x00001000 #define ECNTRL_TBI_MODE 0x00000020 #define ECNTRL_R100 0x00000008 +#define ECNTRL_SGMII_MODE 0x00000002 #define miim_end -2 #define miim_read -1 diff --git a/include/asm-ppc/processor.h b/include/asm-ppc/processor.h index 058596275..944cbe90c 100644 --- a/include/asm-ppc/processor.h +++ b/include/asm-ppc/processor.h @@ -232,6 +232,9 @@ #define HID0_BHTE (1<<2) /* Branch History Table Enable */ #define HID0_BTCD (1<<1) /* Branch target cache disable */ #define SPRN_HID1 0x3F1 /* Hardware Implementation Register 1 */ +#define HID1_RFXE (1<<17) /* Read Fault Exception Enable */ +#define HID1_ASTME (1<<13) /* Address bus streaming mode */ +#define HID1_ABE (1<<12) /* Address broadcast enable */ #define SPRN_IABR 0x3F2 /* Instruction Address Breakpoint Register */ #ifndef CONFIG_BOOKE #define SPRN_IAC1 0x3F4 /* Instruction Address Compare 1 */ @@ -415,10 +418,12 @@ #define SPRN_IVOR15 0x19f /* Interrupt Vector Offset Register 15 */ /* e500 definitions */ -#define SPRN_L1CSR0 0x3f2 /* L1 Cache Control and Status Register 0 */ +#define SPRN_L1CSR0 0x3f2 /* L1 Data Cache Control and Status Register 0 */ +#define L1CSR0_CPE 0x00010000 /* Data Cache Parity Enable */ #define L1CSR0_DCFI 0x00000002 /* Data Cache Flash Invalidate */ #define L1CSR0_DCE 0x00000001 /* Data Cache Enable */ -#define SPRN_L1CSR1 0x3f3 /* L1 Cache Control and Status Register 1 */ +#define SPRN_L1CSR1 0x3f3 /* L1 Instruction Cache Control and Status Register 1 */ +#define L1CSR1_CPE 0x00010000 /* Instruction Cache Parity Enable */ #define L1CSR1_ICFI 0x00000002 /* Instruction Cache Flash Invalidate */ #define L1CSR1_ICE 0x00000001 /* Instruction Cache Enable */ @@ -840,6 +845,8 @@ #define SVR_8560 0x8070 #define SVR_8555 0x8079 #define SVR_8541 0x807A +#define SVR_8544 0x8034 +#define SVR_8544_E 0x803C #define SVR_8548 0x8031 #define SVR_8548_E 0x8039 #define SVR_8641 0x8090 From 66ed6cca3f340f7a8a06d9272ae2ef8e96f0273d Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Mon, 23 Apr 2007 02:37:47 -0500 Subject: [PATCH 24/47] Reworked 85xx speed detection code Changed the code to read the registers and calculate the clock rates, rather than using a "switch" statement. Idea from Andrew Klossner Signed-off-by: Andy Fleming --- cpu/mpc85xx/speed.c | 44 ++++++++------------------------------------ 1 file changed, 8 insertions(+), 36 deletions(-) diff --git a/cpu/mpc85xx/speed.c b/cpu/mpc85xx/speed.c index ca81ee735..12359a2d6 100644 --- a/cpu/mpc85xx/speed.c +++ b/cpu/mpc85xx/speed.c @@ -37,49 +37,21 @@ void get_sys_info (sys_info_t * sysInfo) { volatile immap_t *immap = (immap_t *)CFG_IMMR; volatile ccsr_gur_t *gur = &immap->im_gur; - uint plat_ratio,e500_ratio; + uint plat_ratio,e500_ratio,half_freqSystemBus; plat_ratio = (gur->porpllsr) & 0x0000003e; plat_ratio >>= 1; - switch(plat_ratio) { - case 0x02: - case 0x03: - case 0x04: - case 0x05: - case 0x06: - case 0x08: - case 0x09: - case 0x0a: - case 0x0c: - case 0x10: - sysInfo->freqSystemBus = plat_ratio * CONFIG_SYS_CLK_FREQ; - break; - default: - sysInfo->freqSystemBus = 0; - break; - } - + sysInfo->freqSystemBus = plat_ratio * CONFIG_SYS_CLK_FREQ; e500_ratio = (gur->porpllsr) & 0x003f0000; e500_ratio >>= 16; - switch(e500_ratio) { - case 0x04: - sysInfo->freqProcessor = 2*sysInfo->freqSystemBus; - break; - case 0x05: - sysInfo->freqProcessor = 5*sysInfo->freqSystemBus/2; - break; - case 0x06: - sysInfo->freqProcessor = 3*sysInfo->freqSystemBus; - break; - case 0x07: - sysInfo->freqProcessor = 7*sysInfo->freqSystemBus/2; - break; - default: - sysInfo->freqProcessor = 0; - break; - } + + /* Divide before multiply to avoid integer + * overflow for processor speeds above 2GHz */ + half_freqSystemBus = sysInfo->freqSystemBus/2; + sysInfo->freqProcessor = e500_ratio*half_freqSystemBus; } + int get_clocks (void) { sys_info_t sys_info; From 37ed6cdd4159195bfad68d8a237f6adda8f482cb Mon Sep 17 00:00:00 2001 From: Matthias Fuchs Date: Tue, 24 Apr 2007 14:03:45 +0200 Subject: [PATCH 25/47] ppc4xx: setup 440EPx/GRx ZMII/RGMII bridge depending on PFC register content. Signed-off-by: Matthias Fuchs --- cpu/ppc4xx/4xx_enet.c | 30 +++++++++++++++++++++--------- 1 file changed, 21 insertions(+), 9 deletions(-) diff --git a/cpu/ppc4xx/4xx_enet.c b/cpu/ppc4xx/4xx_enet.c index cf56581d8..be4e82405 100644 --- a/cpu/ppc4xx/4xx_enet.c +++ b/cpu/ppc4xx/4xx_enet.c @@ -339,29 +339,41 @@ int ppc_4xx_eth_setup_bridge(int devnum, bd_t * bis) int ppc_4xx_eth_setup_bridge(int devnum, bd_t * bis) { unsigned long zmiifer=0x0; + unsigned long pfc1; - /* - * Right now only 2*RGMII is supported. Please extend when needed. - * sr - 2006-08-29 - */ - switch (1) { - case 0: + mfsdr(sdr_pfc1, pfc1); + pfc1 &= SDR0_PFC1_SELECT_MASK; + + switch (pfc1) { + case SDR0_PFC1_SELECT_CONFIG_2: /* 1 x GMII port */ out32 (ZMII_FER, 0x00); out32 (RGMII_FER, 0x00000037); bis->bi_phymode[0] = BI_PHYMODE_GMII; bis->bi_phymode[1] = BI_PHYMODE_NONE; break; - case 1: + case SDR0_PFC1_SELECT_CONFIG_4: /* 2 x RGMII ports */ out32 (ZMII_FER, 0x00); out32 (RGMII_FER, 0x00000055); bis->bi_phymode[0] = BI_PHYMODE_RGMII; bis->bi_phymode[1] = BI_PHYMODE_RGMII; break; - case 2: + case SDR0_PFC1_SELECT_CONFIG_6: /* 2 x SMII ports */ - + out32 (ZMII_FER, + ((ZMII_FER_SMII) << ZMII_FER_V(0)) | + ((ZMII_FER_SMII) << ZMII_FER_V(1))); + out32 (RGMII_FER, 0x00000000); + bis->bi_phymode[0] = BI_PHYMODE_SMII; + bis->bi_phymode[1] = BI_PHYMODE_SMII; + break; + case SDR0_PFC1_SELECT_CONFIG_1_2: + /* only 1 x MII supported */ + out32 (ZMII_FER, (ZMII_FER_MII) << ZMII_FER_V(0)); + out32 (RGMII_FER, 0x00000000); + bis->bi_phymode[0] = BI_PHYMODE_MII; + bis->bi_phymode[1] = BI_PHYMODE_NONE; break; default: break; From 8b39501d28754e72726ce7fb02310e56dbdf116a Mon Sep 17 00:00:00 2001 From: Stefan Roese Date: Sun, 29 Apr 2007 14:13:01 +0200 Subject: [PATCH 26/47] ppc4xx: Bamboo: Use current NAND driver and *not* the legacy driver Signed-off-by: Stefan Roese --- board/amcc/bamboo/bamboo.c | 81 ------------------------------------ board/amcc/bamboo/u-boot.lds | 14 +------ include/configs/bamboo.h | 67 ++++------------------------- 3 files changed, 8 insertions(+), 154 deletions(-) diff --git a/board/amcc/bamboo/bamboo.c b/board/amcc/bamboo/bamboo.c index b5bb14580..6260b016d 100644 --- a/board/amcc/bamboo/bamboo.c +++ b/board/amcc/bamboo/bamboo.c @@ -277,87 +277,6 @@ int board_early_init_f(void) return 0; } -#if (CONFIG_COMMANDS & CFG_CMD_NAND) -#include -extern struct nand_chip nand_dev_desc[CFG_MAX_NAND_DEVICE]; - -/*----------------------------------------------------------------------------+ - | nand_reset. - | Reset Nand flash - | This routine will abort previous cmd - +----------------------------------------------------------------------------*/ -int nand_reset(ulong addr) -{ - int wait=0, stat=0; - - out8(addr + NAND_CMD_REG, NAND0_CMD_RESET); - out8(addr + NAND_CMD_REG, NAND0_CMD_READ_STATUS); - - while ((stat != 0xc0) && (wait != 0xffff)) { - stat = in8(addr + NAND_DATA_REG); - wait++; - } - - if (stat == 0xc0) { - return 0; - } else { - printf("NAND Reset timeout.\n"); - return -1; - } -} - -void board_nand_set_device(int cs, ulong addr) -{ - /* Set NandFlash Core Configuration Register */ - out32(addr + NAND_CCR_REG, 0x00001000 | (cs << 24)); - - switch (cs) { - case 1: - /* ------- - * NAND0 - * ------- - * K9F1208U0A : 4 addr cyc, 1 col + 3 Row - * Set NDF1CR - Enable External CS1 in NAND FLASH controller - */ - out32(addr + NAND_CR1_REG, 0x80002222); - break; - - case 2: - /* ------- - * NAND1 - * ------- - * K9K2G0B : 5 addr cyc, 2 col + 3 Row - * Set NDF2CR : Enable External CS2 in NAND FLASH controller - */ - out32(addr + NAND_CR2_REG, 0xC0007777); - break; - } - - /* Perform Reset Command */ - if (nand_reset(addr) != 0) - return; -} - -void nand_init(void) -{ - board_nand_set_device(1, CFG_NAND_ADDR); - - nand_probe(CFG_NAND_ADDR); - if (nand_dev_desc[0].ChipID != NAND_ChipID_UNKNOWN) { - print_size(nand_dev_desc[0].totlen, "\n"); - } - -#if 0 /* NAND1 not supported yet */ - board_nand_set_device(2, CFG_NAND2_ADDR); - - nand_probe(CFG_NAND2_ADDR); - if (nand_dev_desc[0].ChipID != NAND_ChipID_UNKNOWN) { - print_size(nand_dev_desc[0].totlen, "\n"); - } -#endif -} -#endif /* (CONFIG_COMMANDS & CFG_CMD_NAND) */ - int checkboard(void) { char *s = getenv("serial#"); diff --git a/board/amcc/bamboo/u-boot.lds b/board/amcc/bamboo/u-boot.lds index 176900ec2..f6d718319 100644 --- a/board/amcc/bamboo/u-boot.lds +++ b/board/amcc/bamboo/u-boot.lds @@ -68,19 +68,7 @@ SECTIONS cpu/ppc4xx/start.o (.text) board/amcc/bamboo/init.o (.text) - cpu/ppc4xx/kgdb.o (.text) - cpu/ppc4xx/traps.o (.text) - cpu/ppc4xx/interrupts.o (.text) - cpu/ppc4xx/serial.o (.text) - cpu/ppc4xx/cpu_init.o (.text) - cpu/ppc4xx/speed.o (.text) - common/dlmalloc.o (.text) - lib_generic/crc32.o (.text) - lib_ppc/extable.o (.text) - lib_generic/zlib.o (.text) - -/* . = env_offset;*/ -/* common/environment.o(.text)*/ + board/amcc/bamboo/bamboo.o (.text) *(.text) *(.fixup) diff --git a/include/configs/bamboo.h b/include/configs/bamboo.h index bcc736ceb..db58a9fa7 100644 --- a/include/configs/bamboo.h +++ b/include/configs/bamboo.h @@ -1,5 +1,5 @@ /* - * (C) Copyright 2005-2006 + * (C) Copyright 2005-2007 * Stefan Roese, DENX Software Engineering, sr@denx.de. * * See file CREDITS for list of people who contributed to this @@ -43,7 +43,6 @@ * 2nd ethernet port you have to "undef" the following define. */ #define CONFIG_BAMBOO_NAND 1 /* enable nand flash support */ -#define CFG_NAND_LEGACY /*----------------------------------------------------------------------- * Base addresses -- Note these are effective addresses where the @@ -143,65 +142,13 @@ #endif /* CFG_ENV_IS_IN_FLASH */ /*----------------------------------------------------------------------- - * NAND-FLASH related + * NAND FLASH *----------------------------------------------------------------------*/ -#define NAND_CMD_REG (0x00) /* NandFlash Command Register */ -#define NAND_ADDR_REG (0x04) /* NandFlash Address Register */ -#define NAND_DATA_REG (0x08) /* NandFlash Data Register */ -#define NAND_ECC0_REG (0x10) /* NandFlash ECC Register0 */ -#define NAND_ECC1_REG (0x14) /* NandFlash ECC Register1 */ -#define NAND_ECC2_REG (0x18) /* NandFlash ECC Register2 */ -#define NAND_ECC3_REG (0x1C) /* NandFlash ECC Register3 */ -#define NAND_ECC4_REG (0x20) /* NandFlash ECC Register4 */ -#define NAND_ECC5_REG (0x24) /* NandFlash ECC Register5 */ -#define NAND_ECC6_REG (0x28) /* NandFlash ECC Register6 */ -#define NAND_ECC7_REG (0x2C) /* NandFlash ECC Register7 */ -#define NAND_CR0_REG (0x30) /* NandFlash Device Bank0 Config Register */ -#define NAND_CR1_REG (0x34) /* NandFlash Device Bank1 Config Register */ -#define NAND_CR2_REG (0x38) /* NandFlash Device Bank2 Config Register */ -#define NAND_CR3_REG (0x3C) /* NandFlash Device Bank3 Config Register */ -#define NAND_CCR_REG (0x40) /* NandFlash Core Configuration Register */ -#define NAND_STAT_REG (0x44) /* NandFlash Device Status Register */ -#define NAND_HWCTL_REG (0x48) /* NandFlash Direct Hwd Control Register */ -#define NAND_REVID_REG (0x50) /* NandFlash Core Revision Id Register */ - -/* Nand Flash K9F1208U0A Command Set => Nand Flash 0 */ -#define NAND0_CMD_READ1_HALF1 0x00 /* Starting addr for 1rst half of registers */ -#define NAND0_CMD_READ1_HALF2 0x01 /* Starting addr for 2nd half of registers */ -#define NAND0_CMD_READ2 0x50 -#define NAND0_CMD_READ_ID 0x90 -#define NAND0_CMD_READ_STATUS 0x70 -#define NAND0_CMD_RESET 0xFF -#define NAND0_CMD_PAGE_PROG 0x80 -#define NAND0_CMD_PAGE_PROG_TRUE 0x10 -#define NAND0_CMD_PAGE_PROG_DUMMY 0x11 -#define NAND0_CMD_BLOCK_ERASE 0x60 -#define NAND0_CMD_BLOCK_ERASE_END 0xD0 - -#define CFG_MAX_NAND_DEVICE 1 /* Max number of NAND devices */ -#define SECTORSIZE 512 - -#define ADDR_COLUMN 1 -#define ADDR_PAGE 2 -#define ADDR_COLUMN_PAGE 3 - -#define NAND_ChipID_UNKNOWN 0x00 -#define NAND_MAX_FLOORS 1 -#define NAND_MAX_CHIPS 1 - -#define WRITE_NAND_COMMAND(d, adr) do {*(volatile u8 *)((ulong)adr+NAND_CMD_REG) = d;} while(0) -#define WRITE_NAND_ADDRESS(d, adr) do {*(volatile u8 *)((ulong)adr+NAND_ADDR_REG) = d;} while(0) -#define WRITE_NAND(d, adr) do {*(volatile u8 *)((ulong)adr+NAND_DATA_REG) = d;} while(0) -#define READ_NAND(adr) (*(volatile u8 *)((ulong)adr+NAND_DATA_REG)) -#define NAND_WAIT_READY(nand) while (!(*(volatile u8 *)((ulong)nand->IO_ADDR+NAND_STAT_REG) & 0x01)) - -/* not needed with 440EP NAND controller */ -#define NAND_CTL_CLRALE(nandptr) -#define NAND_CTL_SETALE(nandptr) -#define NAND_CTL_CLRCLE(nandptr) -#define NAND_CTL_SETCLE(nandptr) -#define NAND_DISABLE_CE(nand) -#define NAND_ENABLE_CE(nand) +#define CFG_MAX_NAND_DEVICE 1 +#define NAND_MAX_CHIPS 1 +#define CFG_NAND_CS 1 +#define CFG_NAND_BASE (CFG_NAND_ADDR + CFG_NAND_CS) +#define CFG_NAND_SELECT_DEVICE 1 /* nand driver supports mutipl. chips */ /*----------------------------------------------------------------------- * DDR SDRAM From c1ab82669d9525998c34e802a12cad662723f22a Mon Sep 17 00:00:00 2001 From: James Yang Date: Fri, 16 Mar 2007 13:02:53 -0500 Subject: [PATCH 27/47] Rewrote picos_to_clk() to avoid rounding errors. Clarified that conversion is to DRAM clocks rather than platform clocks. Made function static to spd_sdram.c. Signed-off-by: James Yang Signed-off-by: Jon Loeliger --- cpu/mpc86xx/spd_sdram.c | 26 +++++++++++++++++++------- 1 file changed, 19 insertions(+), 7 deletions(-) diff --git a/cpu/mpc86xx/spd_sdram.c b/cpu/mpc86xx/spd_sdram.c index ac9ff81ce..f37ab430b 100644 --- a/cpu/mpc86xx/spd_sdram.c +++ b/cpu/mpc86xx/spd_sdram.c @@ -51,20 +51,32 @@ extern int dma_xfer(void *dest, uint count, void *src); #define CFG_SUPER_BANK_INTERLEAVING 0 /* - * Convert picoseconds into clock cycles (rounding up if needed). + * Convert picoseconds into DRAM clock cycles (rounding up if needed). */ -int -picos_to_clk(int picos) +static unsigned int +picos_to_clk(unsigned int picos) { - int clks; + /* use unsigned long long to avoid rounding errors */ + const unsigned long long ULL_2e12 = 2000000000000ULL; + unsigned long long clks; + unsigned long long clks_temp; - clks = picos / (2000000000 / (get_bus_freq(0) / 1000)); - if (picos % (2000000000 / (get_bus_freq(0) / 1000)) != 0) { + if (! picos) + return 0; + + clks = get_bus_freq(0) * (unsigned long long) picos; + clks_temp = clks; + clks = clks / ULL_2e12; + if (clks_temp % ULL_2e12) { clks++; } - return clks; + if (clks > 0xFFFFFFFFULL) { + clks = 0xFFFFFFFFULL; + } + + return (unsigned int) clks; } From a75af9bfd8fff0499efdbb90601cec5a2afef117 Mon Sep 17 00:00:00 2001 From: James Yang Date: Wed, 7 Feb 2007 15:28:04 -0600 Subject: [PATCH 28/47] Conditionalize 8641 Rev1.0 MCM workarounds Signed-off-by: James Yang Signed-off-by: Jon Loeliger --- cpu/mpc86xx/start.S | 42 ++++++++++++++++++++++++++++-------------- include/mpc86xx.h | 9 +++++++++ 2 files changed, 37 insertions(+), 14 deletions(-) diff --git a/cpu/mpc86xx/start.S b/cpu/mpc86xx/start.S index 7406fe224..67c56db1a 100644 --- a/cpu/mpc86xx/start.S +++ b/cpu/mpc86xx/start.S @@ -241,25 +241,39 @@ in_flash: bl setup_ccsrbar #endif - /* Fix for SMP linux - Changing arbitration to round-robin */ - lis r3, CFG_CCSRBAR@h - ori r3, r3, 0x1000 - xor r4, r4, r4 - li r4, 0x1000 - stw r4, 0(r3) + /* -- MPC8641 Rev 1.0 MCM Errata fixups -- */ + + /* skip fixups if not Rev 1.0 */ + mfspr r4, SVR + rlwinm r4,r4,0,24,31 + cmpwi r4,0x10 + bne 1f + + lis r3,MCM_ABCR@ha + lwz r4,MCM_ABCR@l(r3) /* ABCR -> r4 */ + + /* set ABCR[A_STRM_CNT] = 0 */ + rlwinm r4,r4,0,0,29 + + /* set ABCR[ARB_POLICY] to 0x1 (round-robin) */ + addi r0,r0,1 + rlwimi r4,r0,12,18,19 + + stw r4,MCM_ABCR@l(r3) /* r4 -> ABCR */ + sync + + /* Set DBCR[ERD_DIS] */ + lis r3,MCM_DBCR@ha + lwz r4,MCM_DBCR@l(r3) + oris r4, r4, 0x4000 + stw r4,MCM_DBCR@l(r3) + sync +1: /* setup the law entries */ bl law_entry sync - /* Don't use this feature due to bug in 8641D PD4 */ - /* Disable ERD_DIS */ - lis r3, CFG_CCSRBAR@h - ori r3, r3, 0x1008 - lwz r4, 0(r3) - oris r4, r4, 0x4000 - stw r4, 0(r3) - sync #if (EMULATOR_RUN == 1) /* On the emulator we want to adjust these ASAP */ diff --git a/include/mpc86xx.h b/include/mpc86xx.h index bc8ba3f2d..673bfed16 100644 --- a/include/mpc86xx.h +++ b/include/mpc86xx.h @@ -9,6 +9,15 @@ #define EXC_OFF_SYS_RESET 0x0100 /* System reset offset */ + +/* + * platform register addresses + */ + +#define GUTS_SVR (CFG_CCSRBAR + 0xE00A4) +#define MCM_ABCR (CFG_CCSRBAR + 0x01000) +#define MCM_DBCR (CFG_CCSRBAR + 0x01008) + /* * l2cr values. Look in config_.h for the actual setup */ From af1c2b84bf27c8565baddc82d1abb93700d10e2e Mon Sep 17 00:00:00 2001 From: David Updegraff Date: Fri, 20 Apr 2007 14:34:48 -0500 Subject: [PATCH 29/47] Add support for treating unknown PHYs as generic PHYs. When bringing up u-boot on new boards, PHY support sometimes gets neglected. Most PHYs don't really need any special support, though. By adding a generic entry that always matches if nothing else does, we can provide support for "unsupported" PHYs for the tsec. The generic PHY driver supports most PHYs, including gigabit. Signed-off-by: David Updegraff Signed-off-by: Andy Fleming --- drivers/tsec.c | 93 ++++++++++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 93 insertions(+) diff --git a/drivers/tsec.c b/drivers/tsec.c index ed35f227c..25566a733 100644 --- a/drivers/tsec.c +++ b/drivers/tsec.c @@ -385,6 +385,76 @@ uint mii_parse_sr(uint mii_reg, struct tsec_private * priv) return 0; } +/* Generic function which updates the speed and duplex. If + * autonegotiation is enabled, it uses the AND of the link + * partner's advertised capabilities and our advertised + * capabilities. If autonegotiation is disabled, we use the + * appropriate bits in the control register. + * + * Stolen from Linux's mii.c and phy_device.c + */ +uint mii_parse_link(uint mii_reg, struct tsec_private *priv) +{ + /* We're using autonegotiation */ + if (mii_reg & PHY_BMSR_AUTN_ABLE) { + uint lpa = 0; + uint gblpa = 0; + + /* Check for gigabit capability */ + if (mii_reg & PHY_BMSR_EXT) { + /* We want a list of states supported by + * both PHYs in the link + */ + gblpa = read_phy_reg(priv, PHY_1000BTSR); + gblpa &= read_phy_reg(priv, PHY_1000BTCR) << 2; + } + + /* Set the baseline so we only have to set them + * if they're different + */ + priv->speed = 10; + priv->duplexity = 0; + + /* Check the gigabit fields */ + if (gblpa & (PHY_1000BTSR_1000FD | PHY_1000BTSR_1000HD)) { + priv->speed = 1000; + + if (gblpa & PHY_1000BTSR_1000FD) + priv->duplexity = 1; + + /* We're done! */ + return 0; + } + + lpa = read_phy_reg(priv, PHY_ANAR); + lpa &= read_phy_reg(priv, PHY_ANLPAR); + + if (lpa & (PHY_ANLPAR_TXFD | PHY_ANLPAR_TX)) { + priv->speed = 100; + + if (lpa & PHY_ANLPAR_TXFD) + priv->duplexity = 1; + + } else if (lpa & PHY_ANLPAR_10FD) + priv->duplexity = 1; + } else { + uint bmcr = read_phy_reg(priv, PHY_BMCR); + + priv->speed = 10; + priv->duplexity = 0; + + if (bmcr & PHY_BMCR_DPLX) + priv->duplexity = 1; + + if (bmcr & PHY_BMCR_1000_MBPS) + priv->speed = 1000; + else if (bmcr & PHY_BMCR_100_MBPS) + priv->speed = 100; + } + + return 0; +} + /* * Parse the BCM54xx status register for speed and duplex information. * The linux sungem_phy has this information, but in a table format. @@ -722,6 +792,7 @@ static void startup_tsec(struct eth_device *dev) /* Start up the PHY */ if(priv->phyinfo) phy_run_commands(priv, priv->phyinfo->startup); + adjust_link(dev); /* Enable Transmit and Receive */ @@ -1092,6 +1163,27 @@ struct phy_info phy_info_dm9161 = { {miim_end,} }, }; +/* a generic flavor. */ +struct phy_info phy_info_generic = { + 0, + "Unknown/Generic PHY", + 32, + (struct phy_cmd[]) { /* config */ + {PHY_BMCR, PHY_BMCR_RESET, NULL}, + {PHY_BMCR, PHY_BMCR_AUTON|PHY_BMCR_RST_NEG, NULL}, + {miim_end,} + }, + (struct phy_cmd[]) { /* startup */ + {PHY_BMSR, miim_read, NULL}, + {PHY_BMSR, miim_read, &mii_parse_sr}, + {PHY_BMSR, miim_read, &mii_parse_link}, + {miim_end,} + }, + (struct phy_cmd[]) { /* shutdown */ + {miim_end,} + } +}; + uint mii_parse_lxt971_sr2(uint mii_reg, struct tsec_private *priv) { @@ -1207,6 +1299,7 @@ struct phy_info *phy_info[] = { &phy_info_lxt971, &phy_info_VSC8244, &phy_info_dp83865, + &phy_info_generic, NULL }; From 6743105988fc44d5b0d30388c790607835aae7a6 Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Mon, 23 Apr 2007 02:54:25 -0500 Subject: [PATCH 30/47] Add support for the 8568 MDS board This included some changes to common files: * Add 8568 processor SVR to various places * Add support for setting the qe bus-frequency value in the dts * Add the 8568MDS target to the Makefile Signed-off-by: Andy Fleming --- Makefile | 3 + board/mpc8568mds/Makefile | 58 ++++ board/mpc8568mds/bcsr.c | 49 ++++ board/mpc8568mds/bcsr.h | 99 +++++++ board/mpc8568mds/config.mk | 30 ++ board/mpc8568mds/ft_board.c | 45 +++ board/mpc8568mds/init.S | 258 +++++++++++++++++ board/mpc8568mds/mpc8568mds.c | 288 +++++++++++++++++++ board/mpc8568mds/u-boot.lds | 152 ++++++++++ cpu/mpc85xx/cpu.c | 7 + cpu/mpc85xx/cpu_init.c | 2 - include/asm-ppc/processor.h | 1 + include/configs/MPC8568MDS.h | 505 ++++++++++++++++++++++++++++++++++ 13 files changed, 1495 insertions(+), 2 deletions(-) create mode 100644 board/mpc8568mds/Makefile create mode 100644 board/mpc8568mds/bcsr.c create mode 100644 board/mpc8568mds/bcsr.h create mode 100644 board/mpc8568mds/config.mk create mode 100644 board/mpc8568mds/ft_board.c create mode 100644 board/mpc8568mds/init.S create mode 100644 board/mpc8568mds/mpc8568mds.c create mode 100644 board/mpc8568mds/u-boot.lds create mode 100644 include/configs/MPC8568MDS.h diff --git a/Makefile b/Makefile index d447a9610..a9d56ecb2 100644 --- a/Makefile +++ b/Makefile @@ -1739,6 +1739,9 @@ MPC8548CDS_config: unconfig MPC8555CDS_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8555cds cds +MPC8568MDS_config: unconfig + @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8568mds + PM854_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx pm854 diff --git a/board/mpc8568mds/Makefile b/board/mpc8568mds/Makefile new file mode 100644 index 000000000..a799aa4cc --- /dev/null +++ b/board/mpc8568mds/Makefile @@ -0,0 +1,58 @@ +# +# Copyright 2004-2007 Freescale Semiconductor. +# (C) Copyright 2001-2006 +# Wolfgang Denk, DENX Software Engineering, wd@denx.de. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +include $(TOPDIR)/config.mk +ifneq ($(OBJTREE),$(SRCTREE)) +$(shell mkdir -p $(obj)../common) +endif + +LIB = $(obj)lib$(BOARD).a + +COBJS := $(BOARD).o \ + bcsr.o \ + ft_board.o + +SOBJS := init.o + +SRCS := $(SOBJS:.o=.S) $(COBJS:.o=.c) +OBJS := $(addprefix $(obj),$(COBJS)) +SOBJS := $(addprefix $(obj),$(SOBJS)) + +$(LIB): $(obj).depend $(OBJS) $(SOBJS) + $(AR) $(ARFLAGS) $@ $(OBJS) + +clean: + rm -f $(OBJS) $(SOBJS) + +distclean: clean + rm -f $(LIB) core *.bak .depend + +######################################################################### + +# defines $(obj).depend target +include $(SRCTREE)/rules.mk + +sinclude $(obj).depend + +######################################################################### diff --git a/board/mpc8568mds/bcsr.c b/board/mpc8568mds/bcsr.c new file mode 100644 index 000000000..2e2e8cd18 --- /dev/null +++ b/board/mpc8568mds/bcsr.c @@ -0,0 +1,49 @@ +/* + * Copyright 2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include +#include "bcsr.h" + +void enable_8568mds_duart() +{ + volatile uint* duart_mux = (uint *)(CFG_CCSRBAR + 0xe0060); + volatile uint* devices = (uint *)(CFG_CCSRBAR + 0xe0070); + volatile u8 *bcsr = (u8 *)(CFG_BCSR); + + *duart_mux = 0x80000000; /* Set the mux to Duart on PMUXCR */ + *devices = 0; /* Enable all peripheral devices */ + bcsr[5] |= 0x01; /* Enable Duart in BCSR*/ +} + +void enable_8568mds_flash_write() +{ + volatile u8 *bcsr = (u8 *)(CFG_BCSR); + + bcsr[9] |= 0x01; +} + +void disable_8568mds_flash_write() +{ + volatile u8 *bcsr = (u8 *)(CFG_BCSR); + + bcsr[9] &= ~(0x01); +} diff --git a/board/mpc8568mds/bcsr.h b/board/mpc8568mds/bcsr.h new file mode 100644 index 000000000..8d4cb2f14 --- /dev/null +++ b/board/mpc8568mds/bcsr.h @@ -0,0 +1,99 @@ +/* + * Copyright 2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#ifndef __BCSR_H_ +#define __BCSR_H_ + +#include + +/* BCSR Bit definitions + * BCSR 0 * + 0:3 ccb sys pll + 4:6 cfg core pll + 7 cfg boot seq + + * BCSR 1 * + 0:2 cfg rom lock + 3:5 cfg host agent + 6 PCI IO + 7 cfg RIO size + + * BCSR 2 * + 0:4 QE PLL + 5 QE clock + 6 cfg PCI arbiter + + * BCSR 3 * + 0 TSEC1 reduce + 1 TSEC2 reduce + 2:3 TSEC1 protocol + 4:5 TSEC2 protocol + 6 PHY1 slave + 7 PHY2 slave + + * BCSR 4 * + 4 clock enable + 5 boot EPROM + 6 GETH transactive reset + 7 BRD write potect + + * BCSR 5 * + 1:3 Leds 1-3 + 4 UPC1 enable + 5 UPC2 enable + 6 UPC2 pos + 7 RS232 enable + + * BCSR 6 * + 0 CFG ver 0 + 1 CFG ver 1 + 6 Register config led + 7 Power on reset + + * BCSR 7 * + 2 board host mode indication + 5 enable TSEC1 PHY + 6 enable TSEC2 PHY + + * BCSR 8 * + 0 UCC GETH1 enable + 1 UCC GMII enable + 3 UCC TBI enable + 5 UCC MII enable + 7 Real time clock reset + + * BCSR 9 * + 0 UCC2 GETH enable + 1 UCC2 GMII enable + 3 UCC2 TBI enable + 5 UCC2 MII enable + 6 Ready only - indicate flash ready after burning + 7 Flash write protect +*/ + +/*BCSR Utils functions*/ + +void enable_8568mds_duart(void); +void enable_8568mds_flash_write(void); +void disable_8568mds_flash_write(void); + +#endif /* __BCSR_H_ */ diff --git a/board/mpc8568mds/config.mk b/board/mpc8568mds/config.mk new file mode 100644 index 000000000..021522caf --- /dev/null +++ b/board/mpc8568mds/config.mk @@ -0,0 +1,30 @@ +# +# Copyright 2007 Freescale Semiconductor. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +# +# mpc8568mds board +# +TEXT_BASE = 0xfff80000 + +PLATFORM_CPPFLAGS += -DCONFIG_E500=1 +PLATFORM_CPPFLAGS += -DCONFIG_MPC85xx=1 +PLATFORM_CPPFLAGS += -DCONFIG_MPC8568=1 diff --git a/board/mpc8568mds/ft_board.c b/board/mpc8568mds/ft_board.c new file mode 100644 index 000000000..36815ccfb --- /dev/null +++ b/board/mpc8568mds/ft_board.c @@ -0,0 +1,45 @@ +/* + * Copyright 2004-2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include + +#include + +extern void ft_cpu_setup(void *blob, bd_t *bd); + +#if defined(CONFIG_OF_FLAT_TREE) && defined(CONFIG_OF_BOARD_SETUP) +void +ft_board_setup(void *blob, bd_t *bd) +{ + u32 *p; + int len; +#ifdef CONFIG_PCI + ft_pci_setup(blob, bd); +#endif + ft_cpu_setup(blob, bd); + p = ft_get_prop(blob, "/memory/reg", &len); + if (p != NULL) { + *p++ = cpu_to_be32(bd->bi_memstart); + *p = cpu_to_be32(bd->bi_memsize); + } +} +#endif /* CONFIG_OF_FLAT_TREE && CONFIG_OF_BOARD_SETUP */ diff --git a/board/mpc8568mds/init.S b/board/mpc8568mds/init.S new file mode 100644 index 000000000..0d879821e --- /dev/null +++ b/board/mpc8568mds/init.S @@ -0,0 +1,258 @@ +/* + * Copyright 2004-2007 Freescale Semiconductor. + * Copyright 2002,2003, Motorola Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include +#include +#include +#include +#include +#include + + +/* + * TLB0 and TLB1 Entries + * + * Out of reset, TLB1's Entry 0 maps the highest 4K for CCSRBAR. + * However, CCSRBAR is then relocated to CFG_CCSRBAR right after + * these TLB entries are established. + * + * The TLB entries for DDR are dynamically setup in spd_sdram() + * and use TLB1 Entries 8 through 15 as needed according to the + * size of DDR memory. + * + * MAS0: tlbsel, esel, nv + * MAS1: valid, iprot, tid, ts, tsize + * MAS2: epn, sharen, x0, x1, w, i, m, g, e + * MAS3: rpn, u0-u3, ux, sx, uw, sw, ur, sr + */ +#define entry_start \ + mflr r1 ; \ + bl 0f ; + +#define entry_end \ +0: mflr r0 ; \ + mtlr r1 ; \ + blr ; + + + .section .bootpg, "ax" + .globl tlb1_entry +tlb1_entry: + entry_start + + /* + * Number of TLB0 and TLB1 entries in the following table + */ + .long (2f-1f)/16 + +1: +#if (CFG_CCSRBAR_DEFAULT != CFG_CCSRBAR) + /* + * TLB0 4K Non-cacheable, guarded + * 0xff700000 4K Initial CCSRBAR mapping + * + * This ends up at a TLB0 Index==0 entry, and must not collide + * with other TLB0 Entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,0,1,0,1,0,1) +#else +#error("Update the number of table entries in tlb1_entry") +#endif + + /* + * TLB0 16K Cacheable, non-guarded + * 0xd001_0000 16K Temporary Global data for initialization + * + * Use four 4K TLB0 entries. These entries must be cacheable + * as they provide the bootstrap memory before the memory + * controler and real memory have been configured. + * + * These entries end up at TLB0 Indicies 0x10, 0x14, 0x18 and 0x1c, + * and must not collide with other TLB0 entries. + */ + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR), 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR), 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 4 * 1024), + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 4 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024), + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 12 * 1024), + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 12 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + /* TLB 1 Initializations */ + /* + * TLBe 0: 16M Non-cacheable, guarded + * 0xff000000 16M FLASH (upper half) + * Out of reset this entry is only 4K. + */ + .long TLB1_MAS0(1, 0, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_16M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_FLASH_BASE + 0x1000000), + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_FLASH_BASE + 0x1000000), + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 1: 16M Non-cacheable, guarded + * 0xfe000000 16M FLASH (lower half) + */ + .long TLB1_MAS0(1, 1, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_16M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_FLASH_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_FLASH_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 2: 256M Non-cacheable, guarded + * 0x80000000 256M PCI1 MEM + */ + .long TLB1_MAS0(1, 2, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 3: 256M Non-cacheable, guarded + * 0xa0000000 256M PCIe Mem + */ + .long TLB1_MAS0(1, 3, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PEX_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PEX_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 4: Reserved for future usage + */ + + /* + * TLBe 5: 64M Non-cacheable, guarded + * 0xe000_0000 1M CCSRBAR + * 0xe200_0000 8M PCI1 IO + * 0xe280_0000 8M PCIe IO + */ + .long TLB1_MAS0(1, 5, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 6: 64M Cacheable, non-guarded + * 0xf000_0000 64M LBC SDRAM + */ + .long TLB1_MAS0(1, 6, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_SDRAM_BASE), 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_SDRAM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 7: 256K Non-cacheable, guarded + * 0xf8000000 32K BCSR + * 0xf8008000 32K PIB (CS4) + * 0xf8010000 32K PIB (CS5) + */ + .long TLB1_MAS0(1, 7, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256K) + .long TLB1_MAS2(E500_TLB_EPN(CFG_BCSR_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_BCSR_BASE), 0,0,0,0,0,1,0,1,0,1) + +2: + entry_end + +/* + * LAW(Local Access Window) configuration: + * + *0) 0x0000_0000 0x7fff_ffff DDR 2G + *1) 0x8000_0000 0x9fff_ffff PCI1 MEM 256MB + *2) 0xa000_0000 0xbfff_ffff PCIe MEM 256MB + *5) 0xc000_0000 0xdfff_ffff SRIO 256MB + *-) 0xe000_0000 0xe00f_ffff CCSR 1M + *3) 0xe200_0000 0xe27f_ffff PCI1 I/O 8M + *4) 0xe280_0000 0xe2ff_ffff PCIe I/0 8M + *6.a) 0xf000_0000 0xf3ff_ffff SDRAM 64MB + *6.b) 0xf800_0000 0xf800_7fff BCSR 32KB + *6.c) 0xf800_8000 0xf800_ffff PIB (CS4) 32KB + *6.d) 0xf801_0000 0xf801_7fff PIB (CS5) 32KB + *6.e) 0xfe00_0000 0xffff_ffff Flash 32MB + * + *Notes: + * CCSRBAR and L2-as-SRAM don't need a configured Local Access Window. + * If flash is 8M at default position (last 8M), no LAW needed. + * + * The defines below are 1-off of the actual LAWAR0 usage. + * So LAWAR3 define uses the LAWAR4 register in the ECM. + */ + +#define LAWBAR0 0 +#define LAWAR0 ((LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN) + +#define LAWBAR1 ((CFG_PCI1_MEM_BASE>>12) & 0xfffff) +#define LAWAR1 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_256M)) + +#define LAWBAR2 ((CFG_PEX_MEM_BASE>>12) & 0xfffff) +#define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_256M)) + +#define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_8M)) + +#define LAWBAR4 ((CFG_PEX_IO_PHYS>>12) & 0xfffff) +#define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_16M)) + + +#define LAWBAR5 ((CFG_SRIO_MEM_BASE>>12) & 0xfffff) +#define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_RIO | (LAWAR_SIZE & LAWAR_SIZE_256M)) + +/* LBC window - maps 256M. That's SDRAM, BCSR, PIBs, and Flash */ +#define LAWBAR6 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff) +#define LAWAR6 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) + + .section .bootpg, "ax" + .globl law_entry + +law_entry: + entry_start + .long (4f-3f)/8 +3: + .long LAWBAR0,LAWAR0,LAWBAR1,LAWAR1,LAWBAR2,LAWAR2,LAWBAR3,LAWAR3 + .long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5,LAWBAR6,LAWAR6 +4: + entry_end diff --git a/board/mpc8568mds/mpc8568mds.c b/board/mpc8568mds/mpc8568mds.c new file mode 100644 index 000000000..9c7960d47 --- /dev/null +++ b/board/mpc8568mds/mpc8568mds.c @@ -0,0 +1,288 @@ +/* + * Copyright 2007 Freescale Semiconductor. + * + * (C) Copyright 2002 Scott McNutt + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include +#include +#include +#include +#include + +#include "bcsr.h" + + +#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) +extern void ddr_enable_ecc(unsigned int dram_size); +#endif + +extern long int spd_sdram(void); + +void local_bus_init(void); +void sdram_init(void); + +int board_early_init_f (void) +{ + /* + * Initialize local bus. + */ + local_bus_init (); + + enable_8568mds_duart(); + enable_8568mds_flash_write(); + + return 0; +} + +int checkboard (void) +{ + printf ("Board: 8568 MDS\n"); + + return 0; +} + +long int +initdram(int board_type) +{ + long dram_size = 0; + volatile immap_t *immap = (immap_t *)CFG_IMMR; + + puts("Initializing\n"); + +#if defined(CONFIG_DDR_DLL) + { + /* + * Work around to stabilize DDR DLL MSYNC_IN. + * Errata DDR9 seems to have been fixed. + * This is now the workaround for Errata DDR11: + * Override DLL = 1, Course Adj = 1, Tap Select = 0 + */ + + volatile ccsr_gur_t *gur= &immap->im_gur; + + gur->ddrdllcr = 0x81000000; + asm("sync;isync;msync"); + udelay(200); + } +#endif + dram_size = spd_sdram(); + +#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) + /* + * Initialize and enable DDR ECC. + */ + ddr_enable_ecc(dram_size); +#endif + /* + * SDRAM Initialization + */ + sdram_init(); + + puts(" DDR: "); + return dram_size; +} + +/* + * Initialize Local Bus + */ +void +local_bus_init(void) +{ + volatile immap_t *immap = (immap_t *)CFG_IMMR; + volatile ccsr_gur_t *gur = &immap->im_gur; + volatile ccsr_lbc_t *lbc = &immap->im_lbc; + + uint clkdiv; + uint lbc_hz; + sys_info_t sysinfo; + + get_sys_info(&sysinfo); + clkdiv = (lbc->lcrr & 0x0f) * 2; + lbc_hz = sysinfo.freqSystemBus / 1000000 / clkdiv; + + gur->lbiuiplldcr1 = 0x00078080; + if (clkdiv == 16) { + gur->lbiuiplldcr0 = 0x7c0f1bf0; + } else if (clkdiv == 8) { + gur->lbiuiplldcr0 = 0x6c0f1bf0; + } else if (clkdiv == 4) { + gur->lbiuiplldcr0 = 0x5c0f1bf0; + } + + lbc->lcrr |= 0x00030000; + + asm("sync;isync;msync"); +} + +/* + * Initialize SDRAM memory on the Local Bus. + */ +void +sdram_init(void) +{ +#if defined(CFG_OR2_PRELIM) && defined(CFG_BR2_PRELIM) + + uint idx; + volatile immap_t *immap = (immap_t *)CFG_IMMR; + volatile ccsr_lbc_t *lbc = &immap->im_lbc; + uint *sdram_addr = (uint *)CFG_LBC_SDRAM_BASE; + uint lsdmr_common; + + puts(" SDRAM: "); + + print_size (CFG_LBC_SDRAM_SIZE * 1024 * 1024, "\n"); + + /* + * Setup SDRAM Base and Option Registers + */ + lbc->or2 = CFG_OR2_PRELIM; + asm("msync"); + + lbc->br2 = CFG_BR2_PRELIM; + asm("msync"); + + lbc->lbcr = CFG_LBC_LBCR; + asm("msync"); + + + lbc->lsrt = CFG_LBC_LSRT; + lbc->mrtpr = CFG_LBC_MRTPR; + asm("msync"); + + /* + * MPC8568 uses "new" 15-16 style addressing. + */ + lsdmr_common = CFG_LBC_LSDMR_COMMON; + lsdmr_common |= CFG_LBC_LSDMR_BSMA1516; + + /* + * Issue PRECHARGE ALL command. + */ + lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_PCHALL; + asm("sync;msync"); + *sdram_addr = 0xff; + ppcDcbf((unsigned long) sdram_addr); + udelay(100); + + /* + * Issue 8 AUTO REFRESH commands. + */ + for (idx = 0; idx < 8; idx++) { + lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_ARFRSH; + asm("sync;msync"); + *sdram_addr = 0xff; + ppcDcbf((unsigned long) sdram_addr); + udelay(100); + } + + /* + * Issue 8 MODE-set command. + */ + lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_MRW; + asm("sync;msync"); + *sdram_addr = 0xff; + ppcDcbf((unsigned long) sdram_addr); + udelay(100); + + /* + * Issue NORMAL OP command. + */ + lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_NORMAL; + asm("sync;msync"); + *sdram_addr = 0xff; + ppcDcbf((unsigned long) sdram_addr); + udelay(200); /* Overkill. Must wait > 200 bus cycles */ + +#endif /* enable SDRAM init */ +} + +#if defined(CFG_DRAM_TEST) +int +testdram(void) +{ + uint *pstart = (uint *) CFG_MEMTEST_START; + uint *pend = (uint *) CFG_MEMTEST_END; + uint *p; + + printf("Testing DRAM from 0x%08x to 0x%08x\n", + CFG_MEMTEST_START, + CFG_MEMTEST_END); + + printf("DRAM test phase 1:\n"); + for (p = pstart; p < pend; p++) + *p = 0xaaaaaaaa; + + for (p = pstart; p < pend; p++) { + if (*p != 0xaaaaaaaa) { + printf ("DRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("DRAM test phase 2:\n"); + for (p = pstart; p < pend; p++) + *p = 0x55555555; + + for (p = pstart; p < pend; p++) { + if (*p != 0x55555555) { + printf ("DRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("DRAM test passed.\n"); + return 0; +} +#endif + +#if defined(CONFIG_PCI) +#ifndef CONFIG_PCI_PNP +static struct pci_config_table pci_mpc8568mds_config_table[] = { + { + PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, + pci_cfgfunc_config_device, + {PCI_ENET0_IOADDR, + PCI_ENET0_MEMADDR, + PCI_COMMON_MEMORY | PCI_COMMAND_MASTER} + }, + {} +}; +#endif + +static struct pci_controller hose[] = { +#ifndef CONFIG_PCI_PNP + { config_table: pci_mpc8568mds_config_table,}, +#endif +#ifdef CONFIG_MPC85XX_PCI2 + {}, +#endif +}; + +#endif /* CONFIG_PCI */ + +void +pci_init_board(void) +{ +#ifdef CONFIG_PCI + pci_mpc85xx_init(&hose); +#endif +} diff --git a/board/mpc8568mds/u-boot.lds b/board/mpc8568mds/u-boot.lds new file mode 100644 index 000000000..71099f6f1 --- /dev/null +++ b/board/mpc8568mds/u-boot.lds @@ -0,0 +1,152 @@ +/* + * Copyright 2004-2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +OUTPUT_ARCH(powerpc) +SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib); +/* Do we need any of these for elf? + __DYNAMIC = 0; */ + +SECTIONS +{ + /* ELIOR - From RAM: From FLASH: 0xFFFFFFFC*/ + .resetvec 0xFFFFFFFC: + { + *(.resetvec) + } = 0xffff + + /*(ELIOR - From RAM: From FLASH: 0xFFFFF000*/ + .bootpg 0xFFFFF000: + { + cpu/mpc85xx/start.o (.bootpg) + board/mpc8568mds/init.o (.bootpg) + } = 0xffff + + /* Read-only sections, merged into text segment: */ + . = + SIZEOF_HEADERS; + .interp : { *(.interp) } + .hash : { *(.hash) } + .dynsym : { *(.dynsym) } + .dynstr : { *(.dynstr) } + .rel.text : { *(.rel.text) } + .rela.text : { *(.rela.text) } + .rel.data : { *(.rel.data) } + .rela.data : { *(.rela.data) } + .rel.rodata : { *(.rel.rodata) } + .rela.rodata : { *(.rela.rodata) } + .rel.got : { *(.rel.got) } + .rela.got : { *(.rela.got) } + .rel.ctors : { *(.rel.ctors) } + .rela.ctors : { *(.rela.ctors) } + .rel.dtors : { *(.rel.dtors) } + .rela.dtors : { *(.rela.dtors) } + .rel.bss : { *(.rel.bss) } + .rela.bss : { *(.rela.bss) } + .rel.plt : { *(.rel.plt) } + .rela.plt : { *(.rela.plt) } + .init : { *(.init) } + .plt : { *(.plt) } + .text : + { + cpu/mpc85xx/start.o (.text) + board/mpc8568mds/init.o (.text) + cpu/mpc85xx/traps.o (.text) + cpu/mpc85xx/interrupts.o (.text) + cpu/mpc85xx/cpu_init.o (.text) + cpu/mpc85xx/cpu.o (.text) + cpu/mpc85xx/speed.o (.text) + cpu/mpc85xx/pci.o (.text) + common/dlmalloc.o (.text) + lib_generic/crc32.o (.text) + lib_ppc/extable.o (.text) + lib_generic/zlib.o (.text) + *(.text) + *(.fixup) + *(.got1) + } + _etext = .; + PROVIDE (etext = .); + .rodata : + { + *(.rodata) + *(.rodata1) + *(.rodata.str1.4) + *(.eh_frame) + } + .fini : { *(.fini) } =0 + .ctors : { *(.ctors) } + .dtors : { *(.dtors) } + + /* Read-write section, merged into data segment: */ + . = (. + 0x00FF) & 0xFFFFFF00; + _erotext = .; + PROVIDE (erotext = .); + .reloc : + { + *(.got) + _GOT2_TABLE_ = .; + *(.got2) + _FIXUP_TABLE_ = .; + *(.fixup) + } + __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2; + __fixup_entries = (. - _FIXUP_TABLE_) >> 2; + + .data : + { + *(.data) + *(.data1) + *(.sdata) + *(.sdata2) + *(.dynamic) + CONSTRUCTORS + } + _edata = .; + PROVIDE (edata = .); + + . = .; + __u_boot_cmd_start = .; + .u_boot_cmd : { *(.u_boot_cmd) } + __u_boot_cmd_end = .; + + . = .; + __start___ex_table = .; + __ex_table : { *(__ex_table) } + __stop___ex_table = .; + + . = ALIGN(256); + __init_begin = .; + .text.init : { *(.text.init) } + .data.init : { *(.data.init) } + . = ALIGN(256); + __init_end = .; + + __bss_start = .; + .bss : + { + *(.sbss) *(.scommon) + *(.dynbss) + *(.bss) + *(COMMON) + } + _end = . ; + PROVIDE (end = .); +} diff --git a/cpu/mpc85xx/cpu.c b/cpu/mpc85xx/cpu.c index d5102dfdd..63176d284 100644 --- a/cpu/mpc85xx/cpu.c +++ b/cpu/mpc85xx/cpu.c @@ -76,6 +76,9 @@ int checkcpu (void) case SVR_8544_E: puts("8544_E"); break; + case SVR_8568_E: + puts("8568_E"); + break; default: puts("Unknown"); break; @@ -265,6 +268,10 @@ ft_cpu_setup(void *blob, bd_t *bd) if (p != NULL) *p = cpu_to_be32(clock); + p = ft_get_prop(blob, "/qe@e0080000/" OF_CPU "/bus-frequency", &len); + if (p != NULL) + *p = cpu_to_be32(clock); + p = ft_get_prop(blob, "/" OF_SOC "/serial@4500/clock-frequency", &len); if (p != NULL) *p = cpu_to_be32(clock); diff --git a/cpu/mpc85xx/cpu_init.c b/cpu/mpc85xx/cpu_init.c index 9f4d36c1a..9517146ed 100644 --- a/cpu/mpc85xx/cpu_init.c +++ b/cpu/mpc85xx/cpu_init.c @@ -143,12 +143,10 @@ void cpu_init_f (void) memctl->br1 = CFG_BR1_PRELIM; #endif -#if !defined(CONFIG_MPC85xx) #if defined(CFG_BR2_PRELIM) && defined(CFG_OR2_PRELIM) memctl->or2 = CFG_OR2_PRELIM; memctl->br2 = CFG_BR2_PRELIM; #endif -#endif #if defined(CFG_BR3_PRELIM) && defined(CFG_OR3_PRELIM) memctl->or3 = CFG_OR3_PRELIM; diff --git a/include/asm-ppc/processor.h b/include/asm-ppc/processor.h index 944cbe90c..e9361c517 100644 --- a/include/asm-ppc/processor.h +++ b/include/asm-ppc/processor.h @@ -850,6 +850,7 @@ #define SVR_8548 0x8031 #define SVR_8548_E 0x8039 #define SVR_8641 0x8090 +#define SVR_8568_E 0x807D /* I am just adding a single entry for 8260 boards. I think we may be diff --git a/include/configs/MPC8568MDS.h b/include/configs/MPC8568MDS.h new file mode 100644 index 000000000..66293c522 --- /dev/null +++ b/include/configs/MPC8568MDS.h @@ -0,0 +1,505 @@ +/* + * Copyright 2004-2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +/* + * mpc8568mds board configuration file + */ +#ifndef __CONFIG_H +#define __CONFIG_H + +/* High Level Configuration Options */ +#define CONFIG_BOOKE 1 /* BOOKE */ +#define CONFIG_E500 1 /* BOOKE e500 family */ +#define CONFIG_MPC85xx 1 /* MPC8540/60/55/41/48/68 */ +#define CONFIG_MPC8568 1 /* MPC8568 specific */ +#define CONFIG_MPC8568MDS 1 /* MPC8568MDS board specific */ + +#undef CONFIG_PCI +#define CONFIG_TSEC_ENET /* tsec ethernet support */ +#define CONFIG_ENV_OVERWRITE +#define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup*/ +#define CONFIG_DDR_DLL /* possible DLL fix needed */ +/*#define CONFIG_DDR_2T_TIMING Sets the 2T timing bit */ + +/*#define CONFIG_DDR_ECC*/ /* only for ECC DDR module */ +/*#define CONFIG_ECC_INIT_VIA_DDRCONTROLLER*/ /* DDR controller or DMA? */ +#define CONFIG_MEM_INIT_VALUE 0xDeadBeef + + +/* + * When initializing flash, if we cannot find the manufacturer ID, + * assume this is the AMD flash associated with the MDS board. + * This allows booting from a promjet. + */ +#define CONFIG_ASSUME_AMD_FLASH + +#define MPC85xx_DDR_SDRAM_CLK_CNTL /* 85xx has clock control reg */ + +#ifndef __ASSEMBLY__ +extern unsigned long get_clock_freq(void); +#endif /*Replace a call to get_clock_freq (after it is implemented)*/ +#define CONFIG_SYS_CLK_FREQ 66000000 /*TODO: restore if wanting to read from BCSR: get_clock_freq()*/ /* sysclk for MPC85xx */ + +/* + * These can be toggled for performance analysis, otherwise use default. + */ +/*#define CONFIG_L2_CACHE*/ /* toggle L2 cache */ +#define CONFIG_BTB /* toggle branch predition */ +#define CONFIG_ADDR_STREAMING /* toggle addr streaming */ + +/* + * Only possible on E500 Version 2 or newer cores. + */ +#define CONFIG_ENABLE_36BIT_PHYS 1 + + +#define CONFIG_BOARD_EARLY_INIT_F 1 /* Call board_pre_init */ + +#undef CFG_DRAM_TEST /* memory test, takes time */ +#define CFG_MEMTEST_START 0x00200000 /* memtest works on */ +#define CFG_MEMTEST_END 0x00400000 + +/* + * Base addresses -- Note these are effective addresses where the + * actual resources get mapped (not physical addresses) + */ +#define CFG_CCSRBAR_DEFAULT 0xff700000 /* CCSRBAR Default */ +#define CFG_CCSRBAR 0xe0000000 /* relocated CCSRBAR */ +#define CFG_IMMR CFG_CCSRBAR /* PQII uses CFG_IMMR */ + +/* + * DDR Setup + */ +#define CFG_DDR_SDRAM_BASE 0x00000000 /* DDR is system memory*/ +#define CFG_SDRAM_BASE CFG_DDR_SDRAM_BASE + +#define SPD_EEPROM_ADDRESS 0x51 /* DDR DIMM */ + +/* + * Make sure required options are set + */ +#ifndef CONFIG_SPD_EEPROM +#error ("CONFIG_SPD_EEPROM is required") +#endif + +#undef CONFIG_CLOCKS_IN_MHZ + + +/* + * Local Bus Definitions + */ + +/* + * FLASH on the Local Bus + * Two banks, 8M each, using the CFI driver. + * Boot from BR0/OR0 bank at 0xff00_0000 + * Alternate BR1/OR1 bank at 0xff80_0000 + * + * BR0, BR1: + * Base address 0 = 0xff00_0000 = BR0[0:16] = 1111 1111 0000 0000 0 + * Base address 1 = 0xff80_0000 = BR1[0:16] = 1111 1111 1000 0000 0 + * Port Size = 16 bits = BRx[19:20] = 10 + * Use GPCM = BRx[24:26] = 000 + * Valid = BRx[31] = 1 + * + * 0 4 8 12 16 20 24 28 + * 1111 1111 1000 0000 0001 0000 0000 0001 = ff801001 BR0 + * 1111 1111 0000 0000 0001 0000 0000 0001 = ff001001 BR1 + * + * OR0, OR1: + * Addr Mask = 8M = ORx[0:16] = 1111 1111 1000 0000 0 + * Reserved ORx[17:18] = 11, confusion here? + * CSNT = ORx[20] = 1 + * ACS = half cycle delay = ORx[21:22] = 11 + * SCY = 6 = ORx[24:27] = 0110 + * TRLX = use relaxed timing = ORx[29] = 1 + * EAD = use external address latch delay = OR[31] = 1 + * + * 0 4 8 12 16 20 24 28 + * 1111 1111 1000 0000 0110 1110 0110 0101 = ff806e65 ORx + */ +#define CFG_BCSR_BASE 0xf8000000 + +#define CFG_FLASH_BASE 0xfe000000 /* start of FLASH 32M */ + +/*Chip select 0 - Flash*/ +#define CFG_BR0_PRELIM 0xfe001001 +#define CFG_OR0_PRELIM 0xfe006ff7 + +/*Chip slelect 1 - BCSR*/ +#define CFG_BR1_PRELIM 0xf8000801 +#define CFG_OR1_PRELIM 0xffffe9f7 + +//#define CFG_FLASH_BANKS_LIST {0xff800000, CFG_FLASH_BASE} +#define CFG_MAX_FLASH_BANKS 1 /* number of banks */ +#define CFG_MAX_FLASH_SECT 512 /* sectors per device */ +#undef CFG_FLASH_CHECKSUM +#define CFG_FLASH_ERASE_TOUT 60000 /* Flash Erase Timeout (ms) */ +#define CFG_FLASH_WRITE_TOUT 500 /* Flash Write Timeout (ms) */ + +#define CFG_MONITOR_BASE TEXT_BASE /* start of monitor */ + +#define CFG_FLASH_CFI_DRIVER +#define CFG_FLASH_CFI +#define CFG_FLASH_EMPTY_INFO + + +/* + * SDRAM on the LocalBus + */ +#define CFG_LBC_SDRAM_BASE 0xf0000000 /* Localbus SDRAM */ +#define CFG_LBC_SDRAM_SIZE 64 /* LBC SDRAM is 64MB */ + + +/*Chip select 2 - SDRAM*/ +#define CFG_BR2_PRELIM 0xf0001861 +#define CFG_OR2_PRELIM 0xfc006901 + +#define CFG_LBC_LCRR 0x00030004 /* LB clock ratio reg */ +#define CFG_LBC_LBCR 0x00000000 /* LB config reg */ +#define CFG_LBC_LSRT 0x20000000 /* LB sdram refresh timer */ +#define CFG_LBC_MRTPR 0x00000000 /* LB refresh timer prescal*/ + +/* + * LSDMR masks + */ +#define CFG_LBC_LSDMR_RFEN (1 << (31 - 1)) +#define CFG_LBC_LSDMR_BSMA1516 (3 << (31 - 10)) +#define CFG_LBC_LSDMR_BSMA1617 (4 << (31 - 10)) +#define CFG_LBC_LSDMR_RFCR16 (7 << (31 - 16)) +#define CFG_LBC_LSDMR_PRETOACT7 (7 << (31 - 19)) +#define CFG_LBC_LSDMR_ACTTORW7 (7 << (31 - 22)) +#define CFG_LBC_LSDMR_ACTTORW6 (6 << (31 - 22)) +#define CFG_LBC_LSDMR_BL8 (1 << (31 - 23)) +#define CFG_LBC_LSDMR_WRC4 (0 << (31 - 27)) +#define CFG_LBC_LSDMR_CL3 (3 << (31 - 31)) + +#define CFG_LBC_LSDMR_OP_NORMAL (0 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_ARFRSH (1 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_SRFRSH (2 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_MRW (3 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_PRECH (4 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_PCHALL (5 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_ACTBNK (6 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_RWINV (7 << (31 - 4)) + +/* + * Common settings for all Local Bus SDRAM commands. + * At run time, either BSMA1516 (for CPU 1.1) + * or BSMA1617 (for CPU 1.0) (old) + * is OR'ed in too. + */ +#define CFG_LBC_LSDMR_COMMON ( CFG_LBC_LSDMR_RFCR16 \ + | CFG_LBC_LSDMR_PRETOACT7 \ + | CFG_LBC_LSDMR_ACTTORW7 \ + | CFG_LBC_LSDMR_BL8 \ + | CFG_LBC_LSDMR_WRC4 \ + | CFG_LBC_LSDMR_CL3 \ + | CFG_LBC_LSDMR_RFEN \ + ) + +/* + * The bcsr registers are connected to CS3 on MDS. + * The new memory map places bcsr at 0xf8000000. + * + * For BR3, need: + * Base address of 0xf8000000 = BR[0:16] = 1111 1000 0000 0000 0 + * port-size = 8-bits = BR[19:20] = 01 + * no parity checking = BR[21:22] = 00 + * GPMC for MSEL = BR[24:26] = 000 + * Valid = BR[31] = 1 + * + * 0 4 8 12 16 20 24 28 + * 1111 1000 0000 0000 0000 1000 0000 0001 = f8000801 + * + * For OR3, need: + * 1 MB mask for AM, OR[0:16] = 1111 1111 1111 0000 0 + * disable buffer ctrl OR[19] = 0 + * CSNT OR[20] = 1 + * ACS OR[21:22] = 11 + * XACS OR[23] = 1 + * SCY 15 wait states OR[24:27] = 1111 max is suboptimal but safe + * SETA OR[28] = 0 + * TRLX OR[29] = 1 + * EHTR OR[30] = 1 + * EAD extra time OR[31] = 1 + * + * 0 4 8 12 16 20 24 28 + * 1111 1111 1111 0000 0000 1111 1111 0111 = fff00ff7 + */ +#define CFG_BCSR (0xf8000000) + +/*Chip slelect 4 - PIB*/ +#define CFG_BR4_PRELIM 0xf8008801 +#define CFG_OR4_PRELIM 0xffffe9f7 + +/*Chip select 5 - PIB*/ +#define CFG_BR5_PRELIM 0xf8010801 +#define CFG_OR5_PRELIM 0xffff69f7 + +#define CONFIG_L1_INIT_RAM +#define CFG_INIT_RAM_LOCK 1 +#define CFG_INIT_RAM_ADDR 0xe4010000 /* Initial RAM address */ +#define CFG_INIT_RAM_END 0x4000 /* End of used area in RAM */ + +#define CFG_GBL_DATA_SIZE 128 /* num bytes initial data */ +#define CFG_GBL_DATA_OFFSET (CFG_INIT_RAM_END - CFG_GBL_DATA_SIZE) +#define CFG_INIT_SP_OFFSET CFG_GBL_DATA_OFFSET + +#define CFG_MONITOR_LEN (256 * 1024) /* Reserve 256 kB for Mon */ +#define CFG_MALLOC_LEN (128 * 1024) /* Reserved for malloc */ + +/* Serial Port */ +#define CONFIG_CONS_INDEX 1 +#undef CONFIG_SERIAL_SOFTWARE_FIFO +#define CFG_NS16550 +#define CFG_NS16550_SERIAL +#define CFG_NS16550_REG_SIZE 1 +#define CFG_NS16550_CLK get_bus_freq(0) + +#define CFG_BAUDRATE_TABLE \ + {300, 600, 1200, 2400, 4800, 9600, 19200, 38400,115200} + +#define CFG_NS16550_COM1 (CFG_CCSRBAR+0x4500) +#define CFG_NS16550_COM2 (CFG_CCSRBAR+0x4600) + +/* Use the HUSH parser*/ +#define CFG_HUSH_PARSER +#ifdef CFG_HUSH_PARSER +#define CFG_PROMPT_HUSH_PS2 "> " +#endif + +/* pass open firmware flat tree */ +#define CONFIG_OF_FLAT_TREE 1 +#define CONFIG_OF_BOARD_SETUP 1 + +/* maximum size of the flat tree (8K) */ +#define OF_FLAT_TREE_MAX_SIZE 8192 + +#define OF_CPU "PowerPC,8568@0" +#define OF_SOC "soc8568@e0000000" +#define OF_TBCLK (bd->bi_busfreq / 8) +#define OF_STDOUT_PATH "/soc8568@e0000000/serial@4600" + +/* + * I2C + */ +#define CONFIG_FSL_I2C /* Use FSL common I2C driver */ +#define CONFIG_HARD_I2C /* I2C with hardware support*/ +#undef CONFIG_SOFT_I2C /* I2C bit-banged */ +#define CFG_I2C_SPEED 400000 /* I2C speed and slave address */ +#define CFG_I2C_EEPROM_ADDR 0x57 +#define CFG_I2C_SLAVE 0x7F +#define CFG_I2C_NOPROBES {0x69} /* Don't probe these addrs */ +#define CFG_I2C_OFFSET 0x3000 + +/* + * General PCI + * Memory Addresses are mapped 1-1. I/O is mapped from 0 + */ +#define CFG_PCI1_MEM_BASE 0x80000000 +#define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE +#define CFG_PCI1_MEM_SIZE 0x10000000 /* 256M */ +#define CFG_PCI1_IO_BASE 0x00000000 +#define CFG_PCI1_IO_PHYS 0xe2000000 +#define CFG_PCI1_IO_SIZE 0x00800000 /* 8M */ + +#define CFG_PEX_MEM_BASE 0xa0000000 +#define CFG_PEX_MEM_PHYS CFG_PEX_MEM_BASE +#define CFG_PEX_MEM_SIZE 0x10000000 /* 256M */ +#define CFG_PEX_IO_BASE 0x00000000 +#define CFG_PEX_IO_PHYS 0xe2800000 +#define CFG_PEX_IO_SIZE 0x00800000 /* 8M */ + +#define CFG_SRIO_MEM_BASE 0xc0000000 + +#if defined(CONFIG_PCI) + +#define CONFIG_NET_MULTI +#define CONFIG_PCI_PNP /* do pci plug-and-play */ + +#undef CONFIG_EEPRO100 +#undef CONFIG_TULIP + +#undef CONFIG_PCI_SCAN_SHOW /* show pci devices on startup */ +#define CFG_PCI_SUBSYS_VENDORID 0x1057 /* Motorola */ + +#endif /* CONFIG_PCI */ + + +#if defined(CONFIG_TSEC_ENET) + +#ifndef CONFIG_NET_MULTI +#define CONFIG_NET_MULTI 1 +#endif + +#define CONFIG_MII 1 /* MII PHY management */ +#define CONFIG_MPC85XX_TSEC1 1 +#define CONFIG_MPC85XX_TSEC1_NAME "eTSEC0" +#define CONFIG_MPC85XX_TSEC2 1 +#define CONFIG_MPC85XX_TSEC2_NAME "eTSEC1" +#undef CONFIG_MPC85XX_TSEC3 +#undef CONFIG_MPC85XX_TSEC4 +#undef CONFIG_MPC85XX_FEC + +#define TSEC1_PHY_ADDR 2 +#define TSEC2_PHY_ADDR 3 + +#define TSEC1_PHYIDX 0 +#define TSEC2_PHYIDX 0 + +/* Options are: eTSEC[0-3] */ +#define CONFIG_ETHPRIME "eTSEC0" + +#endif /* CONFIG_TSEC_ENET */ + +/* + * Environment + */ +#define CFG_ENV_IS_IN_FLASH 1 +#define CFG_ENV_ADDR (CFG_MONITOR_BASE + 0x40000) +#define CFG_ENV_SECT_SIZE 0x40000 /* 256K(one sector) for env */ +#define CFG_ENV_SIZE 0x2000 + +#define CONFIG_LOADS_ECHO 1 /* echo on for serial download */ +#define CFG_LOADS_BAUD_CHANGE 1 /* allow baudrate change */ + +#if defined(CONFIG_PCI) +#define CONFIG_COMMANDS (CONFIG_CMD_DFL \ + | CFG_CMD_PCI \ + | CFG_CMD_PING \ + | CFG_CMD_I2C \ + | CFG_CMD_MII) +#else +#define CONFIG_COMMANDS (CONFIG_CMD_DFL \ + | CFG_CMD_PING \ + | CFG_CMD_I2C \ + | CFG_CMD_MII) +#endif +#include + +#undef CONFIG_WATCHDOG /* watchdog disabled */ + +/* + * Miscellaneous configurable options + */ +#define CFG_LONGHELP /* undef to save memory */ +#define CFG_LOAD_ADDR 0x2000000 /* default load address */ +#define CFG_PROMPT "=> " /* Monitor Command Prompt */ +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CBSIZE 1024 /* Console I/O Buffer Size */ +#else +#define CFG_CBSIZE 256 /* Console I/O Buffer Size */ +#endif +#define CFG_PBSIZE (CFG_CBSIZE+sizeof(CFG_PROMPT)+16) /* Print Buffer Size */ +#define CFG_MAXARGS 16 /* max number of command args */ +#define CFG_BARGSIZE CFG_CBSIZE /* Boot Argument Buffer Size */ +#define CFG_HZ 1000 /* decrementer freq: 1ms ticks */ + +/* + * For booting Linux, the board info and command line data + * have to be in the first 8 MB of memory, since this is + * the maximum mapped by the Linux kernel during initialization. + */ +#define CFG_BOOTMAPSZ (8 << 20) /* Initial Memory map for Linux*/ + +/* Cache Configuration */ +#define CFG_DCACHE_SIZE 32768 +#define CFG_CACHELINE_SIZE 32 +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CACHELINE_SHIFT 5 /*log base 2 of the above value*/ +#endif + +/* + * Internal Definitions + * + * Boot Flags + */ +#define BOOTFLAG_COLD 0x01 /* Normal Power-On: Boot from FLASH */ +#define BOOTFLAG_WARM 0x02 /* Software reboot */ + +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CONFIG_KGDB_BAUDRATE 230400 /* speed to run kgdb serial port */ +#define CONFIG_KGDB_SER_INDEX 2 /* which serial port to use */ +#endif + +/* + * Environment Configuration + */ + +/* The mac addresses for all ethernet interface */ +#if defined(CONFIG_TSEC_ENET) +#define CONFIG_ETHADDR 00:E0:0C:00:00:FD +#define CONFIG_HAS_ETH1 +#define CONFIG_ETH1ADDR 00:E0:0C:00:01:FD +#define CONFIG_HAS_ETH2 +#define CONFIG_ETH2ADDR 00:E0:0C:00:02:FD +#endif + +#define CONFIG_IPADDR 192.168.1.253 + +#define CONFIG_HOSTNAME unknown +#define CONFIG_ROOTPATH /nfsroot +#define CONFIG_BOOTFILE your.uImage + +#define CONFIG_SERVERIP 192.168.1.1 +#define CONFIG_GATEWAYIP 192.168.1.1 +#define CONFIG_NETMASK 255.255.255.0 + +#define CONFIG_LOADADDR 200000 /*default location for tftp and bootm*/ + +#define CONFIG_BOOTDELAY 10 /* -1 disables auto-boot */ +#undef CONFIG_BOOTARGS /* the boot command will set bootargs*/ + +#define CONFIG_BAUDRATE 115200 + +#define CONFIG_EXTRA_ENV_SETTINGS \ + "netdev=eth0\0" \ + "consoledev=ttyS0\0" \ + "ramdiskaddr=600000\0" \ + "ramdiskfile=your.ramdisk.u-boot\0" \ + "fdtaddr=400000\0" \ + "fdtfile=your.fdt.dtb\0" \ + "nfsargs=setenv bootargs root=/dev/nfs rw " \ + "nfsroot=$serverip:$rootpath " \ + "ip=$ipaddr:$serverip:$gatewayip:$netmask:$hostname:$netdev:off " \ + "console=$consoledev,$baudrate $othbootargs\0" \ + "ramargs=setenv bootargs root=/dev/ram rw " \ + "console=$consoledev,$baudrate $othbootargs\0" \ + + +#define CONFIG_NFSBOOTCOMMAND \ + "run nfsargs;" \ + "tftp $loadaddr $bootfile;" \ + "tftp $fdtaddr $fdtfile;" \ + "bootm $loadaddr - $fdtaddr" + + +#define CONFIG_RAMBOOTCOMMAND \ + "run ramargs;" \ + "tftp $ramdiskaddr $ramdiskfile;" \ + "tftp $loadaddr $bootfile;" \ + "bootm $loadaddr $ramdiskaddr" + +#define CONFIG_BOOTCOMMAND CONFIG_NFSBOOTCOMMAND + +#endif /* __CONFIG_H */ From ffa621a0d12a1ccd81c936c567f8917a213787a8 Mon Sep 17 00:00:00 2001 From: Andy Fleming Date: Sat, 24 Feb 2007 01:08:13 -0600 Subject: [PATCH 31/47] Cleaned up some 85xx PCI bugs * Cleaned up the CDS PCI Config Tables and added NULL entries to the end * Fixed PCIe LAWBAR assignemt to use the cpu-relative address * Fixed 85xx PCI code to assign powar region sizes based on the config values (rather than hard-coding them) * Fixed the 8548 CDS PCI2 IO to once again have 0 as the base address Signed-off-by: Andy Fleming --- board/cds/mpc8541cds/mpc8541cds.c | 9 ++++++--- board/cds/mpc8548cds/init.S | 2 +- board/cds/mpc8548cds/mpc8548cds.c | 9 ++++++--- board/cds/mpc8555cds/mpc8555cds.c | 11 +++++++---- cpu/mpc85xx/pci.c | 8 ++++---- include/configs/MPC8548CDS.h | 8 ++++---- 6 files changed, 28 insertions(+), 19 deletions(-) diff --git a/board/cds/mpc8541cds/mpc8541cds.c b/board/cds/mpc8541cds/mpc8541cds.c index a42904cf7..419232483 100644 --- a/board/cds/mpc8541cds/mpc8541cds.c +++ b/board/cds/mpc8541cds/mpc8541cds.c @@ -477,11 +477,14 @@ void dummy_func(struct pci_controller* hose, pci_dev_t dev, struct pci_config_ta static struct pci_config_table pci_mpc85xxcds_config_table[] = { {0x10e3, 0x0513, PCI_ANY_ID, 1, 3, PCI_ANY_ID, dummy_func, {0,0,0}}, {0x1106, 0x0686, PCI_ANY_ID, 1, 2, 0, mpc85xx_config_via, {0,0,0}}, - {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, mpc85xx_config_via_usbide, {0,0,0}}, + {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, + mpc85xx_config_via_usbide, {0,0,0}}, {0x1105, 0x3038, PCI_ANY_ID, 1, 2, 2, mpc85xx_config_via_usb, {0,0,0}}, {0x1106, 0x3038, PCI_ANY_ID, 1, 2, 3, mpc85xx_config_via_usb2, {0,0,0}}, - {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, mpc85xx_config_via_power, {0,0,0}}, - {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}} + {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, + mpc85xx_config_via_power, {0,0,0}}, + {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}}, + {}, }; static struct pci_controller hose[] = { diff --git a/board/cds/mpc8548cds/init.S b/board/cds/mpc8548cds/init.S index 34ca711bd..d468f5b61 100644 --- a/board/cds/mpc8548cds/init.S +++ b/board/cds/mpc8548cds/init.S @@ -248,7 +248,7 @@ tlb1_entry: #define LAWBAR6 ((CFG_PEX_MEM_BASE>>12) & 0xfffff) #define LAWAR6 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_512M)) -#define LAWBAR7 ((CFG_PEX_IO_BASE>>12) & 0xfffff) +#define LAWBAR7 ((CFG_PEX_IO_PHYS>>12) & 0xfffff) #define LAWAR7 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_16M)) #define LAWBAR8 ((CFG_RIO_MEM_BASE>>12) & 0xfffff) diff --git a/board/cds/mpc8548cds/mpc8548cds.c b/board/cds/mpc8548cds/mpc8548cds.c index 0d3fcebfe..929ff2e66 100644 --- a/board/cds/mpc8548cds/mpc8548cds.c +++ b/board/cds/mpc8548cds/mpc8548cds.c @@ -310,11 +310,14 @@ void dummy_func(struct pci_controller* hose, pci_dev_t dev, struct pci_config_ta static struct pci_config_table pci_mpc85xxcds_config_table[] = { {0x10e3, 0x0513, PCI_ANY_ID, 1, 3, PCI_ANY_ID, dummy_func, {0,0,0}}, {0x1106, 0x0686, PCI_ANY_ID, 1, 2, 0, mpc85xx_config_via, {0,0,0}}, - {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, mpc85xx_config_via_usbide, {0,0,0}}, + {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, + mpc85xx_config_via_usbide, {0,0,0}}, {0x1105, 0x3038, PCI_ANY_ID, 1, 2, 2, mpc85xx_config_via_usb, {0,0,0}}, {0x1106, 0x3038, PCI_ANY_ID, 1, 2, 3, mpc85xx_config_via_usb2, {0,0,0}}, - {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, mpc85xx_config_via_power, {0,0,0}}, - {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}} + {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, + mpc85xx_config_via_power, {0,0,0}}, + {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}}, + {}, }; static struct pci_controller hose[] = { diff --git a/board/cds/mpc8555cds/mpc8555cds.c b/board/cds/mpc8555cds/mpc8555cds.c index d980ea631..704bf0316 100644 --- a/board/cds/mpc8555cds/mpc8555cds.c +++ b/board/cds/mpc8555cds/mpc8555cds.c @@ -474,11 +474,14 @@ void dummy_func(struct pci_controller* hose, pci_dev_t dev, struct pci_config_ta static struct pci_config_table pci_mpc85xxcds_config_table[] = { {0x10e3, 0x0513, PCI_ANY_ID, 1, 3, PCI_ANY_ID, dummy_func, {0,0,0}}, {0x1106, 0x0686, PCI_ANY_ID, 1, 2, 0, mpc85xx_config_via, {0,0,0}}, - {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, mpc85xx_config_via_usbide, {0,0,0}}, + {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, + mpc85xx_config_via_usbide, {0,0,0}}, {0x1105, 0x3038, PCI_ANY_ID, 1, 2, 2, mpc85xx_config_via_usb, {0,0,0}}, {0x1106, 0x3038, PCI_ANY_ID, 1, 2, 3, mpc85xx_config_via_usb2, {0,0,0}}, - {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, mpc85xx_config_via_power, {0,0,0}}, - {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}} + {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, + mpc85xx_config_via_power, {0,0,0}}, + {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}}, + {}, }; @@ -487,7 +490,7 @@ static struct pci_controller hose[] = { config_table: pci_mpc85xxcds_config_table, }, #ifdef CONFIG_MPC85XX_PCI2 - { } + {}, #endif }; diff --git a/cpu/mpc85xx/pci.c b/cpu/mpc85xx/pci.c index 84f839ae1..3c1a323aa 100644 --- a/cpu/mpc85xx/pci.c +++ b/cpu/mpc85xx/pci.c @@ -90,14 +90,14 @@ pci_mpc85xx_init(struct pci_controller *board_hose) pcix->powbar1 = (CFG_PCI1_MEM_PHYS >> 12) & 0x000fffff; pcix->powbear1 = 0x00000000; pcix->powar1 = (POWAR_EN | POWAR_MEM_READ | - POWAR_MEM_WRITE | POWAR_MEM_512M); + POWAR_MEM_WRITE | (__ilog2(CFG_PCI1_MEM_SIZE) - 1)); pcix->potar2 = (CFG_PCI1_IO_BASE >> 12) & 0x000fffff; pcix->potear2 = 0x00000000; pcix->powbar2 = (CFG_PCI1_IO_PHYS >> 12) & 0x000fffff; pcix->powbear2 = 0x00000000; pcix->powar2 = (POWAR_EN | POWAR_IO_READ | - POWAR_IO_WRITE | POWAR_IO_1M); + POWAR_IO_WRITE | (__ilog2(CFG_PCI1_IO_SIZE) - 1)); pcix->pitar1 = 0x00000000; pcix->piwbar1 = 0x00000000; @@ -175,14 +175,14 @@ pci_mpc85xx_init(struct pci_controller *board_hose) pcix2->powbar1 = (CFG_PCI2_MEM_PHYS >> 12) & 0x000fffff; pcix2->powbear1 = 0x00000000; pcix2->powar1 = (POWAR_EN | POWAR_MEM_READ | - POWAR_MEM_WRITE | POWAR_MEM_512M); + POWAR_MEM_WRITE | (__ilog2(CFG_PCI2_MEM_SIZE) - 1)); pcix2->potar2 = (CFG_PCI2_IO_BASE >> 12) & 0x000fffff; pcix2->potear2 = 0x00000000; pcix2->powbar2 = (CFG_PCI2_IO_PHYS >> 12) & 0x000fffff; pcix2->powbear2 = 0x00000000; pcix2->powar2 = (POWAR_EN | POWAR_IO_READ | - POWAR_IO_WRITE | POWAR_IO_1M); + POWAR_IO_WRITE | (__ilog2(CFG_PCI2_IO_SIZE) - 1)); pcix2->pitar1 = 0x00000000; pcix2->piwbar1 = 0x00000000; diff --git a/include/configs/MPC8548CDS.h b/include/configs/MPC8548CDS.h index 14936c28a..680009d60 100644 --- a/include/configs/MPC8548CDS.h +++ b/include/configs/MPC8548CDS.h @@ -352,16 +352,16 @@ extern unsigned long get_clock_freq(void); #define CFG_PCI2_MEM_BASE 0x90000000 #define CFG_PCI2_MEM_PHYS CFG_PCI2_MEM_BASE #define CFG_PCI2_MEM_SIZE 0x10000000 /* 256M */ -#define CFG_PCI2_IO_BASE 0xe2800000 +#define CFG_PCI2_IO_BASE 0x00000000 #define CFG_PCI2_IO_PHYS 0xe2800000 #define CFG_PCI2_IO_SIZE 0x00800000 /* 8M */ #define CFG_PEX_MEM_BASE 0xa0000000 #define CFG_PEX_MEM_PHYS CFG_PEX_MEM_BASE #define CFG_PEX_MEM_SIZE 0x20000000 /* 512M */ -#define CFG_PEX_IO_BASE 0xe3000000 -#define CFG_PEX_IO_PHYS CFG_PEX_IO_BASE -#define CFG_PEX_IO_SIZE 0x1000000 /* 16M */ +#define CFG_PEX_IO_BASE 0x00000000 +#define CFG_PEX_IO_PHYS 0xe3000000 +#define CFG_PEX_IO_SIZE 0x01000000 /* 16M */ /* * RapidIO MMU From 35171dc04e028ecacc23ad916a66295472555dbf Mon Sep 17 00:00:00 2001 From: Dan Malek Date: Fri, 5 Jan 2007 09:15:34 +0100 Subject: [PATCH 32/47] Add support for STX GP3SSA (stxssa) Board Signed-off-by Dan Malek, --- MAINTAINERS | 3 +- Makefile | 3 + board/stxssa/Makefile | 48 +++++ board/stxssa/config.mk | 34 ++++ board/stxssa/init.S | 256 ++++++++++++++++++++++++ board/stxssa/stxssa.c | 397 +++++++++++++++++++++++++++++++++++++ board/stxssa/u-boot.lds | 158 +++++++++++++++ include/configs/stxssa.h | 418 +++++++++++++++++++++++++++++++++++++++ 8 files changed, 1316 insertions(+), 1 deletion(-) create mode 100644 board/stxssa/Makefile create mode 100644 board/stxssa/config.mk create mode 100644 board/stxssa/init.S create mode 100644 board/stxssa/stxssa.c create mode 100644 board/stxssa/u-boot.lds create mode 100644 include/configs/stxssa.h diff --git a/MAINTAINERS b/MAINTAINERS index c3c73da4f..d145ecdad 100644 --- a/MAINTAINERS +++ b/MAINTAINERS @@ -221,9 +221,10 @@ Jon Loeliger MPC8641HPCN MPC8641D -Dan Malek +Dan Malek STxGP3 MPC85xx + STxSSA MPC85xx STxXTc MPC8xx Eran Man diff --git a/Makefile b/Makefile index 94cda54c7..2fe9a4682 100644 --- a/Makefile +++ b/Makefile @@ -1771,6 +1771,9 @@ sbc8560_66_config: unconfig stxgp3_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx stxgp3 +stxssa_config: unconfig + @$(MKCONFIG) $(@:_config=) ppc mpc85xx stxssa + TQM8540_config \ TQM8541_config \ TQM8555_config \ diff --git a/board/stxssa/Makefile b/board/stxssa/Makefile new file mode 100644 index 000000000..5d8ea3494 --- /dev/null +++ b/board/stxssa/Makefile @@ -0,0 +1,48 @@ +# +# (C) Copyright 2001 +# Wolfgang Denk, DENX Software Engineering, wd@denx.de. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +include $(TOPDIR)/config.mk + +LIB = lib$(BOARD).a + +OBJS := $(BOARD).o +SOBJS := init.o +#SOBJS := + +$(LIB): $(OBJS) $(SOBJS) + $(AR) crv $@ $(OBJS) + +clean: + rm -f $(OBJS) $(SOBJS) + +distclean: clean + rm -f $(LIB) core *.bak .depend + +######################################################################### + +.depend: Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c) + $(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@ + +-include .depend + +######################################################################### diff --git a/board/stxssa/config.mk b/board/stxssa/config.mk new file mode 100644 index 000000000..30f42c53a --- /dev/null +++ b/board/stxssa/config.mk @@ -0,0 +1,34 @@ +# Modified by Xianghua Xiao, X.Xiao@motorola.com +# (C) Copyright 2002,2003 Motorola Inc. +# +# Copied from ADS85xx for STx GP3 - Dan Malek +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +# +# default CCARBAR is at 0xff700000 +# assume U-Boot is less than 0.5MB +# U-Boot is less than 256K, so push +# it further up into the flash +# +TEXT_BASE = 0xfffC0000 + +PLATFORM_CPPFLAGS += -DCONFIG_MPC85xx=1 +PLATFORM_CPPFLAGS += -DCONFIG_E500=1 diff --git a/board/stxssa/init.S b/board/stxssa/init.S new file mode 100644 index 000000000..a1a8d9e0c --- /dev/null +++ b/board/stxssa/init.S @@ -0,0 +1,256 @@ +/* + * Copyright (C) 2005 Embedded Alley Solutions, Inc. + * Dan Malek + * Copied from STx GP3. + * Updates for Silicon Tx GP3 SSA. We only support 32-bit flash + * and DDR with SPD EEPROM configuration. + * + * Copyright 2004 Freescale Semiconductor. + * Copyright (C) 2002,2003, Motorola Inc. + * Xianghua Xiao + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include +#include +#include +#include +#include +#include + + +/* + * TLB0 and TLB1 Entries + * + * Out of reset, TLB1's Entry 0 maps the highest 4K for CCSRBAR. + * However, CCSRBAR is then relocated to CFG_CCSRBAR right after + * these TLB entries are established. + * + * The TLB entries for DDR are dynamically setup in spd_sdram() + * and use TLB1 Entries 8 through 15 as needed according to the + * size of DDR memory. + * + * MAS0: tlbsel, esel, nv + * MAS1: valid, iprot, tid, ts, tsize + * MAS2: epn, sharen, x0, x1, w, i, m, g, e + * MAS3: rpn, u0-u3, ux, sx, uw, sw, ur, sr + */ + +#define entry_start \ + mflr r1 ; \ + bl 0f ; + +#define entry_end \ +0: mflr r0 ; \ + mtlr r1 ; \ + blr ; + + + .section .bootpg, "ax" + .globl tlb1_entry +tlb1_entry: + entry_start + + /* + * Number of TLB0 and TLB1 entries in the following table + */ + .long 12 + +#if (CFG_CCSRBAR_DEFAULT != CFG_CCSRBAR) + /* + * TLB0 4K Non-cacheable, guarded + * 0xff700000 4K Initial CCSRBAR mapping + * + * This ends up at a TLB0 Index==0 entry, and must not collide + * with other TLB0 Entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,0,1,0,1,0,1) +#else +#error("Update the number of table entries in tlb1_entry") +#endif + + /* + * TLB0 16K Cacheable, non-guarded + * 0xd001_0000 16K Temporary Global data for initialization + * + * Use four 4K TLB0 entries. These entries must be cacheable + * as they provide the bootstrap memory before the memory + * controler and real memory have been configured. + * + * These entries end up at TLB0 Indicies 0x10, 0x14, 0x18 and 0x1c, + * and must not collide with other TLB0 entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR), \ + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR), \ + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 4 * 1024), \ + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 4 * 1024), \ + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024), \ + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 8 * 1024), \ + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 12 * 1024), \ + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 12 * 1024), \ + 0,0,0,0,0,1,0,1,0,1) + + + /* + * TLB 0: 64M Non-cacheable, guarded + * 0xfc000000 6M4 FLASH + * Out of reset this entry is only 4K. + */ + .long TLB1_MAS0(1, 0, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_FLASH_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_FLASH_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 1: 256M Non-cacheable, guarded + * 0x80000000 256M PCI1 MEM First half + */ + .long TLB1_MAS0(1, 1, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 2: 256M Non-cacheable, guarded + * 0x90000000 256M PCI1 MEM Second half + */ + .long TLB1_MAS0(1, 2, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE + 0x10000000), \ + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE + 0x10000000), \ + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 3: 256M Non-cacheable, guarded + * 0xa0000000 256M PCI2 MEM First half + */ + .long TLB1_MAS0(1, 3, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 4: 256M Non-cacheable, guarded + * 0xb0000000 256M PCI2 MEM Second half + */ + .long TLB1_MAS0(1, 4, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE + 0x10000000), \ + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE + 0x10000000), \ + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 5: 64M Non-cacheable, guarded + * 0xe000_0000 1M CCSRBAR + * 0xe200_0000 16M PCI1 IO + * 0xe300_0000 16M PCI2 IO + */ + .long TLB1_MAS0(1, 5, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 6: 256M Non-cacheable, guarded + * 0xf0000000 Local bus expansion option. + * 0xfb000000 Configuration Latch register (one word) + * 0xfc000000 Up to 64M flash + */ + .long TLB1_MAS0(1, 7, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_OPTION_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_OPTION_BASE), 0,0,0,0,0,1,0,1,0,1) + entry_end + +/* + * LAW(Local Access Window) configuration: + * + * 0x0000_0000 0x7fff_ffff DDR 2G + * 0x8000_0000 0x9fff_ffff PCI1 MEM 512M + * 0xa000_0000 0xbfff_ffff PCI2 MEM 512M + * 0xe000_0000 0xe000_ffff CCSR 1M + * 0xe200_0000 0xe2ff_ffff PCI1 IO 16M + * 0xe300_0000 0xe3ff_ffff PCI2 IO 16M + * 0xf000_0000 0xfaff_ffff Local bus 128M + * 0xfb00_0000 0xfb00_ffff Config Latch 64K + * 0xfc00_0000 0xffff_ffff FLASH (boot bank) 64M + * + * Notes: + * CCSRBAR and L2-as-SRAM don't need a configured Local Access Window. + * If flash is 8M at default position (last 8M), no LAW needed. + */ + +#if !defined(CONFIG_SPD_EEPROM) +#define LAWBAR0 ((CFG_DDR_SDRAM_BASE>>12) & 0xfffff) +#define LAWAR0 (LAWAR_EN | LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) +#else +#define LAWBAR0 0 +#define LAWAR0 ((LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN) +#endif + +#define LAWBAR1 ((CFG_PCI1_MEM_BASE>>12) & 0xfffff) +#define LAWAR1 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M)) + +#define LAWBAR2 ((CFG_PCI2_MEM_BASE>>12) & 0xfffff) +#define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M)) + +#define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M)) + +#define LAWBAR4 ((CFG_PCI2_IO_PHYS>>12) & 0xfffff) +#define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M)) + +/* Map the whole localbus, including flash and reset latch. +*/ +#define LAWBAR5 ((CFG_LBC_OPTION_BASE>>12) & 0xfffff) +#define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) + + + .section .bootpg, "ax" + .globl law_entry +law_entry: + entry_start + .long 6 + .long LAWBAR0,LAWAR0,LAWBAR1,LAWAR1,LAWBAR2,LAWAR2,LAWBAR3,LAWAR3 + .long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5 + entry_end diff --git a/board/stxssa/stxssa.c b/board/stxssa/stxssa.c new file mode 100644 index 000000000..87d3d6f99 --- /dev/null +++ b/board/stxssa/stxssa.c @@ -0,0 +1,397 @@ +/* + * (C) Copyright 2005, Embedded Alley Solutions, Inc. + * Dan Malek, + * Copied from STx GP3. + * Updates for Silicon Tx GP3 SSA + * + * (C) Copyright 2003,Motorola Inc. + * Xianghua Xiao, (X.Xiao@motorola.com) + * + * (C) Copyright 2002 Scott McNutt + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + + +extern long int spd_sdram (void); + +#include +#include +#include +#include +#include +#include +#include +#include + +long int fixed_sdram (void); + +/* + * I/O Port configuration table + * + * if conf is 1, then that port pin will be configured at boot time + * according to the five values podr/pdir/ppar/psor/pdat for that entry + */ + +const iop_conf_t iop_conf_tab[4][32] = { + + /* Port A configuration */ + { /* conf ppar psor pdir podr pdat */ + /* PA31 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 TxENB */ + /* PA30 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 TxClav */ + /* PA29 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 TxSOC */ + /* PA28 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 RxENB */ + /* PA27 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 RxSOC */ + /* PA26 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 RxClav */ + /* PA25 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[0] */ + /* PA24 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[1] */ + /* PA23 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[2] */ + /* PA22 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[3] */ + /* PA21 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[4] */ + /* PA20 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[5] */ + /* PA19 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[6] */ + /* PA18 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[7] */ + /* PA17 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[7] */ + /* PA16 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[6] */ + /* PA15 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[5] */ + /* PA14 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[4] */ + /* PA13 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[3] */ + /* PA12 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[2] */ + /* PA11 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[1] */ + /* PA10 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[0] */ + /* PA9 */ { 0, 1, 1, 1, 0, 0 }, /* FCC1 L1TXD */ + /* PA8 */ { 0, 1, 1, 0, 0, 0 }, /* FCC1 L1RXD */ + /* PA7 */ { 0, 0, 0, 1, 0, 0 }, /* PA7 */ + /* PA6 */ { 0, 1, 1, 1, 0, 0 }, /* TDM A1 L1RSYNC */ + /* PA5 */ { 0, 0, 0, 1, 0, 0 }, /* PA5 */ + /* PA4 */ { 0, 0, 0, 1, 0, 0 }, /* PA4 */ + /* PA3 */ { 0, 0, 0, 1, 0, 0 }, /* PA3 */ + /* PA2 */ { 0, 0, 0, 1, 0, 0 }, /* PA2 */ + /* PA1 */ { 1, 0, 0, 0, 0, 0 }, /* FREERUN */ + /* PA0 */ { 0, 0, 0, 1, 0, 0 } /* PA0 */ + }, + + /* Port B configuration */ + { /* conf ppar psor pdir podr pdat */ + /* PB31 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TX_ER */ + /* PB30 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RX_DV */ + /* PB29 */ { 1, 1, 1, 1, 0, 0 }, /* FCC2 MII TX_EN */ + /* PB28 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RX_ER */ + /* PB27 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII COL */ + /* PB26 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII CRS */ + /* PB25 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TxD[3] */ + /* PB24 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TxD[2] */ + /* PB23 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TxD[1] */ + /* PB22 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TxD[0] */ + /* PB21 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RxD[0] */ + /* PB20 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RxD[1] */ + /* PB19 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RxD[2] */ + /* PB18 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RxD[3] */ + /* PB17 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RX_DIV */ + /* PB16 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RX_ERR */ + /* PB15 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TX_ERR */ + /* PB14 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TX_EN */ + /* PB13 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:COL */ + /* PB12 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:CRS */ + /* PB11 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RXD */ + /* PB10 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RXD */ + /* PB9 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RXD */ + /* PB8 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RXD */ + /* PB7 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TXD */ + /* PB6 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TXD */ + /* PB5 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TXD */ + /* PB4 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TXD */ + /* PB3 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PB2 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PB1 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PB0 */ { 0, 0, 0, 0, 0, 0 } /* pin doesn't exist */ + }, + + /* Port C */ + { /* conf ppar psor pdir podr pdat */ + /* PC31 */ { 0, 0, 0, 1, 0, 0 }, /* PC31 */ + /* PC30 */ { 0, 0, 0, 1, 0, 0 }, /* PC30 */ + /* PC29 */ { 0, 1, 1, 0, 0, 0 }, /* SCC1 EN *CLSN */ + /* PC28 */ { 0, 0, 0, 1, 0, 0 }, /* PC28 */ + /* PC27 */ { 0, 0, 0, 1, 0, 0 }, /* UART Clock in */ + /* PC26 */ { 0, 0, 0, 1, 0, 0 }, /* PC26 */ + /* PC25 */ { 0, 0, 0, 1, 0, 0 }, /* PC25 */ + /* PC24 */ { 0, 0, 0, 1, 0, 0 }, /* PC24 */ + /* PC23 */ { 0, 1, 0, 1, 0, 0 }, /* ATMTFCLK */ + /* PC22 */ { 0, 1, 0, 0, 0, 0 }, /* ATMRFCLK */ + /* PC21 */ { 0, 1, 0, 0, 0, 0 }, /* SCC1 EN RXCLK */ + /* PC20 */ { 0, 1, 0, 0, 0, 0 }, /* SCC1 EN TXCLK */ + /* PC19 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RX_CLK CLK13 */ + /* PC18 */ { 1, 1, 0, 0, 0, 0 }, /* FCC Tx Clock (CLK14) */ + /* PC17 */ { 0, 0, 0, 1, 0, 0 }, /* PC17 */ + /* PC16 */ { 0, 1, 0, 0, 0, 0 }, /* FCC Tx Clock (CLK16) */ + /* PC15 */ { 0, 1, 0, 0, 0, 0 }, /* PC15 */ + /* PC14 */ { 0, 1, 0, 0, 0, 0 }, /* SCC1 EN *CD */ + /* PC13 */ { 0, 0, 0, 1, 0, 0 }, /* PC13 */ + /* PC12 */ { 0, 1, 0, 1, 0, 0 }, /* PC12 */ + /* PC11 */ { 0, 0, 0, 1, 0, 0 }, /* LXT971 transmit control */ + /* PC10 */ { 0, 0, 0, 1, 0, 0 }, /* FETHMDC */ + /* PC9 */ { 0, 0, 0, 0, 0, 0 }, /* FETHMDIO */ + /* PC8 */ { 0, 0, 0, 1, 0, 0 }, /* PC8 */ + /* PC7 */ { 0, 0, 0, 1, 0, 0 }, /* PC7 */ + /* PC6 */ { 0, 0, 0, 1, 0, 0 }, /* PC6 */ + /* PC5 */ { 0, 0, 0, 1, 0, 0 }, /* PC5 */ + /* PC4 */ { 0, 0, 0, 1, 0, 0 }, /* PC4 */ + /* PC3 */ { 0, 0, 0, 1, 0, 0 }, /* PC3 */ + /* PC2 */ { 0, 0, 0, 1, 0, 1 }, /* ENET FDE */ + /* PC1 */ { 0, 0, 0, 1, 0, 0 }, /* ENET DSQE */ + /* PC0 */ { 0, 0, 0, 1, 0, 0 }, /* ENET LBK */ + }, + + /* Port D */ + { /* conf ppar psor pdir podr pdat */ + /* PD31 */ { 0, 1, 0, 0, 0, 0 }, /* SCC1 EN RxD */ + /* PD30 */ { 0, 1, 1, 1, 0, 0 }, /* SCC1 EN TxD */ + /* PD29 */ { 0, 1, 0, 1, 0, 0 }, /* SCC1 EN TENA */ + /* PD28 */ { 1, 1, 0, 0, 0, 0 }, /* SCC2 RxD */ + /* PD27 */ { 1, 1, 0, 1, 0, 0 }, /* SCC2 TxD */ + /* PD26 */ { 0, 0, 0, 1, 0, 0 }, /* PD26 */ + /* PD25 */ { 0, 0, 0, 1, 0, 0 }, /* PD25 */ + /* PD24 */ { 0, 0, 0, 1, 0, 0 }, /* PD24 */ + /* PD23 */ { 0, 0, 0, 1, 0, 0 }, /* PD23 */ + /* PD22 */ { 0, 0, 0, 1, 0, 0 }, /* PD22 */ + /* PD21 */ { 0, 0, 0, 1, 0, 0 }, /* PD21 */ + /* PD20 */ { 0, 0, 0, 1, 0, 0 }, /* PD20 */ + /* PD19 */ { 0, 0, 0, 1, 0, 0 }, /* PD19 */ + /* PD18 */ { 0, 0, 0, 1, 0, 0 }, /* PD18 */ + /* PD17 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXPRTY */ + /* PD16 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXPRTY */ + /* PD15 */ { 1, 1, 1, 0, 1, 0 }, /* I2C SDA */ + /* PD14 */ { 1, 1, 1, 0, 0, 0 }, /* I2C CLK */ + /* PD13 */ { 0, 0, 0, 0, 0, 0 }, /* PD13 */ + /* PD12 */ { 0, 0, 0, 0, 0, 0 }, /* PD12 */ + /* PD11 */ { 0, 0, 0, 0, 0, 0 }, /* PD11 */ + /* PD10 */ { 0, 0, 0, 0, 0, 0 }, /* PD10 */ + /* PD9 */ { 0, 1, 0, 1, 0, 0 }, /* SMC1 TXD */ + /* PD8 */ { 0, 1, 0, 0, 0, 0 }, /* SMC1 RXD */ + /* PD7 */ { 0, 0, 0, 1, 0, 1 }, /* PD7 */ + /* PD6 */ { 0, 0, 0, 1, 0, 1 }, /* PD6 */ + /* PD5 */ { 0, 0, 0, 1, 0, 1 }, /* PD5 */ + /* PD4 */ { 0, 0, 0, 1, 0, 1 }, /* PD4 */ + /* PD3 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PD2 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PD1 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PD0 */ { 0, 0, 0, 0, 0, 0 } /* pin doesn't exist */ + } +}; + +static uint64_t next_led_update; +static uint led_bit; + +void +reset_phy(void) +{ + volatile uint *blatch; + int i; + + blatch = (volatile uint *)CFG_LBC_CFGLATCH_BASE; + + /* reset Giga bit Ethernet port if needed here */ + +#if 1 + *blatch &= ~0x000000c0; + udelay(100); +#else + *blatch = 0; + asm("eieio"); + for (i=0; i<1000; i++) + udelay(1000); +#endif + *blatch = 0x000000c1; /* Light one led, too */ + udelay(1000); + +#if 0 /* This is the port we really want to use for debugging. */ + /* reset the CPM FEC port */ +#if (CONFIG_ETHER_INDEX == 2) + bcsr->bcsr2 &= ~FETH2_RST; + udelay(2); + bcsr->bcsr2 |= FETH2_RST; + udelay(1000); +#elif (CONFIG_ETHER_INDEX == 3) + bcsr->bcsr3 &= ~FETH3_RST; + udelay(2); + bcsr->bcsr3 |= FETH3_RST; + udelay(1000); +#endif +#if defined(CONFIG_MII) && defined(CONFIG_ETHER_ON_FCC) + /* reset PHY */ + miiphy_reset("FCC1 ETHERNET", 0x0); + + /* change PHY address to 0x02 */ + bb_miiphy_write(NULL, 0, PHY_MIPSCR, 0xf028); + + bb_miiphy_write(NULL, 0x02, PHY_BMCR, + PHY_BMCR_AUTON | PHY_BMCR_RST_NEG); +#endif /* CONFIG_MII */ +#endif +} + +int +board_early_init_f(void) +{ +#if defined(CONFIG_PCI) + volatile immap_t *immr = (immap_t *)CFG_IMMR; + volatile ccsr_pcix_t *pci = &immr->im_pcix; + + pci->peer &= 0xfffffffdf; /* disable master abort */ +#endif + + /* Why is the phy reset done _after_ the ethernet + * initialization in lib_ppc/board.c? + * Do it here so it's done before the TSECs are used. + */ + reset_phy(); + + return 0; +} + +int +checkboard(void) +{ + printf ("Board: Silicon Tx GPPP SSA Board\n"); + return (0); +} + +/* Blinkin' LEDS for Robert. +*/ +void +show_activity(int flag) +{ + volatile uint *blatch; + + if (next_led_update > get_ticks()) + return; + + blatch = (volatile uint *)CFG_LBC_CFGLATCH_BASE; + + led_bit >>= 1; + if (led_bit == 0) + led_bit = 0x08; + *blatch = (0xc0 | led_bit); + eieio(); + next_led_update += (get_tbclk() / 4); +} + +long int +initdram (int board_type) +{ + long dram_size = 0; + extern long spd_sdram (void); + volatile immap_t *immap = (immap_t *)CFG_IMMR; + +#if defined(CONFIG_DDR_DLL) + { + volatile ccsr_gur_t *gur= &immap->im_gur; + uint temp_ddrdll = 0; + + /* Work around to stabilize DDR DLL */ + temp_ddrdll = gur->ddrdllcr; + gur->ddrdllcr = ((temp_ddrdll & 0xff) << 16) | 0x80000000; + asm("sync;isync;msync"); + } +#endif + + dram_size = spd_sdram (); + +#if defined(CONFIG_DDR_ECC) + /* Initialize and enable DDR ECC. + */ + ddr_enable_ecc(dram_size); +#endif + + return dram_size; +} + + +#if defined(CFG_DRAM_TEST) +int testdram (void) +{ + uint *pstart = (uint *) CFG_MEMTEST_START; + uint *pend = (uint *) CFG_MEMTEST_END; + uint *p; + + printf("SDRAM test phase 1:\n"); + for (p = pstart; p < pend; p++) + *p = 0xaaaaaaaa; + + for (p = pstart; p < pend; p++) { + if (*p != 0xaaaaaaaa) { + printf ("SDRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("SDRAM test phase 2:\n"); + for (p = pstart; p < pend; p++) + *p = 0x55555555; + + for (p = pstart; p < pend; p++) { + if (*p != 0x55555555) { + printf ("SDRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("SDRAM test passed.\n"); + return 0; +} +#endif + +#if defined(CONFIG_PCI) + +/* + * Initialize PCI Devices, report devices found. + */ + +#ifndef CONFIG_PCI_PNP +static struct pci_config_table pci_stxgp3_config_table[] = { + { PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, + PCI_IDSEL_NUMBER, PCI_ANY_ID, + pci_cfgfunc_config_device, { PCI_ENET0_IOADDR, + PCI_ENET0_MEMADDR, + PCI_COMMAND_MEMORY | PCI_COMMAND_MASTER + } }, + { } +}; +#endif + + +static struct pci_controller hose = { +#ifndef CONFIG_PCI_PNP + config_table: pci_stxgp3_config_table, +#endif +}; + +#endif /* CONFIG_PCI */ + + +void +pci_init_board(void) +{ +#ifdef CONFIG_PCI + extern void pci_mpc85xx_init(struct pci_controller *hose); + + pci_mpc85xx_init(&hose); +#endif /* CONFIG_PCI */ +} diff --git a/board/stxssa/u-boot.lds b/board/stxssa/u-boot.lds new file mode 100644 index 000000000..95ecf66a8 --- /dev/null +++ b/board/stxssa/u-boot.lds @@ -0,0 +1,158 @@ +/* + * (C) Copyright 2005 Embedded Alley Solutions, Inc. + * Dan Malek, + * Copied from STx GP3. + * Updates for Silicon Tx GP3 SSA. + * + * (C) Copyright 2002,2003,Motorola,Inc. + * Xianghua Xiao, X.Xiao@motorola.com. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +OUTPUT_ARCH(powerpc) +SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib); +/* Do we need any of these for elf? + __DYNAMIC = 0; */ +SECTIONS +{ + .resetvec 0xFFFFFFFC : + { + *(.resetvec) + } = 0xffff + + .bootpg 0xFFFFF000 : + { + cpu/mpc85xx/start.o (.bootpg) + board/stxssa/init.o (.bootpg) + } = 0xffff + + /* Read-only sections, merged into text segment: */ + . = + SIZEOF_HEADERS; + .interp : { *(.interp) } + .hash : { *(.hash) } + .dynsym : { *(.dynsym) } + .dynstr : { *(.dynstr) } + .rel.text : { *(.rel.text) } + .rela.text : { *(.rela.text) } + .rel.data : { *(.rel.data) } + .rela.data : { *(.rela.data) } + .rel.rodata : { *(.rel.rodata) } + .rela.rodata : { *(.rela.rodata) } + .rel.got : { *(.rel.got) } + .rela.got : { *(.rela.got) } + .rel.ctors : { *(.rel.ctors) } + .rela.ctors : { *(.rela.ctors) } + .rel.dtors : { *(.rel.dtors) } + .rela.dtors : { *(.rela.dtors) } + .rel.bss : { *(.rel.bss) } + .rela.bss : { *(.rela.bss) } + .rel.plt : { *(.rel.plt) } + .rela.plt : { *(.rela.plt) } + .init : { *(.init) } + .plt : { *(.plt) } + .text : + { + cpu/mpc85xx/start.o (.text) + board/stxssa/init.o (.text) + cpu/mpc85xx/commproc.o (.text) + cpu/mpc85xx/traps.o (.text) + cpu/mpc85xx/interrupts.o (.text) + cpu/mpc85xx/serial_scc.o (.text) + cpu/mpc85xx/ether_fcc.o (.text) + cpu/mpc85xx/cpu_init.o (.text) + cpu/mpc85xx/cpu.o (.text) + cpu/mpc85xx/speed.o (.text) + cpu/mpc85xx/spd_sdram.o (.text) + common/dlmalloc.o (.text) + lib_generic/crc32.o (.text) + lib_ppc/extable.o (.text) + lib_generic/zlib.o (.text) + *(.text) + *(.fixup) + *(.got1) + } + _etext = .; + PROVIDE (etext = .); + .rodata : + { + *(.rodata) + *(.rodata1) + *(.rodata.str1.4) + *(.eh_frame) + } + .fini : { *(.fini) } =0 + .ctors : { *(.ctors) } + .dtors : { *(.dtors) } + + /* Read-write section, merged into data segment: */ + . = (. + 0x00FF) & 0xFFFFFF00; + _erotext = .; + PROVIDE (erotext = .); + .reloc : + { + *(.got) + _GOT2_TABLE_ = .; + *(.got2) + _FIXUP_TABLE_ = .; + *(.fixup) + } + __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2; + __fixup_entries = (. - _FIXUP_TABLE_) >> 2; + + .data : + { + *(.data) + *(.data1) + *(.sdata) + *(.sdata2) + *(.dynamic) + CONSTRUCTORS + } + _edata = .; + PROVIDE (edata = .); + + . = .; + __u_boot_cmd_start = .; + .u_boot_cmd : { *(.u_boot_cmd) } + __u_boot_cmd_end = .; + + . = .; + __start___ex_table = .; + __ex_table : { *(__ex_table) } + __stop___ex_table = .; + + . = ALIGN(256); + __init_begin = .; + .text.init : { *(.text.init) } + .data.init : { *(.data.init) } + . = ALIGN(256); + __init_end = .; + + __bss_start = .; + .bss : + { + *(.sbss) *(.scommon) + *(.dynbss) + *(.bss) + *(COMMON) + } + _end = . ; + PROVIDE (end = .); +} diff --git a/include/configs/stxssa.h b/include/configs/stxssa.h new file mode 100644 index 000000000..f4ecb8fcd --- /dev/null +++ b/include/configs/stxssa.h @@ -0,0 +1,418 @@ +/* + * (C) Copyright 2005 Embedded Alley Solutions, Inc. + * Dan Malek + * Copied from STx GP3. + * Updates for Silicon Tx GP3 SSA board. + * + * (C) Copyright 2002,2003 Motorola,Inc. + * Xianghua Xiao + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +/* mpc8560ads board configuration file */ +/* please refer to doc/README.mpc85xx for more info */ +/* make sure you change the MAC address and other network params first, + * search for CONFIG_ETHADDR,CONFIG_SERVERIP,etc in this file + */ + +#ifndef __CONFIG_H +#define __CONFIG_H + +/* High Level Configuration Options */ +#define CONFIG_BOOKE 1 /* BOOKE */ +#define CONFIG_E500 1 /* BOOKE e500 family */ +#define CONFIG_MPC85xx 1 /* MPC8540/MPC8560 */ +#define CONFIG_CPM2 1 /* has CPM2 */ +#define CONFIG_STXSSA 1 /* Silicon Tx GPPP SSA board specific*/ + +#undef CONFIG_PCI /* pci ethernet support */ +#define CONFIG_TSEC_ENET /* tsec ethernet support*/ +#undef CONFIG_ETHER_ON_FCC /* cpm FCC ethernet support */ +#define CONFIG_ENV_OVERWRITE +#define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup */ +#undef CONFIG_DDR_ECC /* only for ECC DDR module */ +#undef CONFIG_DDR_DLL /* possible DLL fix needed */ +#define CONFIG_DDR_2T_TIMING /* Sets the 2T timing bit */ + + +/* sysclk for MPC85xx + */ + +#define CONFIG_SYS_CLK_FREQ 33000000 /* most pci cards are 33Mhz */ + +/* Blinkin' LEDs for Robert :-) +*/ +#define CONFIG_SHOW_ACTIVITY 1 + +/* + * These can be toggled for performance analysis, otherwise use default. + */ +#define CONFIG_L2_CACHE /* toggle L2 cache */ +#define CONFIG_BTB /* toggle branch predition */ +#define CONFIG_ADDR_STREAMING /* toggle addr streaming */ + +#define CONFIG_BOARD_EARLY_INIT_F 1 /* Call board_pre_init */ + +#undef CFG_DRAM_TEST /* memory test, takes time */ +#define CFG_MEMTEST_START 0x00200000 /* memtest region */ +#define CFG_MEMTEST_END 0x00400000 + + +/* Localbus connector. There are many options that can be + * connected here, including sdram or lots of flash. + * This address, however, is used to configure a 256M local bus + * window that includes the Config latch below. + */ +#define CFG_LBC_OPTION_BASE 0xf0000000 /* Localbus Extension */ +#define CFG_LBC_OPTION_SIZE 256 /* 256MB */ + +/* There are various flash options used, we configure for the largest, + * which is 64Mbytes. The CFI works fine and will discover the proper + * sizes. + */ +#define CFG_FLASH_BASE 0xfc000000 /* start of FLASH 64M */ +#define CFG_BR0_PRELIM 0xfc001801 /* port size 32bit */ +#define CFG_OR0_PRELIM 0xfc000ff7 /* 64 MB Flash */ + +#define CFG_FLASH_CFI 1 +#define CFG_FLASH_CFI_DRIVER 1 +#undef CFG_FLASH_USE_BUFFER_WRITE /* use buffered writes (20x faster) */ +#define CFG_MAX_FLASH_SECT 256 /* max number of sectors on one chip */ +#define CFG_MAX_FLASH_BANKS 1 /* max number of memory banks */ + +#define CFG_FLASH_BANKS_LIST { CFG_FLASH_BASE } + +#define CFG_FLASH_PROTECTION + +/* The configuration latch is Chip Select 1. + * It's an 8-bit latch in the lower 8 bits of the word. + */ +#define CFG_LBC_CFGLATCH_BASE 0xfb000000 /* Base of config latch */ +#define CFG_BR1_PRELIM 0xfb001801 /* 32-bit port */ +#define CFG_OR1_PRELIM 0xffff0ff7 /* 64K is enough */ + +#define CFG_MONITOR_BASE TEXT_BASE /* start of monitor */ + +#if (CFG_MONITOR_BASE < CFG_FLASH_BASE) +#define CFG_RAMBOOT +#else +#undef CFG_RAMBOOT +#endif + +#ifdef CFG_RAMBOOT +#define CFG_CCSRBAR_DEFAULT 0x40000000 /* CCSRBAR by BDI cfg */ +#else +#define CFG_CCSRBAR_DEFAULT 0xff700000 /* CCSRBAR Default */ +#endif +#define CFG_CCSRBAR 0xe0000000 /* relocated CCSRBAR */ +#define CFG_IMMR CFG_CCSRBAR /* PQII uses CFG_IMMR */ + + +/* + * DDR Setup + */ + +/* + * Base addresses -- Note these are effective addresses where the + * actual resources get mapped (not physical addresses) + */ +#define CFG_DDR_SDRAM_BASE 0x00000000 /* DDR is system memory */ +#define CFG_SDRAM_BASE CFG_DDR_SDRAM_BASE + +#define SPD_EEPROM_ADDRESS 0x54 /* DDR DIMM */ + +#undef CONFIG_CLOCKS_IN_MHZ + +/* local bus definitions */ +#define CFG_BR2_PRELIM 0xf8001861 /* 64MB localbus SDRAM */ +#define CFG_OR2_PRELIM 0xfc006901 +#define CFG_LBC_LCRR 0x00030004 /* local bus freq */ +#define CFG_LBC_LBCR 0x00000000 +#define CFG_LBC_LSRT 0x20000000 +#define CFG_LBC_MRTPR 0x20000000 +#define CFG_LBC_LSDMR_1 0x2861b723 +#define CFG_LBC_LSDMR_2 0x0861b723 +#define CFG_LBC_LSDMR_3 0x0861b723 +#define CFG_LBC_LSDMR_4 0x1861b723 +#define CFG_LBC_LSDMR_5 0x4061b723 + +#define CONFIG_L1_INIT_RAM +#define CFG_INIT_RAM_LOCK 1 +#define CFG_INIT_RAM_ADDR 0x60000000 /* Initial RAM address */ +#define CFG_INIT_RAM_END 0x4000 /* End of used area in RAM */ + +#define CFG_GBL_DATA_SIZE 128 /* num bytes initial data */ +#define CFG_GBL_DATA_OFFSET (CFG_INIT_RAM_END - CFG_GBL_DATA_SIZE) +#define CFG_INIT_SP_OFFSET CFG_GBL_DATA_OFFSET + +#define CFG_MONITOR_LEN (256 * 1024) /* Reserve 256 kB for Mon */ +#define CFG_MALLOC_LEN (128 * 1024) /* Reserved for malloc */ + +/* Serial Port */ +#define CONFIG_CONS_INDEX 2 +#undef CONFIG_SERIAL_SOFTWARE_FIFO +#define CFG_NS16550 +#define CFG_NS16550_SERIAL +#define CFG_NS16550_REG_SIZE 1 +#define CFG_NS16550_CLK get_bus_freq(0) + +#define CONFIG_BAUDRATE 38400 + +#define CFG_BAUDRATE_TABLE \ + {300, 600, 1200, 2400, 4800, 9600, 19200, 38400, 115200} + +#define CFG_NS16550_COM1 (CFG_CCSRBAR+0x4500) +#define CFG_NS16550_COM2 (CFG_CCSRBAR+0x4600) + +/* Use the HUSH parser */ +#define CFG_HUSH_PARSER +#ifdef CFG_HUSH_PARSER +#define CFG_PROMPT_HUSH_PS2 "> " +#endif + +/* I2C */ +#define CONFIG_FSL_I2C /* Use FSL common I2C driver */ +#define CONFIG_HARD_I2C /* I2C with hardware support*/ +#undef CONFIG_SOFT_I2C /* I2C bit-banged */ +#define CFG_I2C_SPEED 400000 /* I2C speed and slave address */ +#define CFG_I2C_SLAVE 0x7F +#if 0 +#define CFG_I2C_NOPROBES {0x00} /* Don't probe these addrs */ +#else +/* I did the 'if 0' so we could keep the syntax above if ever needed. */ +#undef CFG_I2C_NOPROBES +#endif +#define CFG_I2C_OFFSET 0x3000 + +/* I2C EEPROM. AT24C32, we keep our environment in here. +*/ +#define CFG_I2C_EEPROM_ADDR 0x51 /* 1010001x */ +#define CFG_I2C_EEPROM_ADDR_LEN 2 +#define CFG_EEPROM_PAGE_WRITE_BITS 5 /* =32 Bytes per write */ +#define CFG_EEPROM_PAGE_WRITE_ENABLE +#define CFG_EEPROM_PAGE_WRITE_DELAY_MS 20 + +/* + * Standard 8555 PCI mapping. + * Addresses are mapped 1-1. + */ +#define CFG_PCI1_MEM_BASE 0x80000000 +#define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE +#define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI1_IO_BASE 0x00000000 +#define CFG_PCI1_IO_PHYS 0xe2000000 +#define CFG_PCI1_IO_SIZE 0x01000000 /* 16M */ + +#define CFG_PCI2_MEM_BASE 0xa0000000 +#define CFG_PCI2_MEM_PHYS CFG_PCI2_MEM_BASE +#define CFG_PCI2_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI2_IO_BASE 0x00000000 +#define CFG_PCI2_IO_PHYS 0xe3000000 +#define CFG_PCI2_IO_SIZE 0x01000000 /* 16M */ + +#if defined(CONFIG_PCI) /* PCI Ethernet card */ + +#define CONFIG_NET_MULTI +#define CONFIG_PCI_PNP /* do pci plug-and-play */ + +#undef CONFIG_EEPRO100 +#undef CONFIG_TULIP + +#if !defined(CONFIG_PCI_PNP) + #define PCI_ENET0_IOADDR 0xe0000000 + #define PCI_ENET0_MEMADDR 0xe0000000 + #define PCI_IDSEL_NUMBER 0x0c /* slot0->3(IDSEL)=12->15 */ +#endif + +#undef CONFIG_PCI_SCAN_SHOW +#define CFG_PCI_SUBSYS_VENDORID 0x1057 /* Motorola */ + +#endif /* CONFIG_PCI */ + +#if defined(CONFIG_TSEC_ENET) + +#ifndef CONFIG_NET_MULTI +#define CONFIG_NET_MULTI 1 +#endif + +#define CONFIG_MII 1 /* MII PHY management */ + +#define CONFIG_MPC85XX_TSEC1 1 +#define CONFIG_MPC85XX_TSEC1_NAME "TSEC0" +#define CONFIG_MPC85XX_TSEC2 1 +#define CONFIG_MPC85XX_TSEC2_NAME "TSEC1" +#undef CONFIG_MPS85XX_FEC + +#define TSEC1_PHY_ADDR 2 +#define TSEC2_PHY_ADDR 4 +#define TSEC1_PHYIDX 0 +#define TSEC2_PHYIDX 0 +#define CONFIG_ETHPRIME "TSEC0" + +#elif defined(CONFIG_ETHER_ON_FCC) /* CPM FCC Ethernet */ + +#define CONFIG_ETHER_ON_FCC2 /* define if ether on FCC */ +#undef CONFIG_ETHER_NONE /* define if ether on something else */ +#define CONFIG_ETHER_INDEX 2 /* which channel for ether */ + +#if (CONFIG_ETHER_INDEX == 2) + /* + * - Rx-CLK is CLK13 + * - Tx-CLK is CLK14 + * - Select bus for bd/buffers + * - Full duplex + */ + #define CFG_CMXFCR_MASK (CMXFCR_FC2 | CMXFCR_RF2CS_MSK | CMXFCR_TF2CS_MSK) + #define CFG_CMXFCR_VALUE (CMXFCR_RF2CS_CLK13 | CMXFCR_TF2CS_CLK14) + #define CFG_CPMFCR_RAMTYPE 0 +#if 0 + #define CFG_FCC_PSMR (FCC_PSMR_FDE) +#else + #define CFG_FCC_PSMR 0 +#endif + #define FETH2_RST 0x01 +#elif (CONFIG_ETHER_INDEX == 3) + /* need more definitions here for FE3 */ + #define FETH3_RST 0x80 +#endif /* CONFIG_ETHER_INDEX */ + +/* MDIO is done through the TSEC0 control. +*/ +#define CONFIG_MII /* MII PHY management */ +#undef CONFIG_BITBANGMII /* bit-bang MII PHY management */ + +#endif + +/* Environment */ +/* Config in EEPROM +*/ +#if 1 +#define CFG_ENV_IS_IN_EEPROM 1 +#define CFG_ENV_OFFSET 0 +#define CFG_ENV_SIZE 2048 +#else +#define CFG_ENV_IS_IN_FLASH 1 +#define CFG_ENV_SECT_SIZE 0x10000 + +#define CFG_ENV_ADDR (CFG_FLASH_BASE + 0x00030000) +#define CFG_ENV_OFFSET 0 +#define CFG_ENV_SIZE 0x4000 +#endif + +#define CONFIG_BOOTARGS "root=/dev/nfs rw ip=any console=ttyS1,38400" +#define CONFIG_BOOTCOMMAND "bootm 0xffc00000 0xffd00000" +#define CONFIG_BOOTDELAY 3 /* -1 disable autoboot */ + +#define CONFIG_LOADS_ECHO 1 /* echo on for serial download */ +#define CFG_LOADS_BAUD_CHANGE 1 /* allow baudrate change */ + +#if defined(CFG_RAMBOOT) + #if defined(CONFIG_PCI) + #define CONFIG_COMMANDS ((CONFIG_CMD_DFL | CFG_CMD_PCI | \ + CFG_CMD_PING | CFG_CMD_I2C) & \ + ~(CFG_CMD_ENV | \ + CFG_CMD_LOADS )) + #elif defined(CONFIG_TSEC_ENET) + #define CONFIG_COMMANDS ((CONFIG_CMD_DFL | CFG_CMD_PING | \ + CFG_CMD_MII | CFG_CMD_I2C ) & \ + ~(CFG_CMD_ENV)) + #elif defined(CONFIG_ETHER_ON_FCC) + #define CONFIG_COMMANDS ((CONFIG_CMD_DFL | CFG_CMD_MII | \ + CFG_CMD_PING | CFG_CMD_I2C) & \ + ~(CFG_CMD_ENV)) + #endif +#else + #if defined(CONFIG_PCI) + #define CONFIG_COMMANDS (CONFIG_CMD_DFL | CFG_CMD_PCI | \ + CFG_CMD_ELF | CFG_CMD_PING | CFG_CMD_I2C) + #elif defined(CONFIG_TSEC_ENET) + #define CONFIG_COMMANDS (CONFIG_CMD_DFL | CFG_CMD_PING | \ + CFG_CMD_ELF | CFG_CMD_MII | CFG_CMD_I2C) + #elif defined(CONFIG_ETHER_ON_FCC) + #define CONFIG_COMMANDS (CONFIG_CMD_DFL | CFG_CMD_MII | \ + CFG_CMD_ELF | CFG_CMD_PING | CFG_CMD_I2C) + #endif +#endif +#include + +#undef CONFIG_WATCHDOG /* watchdog disabled */ + +/* + * Miscellaneous configurable options + */ +#define CFG_LONGHELP /* undef to save memory */ +#define CFG_PROMPT "SSA=> " /* Monitor Command Prompt */ +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CBSIZE 1024 /* Console I/O Buffer Size */ +#else +#define CFG_CBSIZE 256 /* Console I/O Buffer Size */ +#endif +#define CFG_PBSIZE (CFG_CBSIZE+sizeof(CFG_PROMPT)+16) /* Print Buffer Size */ +#define CFG_MAXARGS 16 /* max number of command args */ +#define CFG_BARGSIZE CFG_CBSIZE /* Boot Argument Buffer Size */ +#define CFG_LOAD_ADDR 0x1000000 /* default load address */ +#define CFG_HZ 1000 /* decrementer freq: 1 ms ticks */ + +/* + * For booting Linux, the board info and command line data + * have to be in the first 8 MB of memory, since this is + * the maximum mapped by the Linux kernel during initialization. + */ +#define CFG_BOOTMAPSZ (8 << 20) /* Initial Memory map for Linux */ + +/* Cache Configuration */ +#define CFG_DCACHE_SIZE 32768 +#define CFG_CACHELINE_SIZE 32 +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CACHELINE_SHIFT 5 /* log base 2 of the above value */ +#endif + +/* + * Internal Definitions + * + * Boot Flags + */ +#define BOOTFLAG_COLD 0x01 /* Normal Power-On: Boot from FLASH */ +#define BOOTFLAG_WARM 0x02 /* Software reboot */ + +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CONFIG_KGDB_BAUDRATE 230400 /* speed to run kgdb serial port */ +#define CONFIG_KGDB_SER_INDEX 2 /* which serial port to use */ +#endif + +/*Note: change below for your network setting!!! */ +#if defined(CONFIG_TSEC_ENET) || defined(CONFIG_ETHER_ON_FCC) +#define CONFIG_ETHADDR 00:e0:0c:07:9b:8a +#define CONFIG_HAS_ETH1 +#define CONFIG_ETH1ADDR 00:e0:0c:07:9b:8b +#define CONFIG_HAS_ETH2 +#define CONFIG_ETH2ADDR 00:e0:0c:07:9b:8c +#endif + +#define CONFIG_SERVERIP 192.168.85.1 +#define CONFIG_IPADDR 192.168.85.60 +#define CONFIG_GATEWAYIP 192.168.85.1 +#define CONFIG_NETMASK 255.255.255.0 +#define CONFIG_HOSTNAME STX_SSA +#define CONFIG_ROOTPATH /gppproot +#define CONFIG_BOOTFILE uImage +#define CONFIG_LOADADDR 0x1000000 + +#endif /* __CONFIG_H */ From 2c6fb199dc5756fc72f49d1f4de105e089049d65 Mon Sep 17 00:00:00 2001 From: Wolfgang Denk Date: Tue, 24 Apr 2007 14:37:49 +0200 Subject: [PATCH 33/47] Cleanup STX GP3SSA code; fix build and compile problems. --- board/stxssa/Makefile | 19 +++++++++++-------- board/stxssa/stxssa.c | 5 +++-- 2 files changed, 14 insertions(+), 10 deletions(-) diff --git a/board/stxssa/Makefile b/board/stxssa/Makefile index 5d8ea3494..344ecdfd7 100644 --- a/board/stxssa/Makefile +++ b/board/stxssa/Makefile @@ -23,14 +23,17 @@ include $(TOPDIR)/config.mk -LIB = lib$(BOARD).a +LIB = $(obj)lib$(BOARD).a -OBJS := $(BOARD).o +COBJS := $(BOARD).o SOBJS := init.o -#SOBJS := -$(LIB): $(OBJS) $(SOBJS) - $(AR) crv $@ $(OBJS) +SRCS := $(SOBJS:.o=.S) $(COBJS:.o=.c) +OBJS := $(addprefix $(obj),$(COBJS)) +SOBJS := $(addprefix $(obj),$(SOBJS)) + +$(LIB): $(obj).depend $(OBJS) $(SOBJS) + $(AR) $(ARFLAGS) $@ $(OBJS) clean: rm -f $(OBJS) $(SOBJS) @@ -40,9 +43,9 @@ distclean: clean ######################################################################### -.depend: Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c) - $(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@ +# defines $(obj).depend target +include $(SRCTREE)/rules.mk --include .depend +sinclude $(obj).depend ######################################################################### diff --git a/board/stxssa/stxssa.c b/board/stxssa/stxssa.c index 87d3d6f99..0fb233d81 100644 --- a/board/stxssa/stxssa.c +++ b/board/stxssa/stxssa.c @@ -203,8 +203,9 @@ void reset_phy(void) { volatile uint *blatch; +#if 0 int i; - +#endif blatch = (volatile uint *)CFG_LBC_CFGLATCH_BASE; /* reset Giga bit Ethernet port if needed here */ @@ -298,10 +299,10 @@ initdram (int board_type) { long dram_size = 0; extern long spd_sdram (void); - volatile immap_t *immap = (immap_t *)CFG_IMMR; #if defined(CONFIG_DDR_DLL) { + volatile immap_t *immap = (immap_t *)CFG_IMMR; volatile ccsr_gur_t *gur= &immap->im_gur; uint temp_ddrdll = 0; From c64a89d6ce8584b9fc64f4e85da9ecac3cfc2c2a Mon Sep 17 00:00:00 2001 From: Wolfgang Denk Date: Thu, 3 May 2007 16:34:41 +0200 Subject: [PATCH 34/47] Update board configuration for STX GP3SSA board: Enable hush shell, environment in flash rather in EEPROM, more user-friendly default environment, etc. The simple EEPROM environment can be selected easily in the board config file. Signed-off-by: Wolfgang Denk --- CHANGELOG | 22 ++++++++++ MAINTAINERS | 6 +-- include/configs/stxssa.h | 87 +++++++++++++++++++++++++++++++--------- 3 files changed, 92 insertions(+), 23 deletions(-) diff --git a/CHANGELOG b/CHANGELOG index a18bb0651..27cad837e 100644 --- a/CHANGELOG +++ b/CHANGELOG @@ -1,3 +1,25 @@ +commit 2c6fb199dc5756fc72f49d1f4de105e089049d65 +Author: Wolfgang Denk +Date: Tue Apr 24 14:37:49 2007 +0200 + + Cleanup STX GP3SSA code; fix build and compile problems. + +commit 35171dc04e028ecacc23ad916a66295472555dbf +Author: Dan Malek +Date: Fri Jan 5 09:15:34 2007 +0100 + + Add support for STX GP3SSA (stxssa) Board + + Signed-off-by Dan Malek, + +commit 14da5f7675bbb427c469e3f45006e027b6e21db9 +Author: Wolfgang Denk +Date: Fri Apr 20 17:43:28 2007 +0200 + + Cleanup compiler warnings, update CHANGELOG + + Signed-off-by: Wolfgang Denk + commit 6923565db12af34fd5e02d354ee65a8c78ac460f Author: Detlev Zundel Date: Fri Apr 20 12:01:47 2007 +0200 diff --git a/MAINTAINERS b/MAINTAINERS index d145ecdad..2eaef1784 100644 --- a/MAINTAINERS +++ b/MAINTAINERS @@ -223,9 +223,9 @@ Jon Loeliger Dan Malek - STxGP3 MPC85xx - STxSSA MPC85xx - STxXTc MPC8xx + stxgp3 MPC85xx + stxssa MPC85xx + stxxtc MPC8xx Eran Man diff --git a/include/configs/stxssa.h b/include/configs/stxssa.h index f4ecb8fcd..8624f4b74 100644 --- a/include/configs/stxssa.h +++ b/include/configs/stxssa.h @@ -87,9 +87,9 @@ * which is 64Mbytes. The CFI works fine and will discover the proper * sizes. */ -#define CFG_FLASH_BASE 0xfc000000 /* start of FLASH 64M */ -#define CFG_BR0_PRELIM 0xfc001801 /* port size 32bit */ -#define CFG_OR0_PRELIM 0xfc000ff7 /* 64 MB Flash */ +#define CFG_FLASH_BASE 0xFC000000 /* start of FLASH 64M */ +#define CFG_BR0_PRELIM 0xFC001801 /* port size 32bit */ +#define CFG_OR0_PRELIM 0xFC000FF7 /* 64 MB Flash */ #define CFG_FLASH_CFI 1 #define CFG_FLASH_CFI_DRIVER 1 @@ -163,7 +163,7 @@ #define CFG_INIT_SP_OFFSET CFG_GBL_DATA_OFFSET #define CFG_MONITOR_LEN (256 * 1024) /* Reserve 256 kB for Mon */ -#define CFG_MALLOC_LEN (128 * 1024) /* Reserved for malloc */ +#define CFG_MALLOC_LEN (512 * 1024) /* Reserved for malloc */ /* Serial Port */ #define CONFIG_CONS_INDEX 2 @@ -173,16 +173,14 @@ #define CFG_NS16550_REG_SIZE 1 #define CFG_NS16550_CLK get_bus_freq(0) -#define CONFIG_BAUDRATE 38400 - #define CFG_BAUDRATE_TABLE \ {300, 600, 1200, 2400, 4800, 9600, 19200, 38400, 115200} #define CFG_NS16550_COM1 (CFG_CCSRBAR+0x4500) #define CFG_NS16550_COM2 (CFG_CCSRBAR+0x4600) -/* Use the HUSH parser */ -#define CFG_HUSH_PARSER +#define CONFIG_CMDLINE_EDITING 1 /* add command line history */ +#define CFG_HUSH_PARSER 1 /* Use the HUSH parser */ #ifdef CFG_HUSH_PARSER #define CFG_PROMPT_HUSH_PS2 "> " #endif @@ -300,29 +298,26 @@ #endif -/* Environment */ -/* Config in EEPROM -*/ -#if 1 +/* Environment - default config is in flash, see below */ +#if 0 /* in EEPROM */ #define CFG_ENV_IS_IN_EEPROM 1 #define CFG_ENV_OFFSET 0 #define CFG_ENV_SIZE 2048 -#else +#else /* in flash */ #define CFG_ENV_IS_IN_FLASH 1 -#define CFG_ENV_SECT_SIZE 0x10000 +#define CFG_ENV_SECT_SIZE 0x40000 -#define CFG_ENV_ADDR (CFG_FLASH_BASE + 0x00030000) -#define CFG_ENV_OFFSET 0 +#define CFG_ENV_ADDR (CFG_MONITOR_BASE - CFG_ENV_SECT_SIZE) #define CFG_ENV_SIZE 0x4000 +#define CFG_ENV_ADDR_REDUND (CFG_ENV_ADDR - CFG_ENV_SECT_SIZE) +#define CFG_ENV_SIZE_REDUND (CFG_ENV_SIZE) #endif -#define CONFIG_BOOTARGS "root=/dev/nfs rw ip=any console=ttyS1,38400" -#define CONFIG_BOOTCOMMAND "bootm 0xffc00000 0xffd00000" -#define CONFIG_BOOTDELAY 3 /* -1 disable autoboot */ - #define CONFIG_LOADS_ECHO 1 /* echo on for serial download */ #define CFG_LOADS_BAUD_CHANGE 1 /* allow baudrate change */ +#define CONFIG_TIMESTAMP /* Print image info with ts */ + #if defined(CFG_RAMBOOT) #if defined(CONFIG_PCI) #define CONFIG_COMMANDS ((CONFIG_CMD_DFL | CFG_CMD_PCI | \ @@ -406,6 +401,18 @@ #define CONFIG_ETH2ADDR 00:e0:0c:07:9b:8c #endif +/* + * Environment in EEPROM is compatible with different flash sector sizes, + * but only little space is available, so we use a very simple setup. + * With environment in flash, we use a more powerful default configuration. + */ +#ifdef CFG_ENV_IS_IN_EEPROM /* use restricted "standard" environment */ + +#define CONFIG_BAUDRATE 38400 + +#define CONFIG_BOOTDELAY 3 /* -1 disable autoboot */ +#define CONFIG_BOOTCOMMAND "bootm 0xffc00000 0xffd00000" +#define CONFIG_BOOTARGS "root=/dev/nfs rw ip=any console=ttyS1,$baudrate" #define CONFIG_SERVERIP 192.168.85.1 #define CONFIG_IPADDR 192.168.85.60 #define CONFIG_GATEWAYIP 192.168.85.1 @@ -415,4 +422,44 @@ #define CONFIG_BOOTFILE uImage #define CONFIG_LOADADDR 0x1000000 +#else /* ENV IS IN FLASH -- use a full-blown envionment */ + +#define CONFIG_BAUDRATE 115200 + +#define CONFIG_BOOTDELAY 5 /* -1 disable autoboot */ + +#define CONFIG_PREBOOT "echo;" \ + "echo Type \\\"run flash_nfs\\\" to mount root filesystem over NFS;" \ + "echo" + +#undef CONFIG_BOOTARGS /* the boot command will set bootargs */ + +#define CONFIG_EXTRA_ENV_SETTINGS \ + "hostname=gp3ssa\0" \ + "bootfile=/tftpboot/gp3ssa/uImage\0" \ + "loadaddr=400000\0" \ + "netdev=eth0\0" \ + "consdev=ttyS1\0" \ + "nfsargs=setenv bootargs root=/dev/nfs rw " \ + "nfsroot=$serverip:$rootpath\0" \ + "ramargs=setenv bootargs root=/dev/ram rw\0" \ + "addip=setenv bootargs $bootargs " \ + "ip=$ipaddr:$serverip:$gatewayip:$netmask" \ + ":$hostname:$netdev:off panic=1\0" \ + "addcons=setenv bootargs $bootargs " \ + "console=$consdev,$baudrate\0" \ + "flash_nfs=run nfsargs addip addcons;" \ + "bootm $kernel_addr\0" \ + "flash_self=run ramargs addip addcons;" \ + "bootm $kernel_addr $ramdisk_addr\0" \ + "net_nfs=tftp $loadaddr $bootfile;" \ + "run nfsargs addip addcons;bootm\0" \ + "rootpath=/opt/eldk/ppc_85xx\0" \ + "kernel_addr=FC000000\0" \ + "ramdisk_addr=FC200000\0" \ + "" +#define CONFIG_BOOTCOMMAND "run flash_self" + +#endif /* CFG_ENV_IS_IN_EEPROM */ + #endif /* __CONFIG_H */ From 9877d7dcd1eebe61aa5d8b8ffe9c048ea426e6f6 Mon Sep 17 00:00:00 2001 From: Wolfgang Denk Date: Fri, 4 May 2007 10:02:33 +0200 Subject: [PATCH 35/47] Fix initrd length corruption in bootm command. When using FDT Images, the length of an inital ramdisk was overwritten (bug introduced by commit 87a449c8, 22 Aug 2006). Patches by Timur Tabi & Johns Daniel. Signed-off-by: Wolfgang Denk --- common/cmd_bootm.c | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) diff --git a/common/cmd_bootm.c b/common/cmd_bootm.c index 32c29e55a..a6499e8dd 100644 --- a/common/cmd_bootm.c +++ b/common/cmd_bootm.c @@ -779,9 +779,8 @@ do_bootm_linux (cmd_tbl_t *cmdtp, int flag, checksum = ntohl(hdr->ih_dcrc); addr = (ulong)((uchar *)(hdr) + sizeof(image_header_t)); - len = ntohl(hdr->ih_size); - if(checksum != crc32(0, (uchar *)addr, len)) { + if(checksum != crc32(0, (uchar *)addr, ntohl(hdr->ih_size))) { printf("ERROR: Flat Device Tree checksum is invalid\n"); return; } From a79886590593ba1d667c840caa4940c61639f18f Mon Sep 17 00:00:00 2001 From: Thomas Knobloch Date: Sat, 5 May 2007 07:04:42 +0200 Subject: [PATCH 36/47] NAND: Wrong calculation of page number in nand_block_bad() In case that there is no memory based bad block table available the function nand_block_checkbad() in drivers/mtd/nand/nand_base.c will call nand_block_bad() directly. When parameter 'getchip' is set to zero, nand_block_bad() will not right shift the offset to calculate the correct page number. Signed-off-by: Thomas Knobloch Signed-off-by: Stefan Roese --- drivers/nand/nand_base.c | 10 +++++----- 1 file changed, 5 insertions(+), 5 deletions(-) diff --git a/drivers/nand/nand_base.c b/drivers/nand/nand_base.c index 849582990..c6fee1822 100644 --- a/drivers/nand/nand_base.c +++ b/drivers/nand/nand_base.c @@ -427,8 +427,9 @@ static int nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) struct nand_chip *this = mtd->priv; u16 bad; + page = (int)(ofs >> this->page_shift) & this->pagemask; + if (getchip) { - page = (int)(ofs >> this->page_shift); chipnr = (int)(ofs >> this->chip_shift); /* Grab the lock and see if the device is available */ @@ -436,18 +437,17 @@ static int nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) /* Select the NAND device */ this->select_chip(mtd, chipnr); - } else - page = (int) ofs; + } if (this->options & NAND_BUSWIDTH_16) { - this->cmdfunc (mtd, NAND_CMD_READOOB, this->badblockpos & 0xFE, page & this->pagemask); + this->cmdfunc (mtd, NAND_CMD_READOOB, this->badblockpos & 0xFE, page); bad = cpu_to_le16(this->read_word(mtd)); if (this->badblockpos & 0x1) bad >>= 1; if ((bad & 0xFF) != 0xff) res = 1; } else { - this->cmdfunc (mtd, NAND_CMD_READOOB, this->badblockpos, page & this->pagemask); + this->cmdfunc (mtd, NAND_CMD_READOOB, this->badblockpos, page); if (this->read_byte(mtd) != 0xff) res = 1; } From f544ff6656fca263ed1ebe39899b6d95da67c8b8 Mon Sep 17 00:00:00 2001 From: Stefan Roese Date: Sat, 5 May 2007 08:29:01 +0200 Subject: [PATCH 37/47] ppc4xx: Sequoia: Remove cpu/ppc4xx/speed.c from NAND booting Using cpu/ppc4xx/speed.c to calculate the bus frequency is too big for the 4k NAND boot image so define bus_frequency to 133MHz here which is save for the refresh counter setup. Signed-off-by: Stefan Roese --- board/amcc/sequoia/sdram.c | 10 +++++++++- nand_spl/board/amcc/sequoia/Makefile | 6 +----- 2 files changed, 10 insertions(+), 6 deletions(-) diff --git a/board/amcc/sequoia/sdram.c b/board/amcc/sequoia/sdram.c index f8b837ed2..d045df187 100644 --- a/board/amcc/sequoia/sdram.c +++ b/board/amcc/sequoia/sdram.c @@ -371,6 +371,14 @@ void denali_core_search_data_eye(unsigned long memory_size) } #endif /* CONFIG_DDR_DATA_EYE */ +#if defined(CONFIG_NAND_SPL) +/* Using cpu/ppc4xx/speed.c to calculate the bus frequency is too big + * for the 4k NAND boot image so define bus_frequency to 133MHz here + * which is save for the refresh counter setup. + */ +#define get_bus_freq(val) 133000000 +#endif + /************************************************************************* * * initdram -- 440EPx's DDR controller is a DENALI Core @@ -404,7 +412,7 @@ long int initdram (int board_type) mtsdram(DDR0_22, 0x00267F0B); mtsdram(DDR0_23, 0x00000000); mtsdram(DDR0_24, 0x01010002); - if (speed > 133333333) + if (speed > 133333334) mtsdram(DDR0_26, 0x5B26050C); else mtsdram(DDR0_26, 0x5B260408); diff --git a/nand_spl/board/amcc/sequoia/Makefile b/nand_spl/board/amcc/sequoia/Makefile index 510999db0..b42da8cf6 100644 --- a/nand_spl/board/amcc/sequoia/Makefile +++ b/nand_spl/board/amcc/sequoia/Makefile @@ -30,7 +30,7 @@ AFLAGS += -DCONFIG_NAND_SPL CFLAGS += -DCONFIG_NAND_SPL SOBJS = start.o init.o resetvec.o -COBJS = nand_boot.o ndfc.o sdram.o speed.o +COBJS = nand_boot.o ndfc.o sdram.o SRCS := $(addprefix $(obj),$(SOBJS:.o=.S) $(COBJS:.o=.c)) OBJS := $(addprefix $(obj),$(SOBJS) $(COBJS)) @@ -69,10 +69,6 @@ $(obj)start.S: @rm -f $(obj)start.S ln -s $(SRCTREE)/cpu/ppc4xx/start.S $(obj)start.S -$(obj)speed.c: - @rm -f $(obj)speed.c - ln -s $(SRCTREE)/cpu/ppc4xx/speed.c $(obj)speed.c - # from board directory $(obj)init.S: @rm -f $(obj)init.S From e3b8c78bc2489c27ae020986ef0eaca684866cef Mon Sep 17 00:00:00 2001 From: Jeffrey Mann Date: Sat, 5 May 2007 08:32:14 +0200 Subject: [PATCH 38/47] ppc4xx: Detect if the sysclk on Sequoia is 33 or 33.333 MHz The AMCC Secquoia board has been changed in a new revision from using a 33.000 MHz clock to a 33.333 MHz system clock. A bit in the CPLD indicates the difference. This patch reads that bit and uses the correct clock speed for the board. This code is backward compatable will all prior boards. All prior boards will be read as 33.000. Signed-off-by: Jeffrey Mann Signed-off-by: Stefan Roese --- include/configs/sequoia.h | 4 +++- 1 file changed, 3 insertions(+), 1 deletion(-) diff --git a/include/configs/sequoia.h b/include/configs/sequoia.h index 1f19621f4..b7f79c26e 100644 --- a/include/configs/sequoia.h +++ b/include/configs/sequoia.h @@ -38,7 +38,9 @@ #define CONFIG_440GRX 1 /* Specific PPC440GRx */ #endif #define CONFIG_4xx 1 /* ... PPC4xx family */ -#define CONFIG_SYS_CLK_FREQ 33000000 /* external freq to pll */ +/* Detect Sequoia PLL input clock automatically via CPLD bit */ +#define CONFIG_SYS_CLK_FREQ ((in8(CFG_BCSR_BASE + 3) & 0x80) ? \ + 3333333 : 33000000) #define CONFIG_BOARD_EARLY_INIT_F 1 /* Call board_early_init_f */ #define CONFIG_MISC_INIT_R 1 /* Call misc_init_r */ From 5499645b3fe17a548af9dfc479ca6e2455f179a2 Mon Sep 17 00:00:00 2001 From: Wolfgang Denk Date: Sat, 5 May 2007 17:15:50 +0200 Subject: [PATCH 39/47] Make "file" command happy with some config.mk files; update CHANGELOG --- CHANGELOG | 109 +++++++++++++++++++++++++++++++++ board/ixdp425/config.mk | 1 + board/prodrive/pdnb3/config.mk | 1 + 3 files changed, 111 insertions(+) diff --git a/CHANGELOG b/CHANGELOG index 27cad837e..66e03e864 100644 --- a/CHANGELOG +++ b/CHANGELOG @@ -1,3 +1,44 @@ +commit a79886590593ba1d667c840caa4940c61639f18f +Author: Thomas Knobloch +Date: Sat May 5 07:04:42 2007 +0200 + + NAND: Wrong calculation of page number in nand_block_bad() + + In case that there is no memory based bad block table available the + function nand_block_checkbad() in drivers/mtd/nand/nand_base.c will call + nand_block_bad() directly. When parameter 'getchip' is set to zero, + nand_block_bad() will not right shift the offset to calculate the + correct page number. + + Signed-off-by: Thomas Knobloch + Signed-off-by: Stefan Roese + +commit 9877d7dcd1eebe61aa5d8b8ffe9c048ea426e6f6 +Author: Wolfgang Denk +Date: Fri May 4 10:02:33 2007 +0200 + + Fix initrd length corruption in bootm command. + + When using FDT Images, the length of an inital ramdisk was + overwritten (bug introduced by commit 87a449c8, 22 Aug 2006). + + Patches by Timur Tabi & Johns Daniel. + + Signed-off-by: Wolfgang Denk + +commit c64a89d6ce8584b9fc64f4e85da9ecac3cfc2c2a +Author: Wolfgang Denk +Date: Thu May 3 16:34:41 2007 +0200 + + Update board configuration for STX GP3SSA board: + + Enable hush shell, environment in flash rather in EEPROM, + more user-friendly default environment, etc. + The simple EEPROM environment can be selected easily in the board + config file. + + Signed-off-by: Wolfgang Denk + commit 2c6fb199dc5756fc72f49d1f4de105e089049d65 Author: Wolfgang Denk Date: Tue Apr 24 14:37:49 2007 +0200 @@ -12,6 +53,74 @@ Date: Fri Jan 5 09:15:34 2007 +0100 Signed-off-by Dan Malek, +commit a75af9bfd8fff0499efdbb90601cec5a2afef117 +Author: James Yang +Date: Wed Feb 7 15:28:04 2007 -0600 + + Conditionalize 8641 Rev1.0 MCM workarounds + + Signed-off-by: James Yang + Signed-off-by: Jon Loeliger + +commit c1ab82669d9525998c34e802a12cad662723f22a +Author: James Yang +Date: Fri Mar 16 13:02:53 2007 -0500 + + Rewrote picos_to_clk() to avoid rounding errors. + Clarified that conversion is to DRAM clocks rather than platform clocks. + Made function static to spd_sdram.c. + + Signed-off-by: James Yang + Signed-off-by: Jon Loeliger + +commit 323bfa8f436dc3bc57187c9b1488bc3146ff1522 +Author: Stefan Roese +Date: Mon Apr 23 12:00:22 2007 +0200 + + Remove BOARDLIBS usage completely + + Signed-off-by: Stefan Roese + +commit 2e343b9a57f32e1bd08c35c9976910333fb4e13d +Author: Ed Swarthout +Date: Wed Feb 28 05:37:29 2007 -0600 + + mpc8641hpcn: Fix LAW and TLB setup to use the IO_PHYS #defines. + + Signed-off-by: Ed Swarthout + +commit 79cb47391eebef85acadb3f6961ef6c55cace6ac +Author: Zhang Wei +Date: Fri Jan 19 10:42:37 2007 +0800 + + Enable LAWs for MPC8641 PCI-Ex2. + + Signed-off-by: Zhang Wei + Signed-off-by: Jon Loeliger + +commit bd7851ce1e1f140665b520026abf1042968b1102 +Author: Jon Loeliger +Date: Fri Apr 20 14:12:26 2007 -0500 + + mpc86xx; Write MAC address to mac-address and local-mac-address + + Some device trees have a mac-address property, some have local-mac-address, + and some have both. To support all of these device trees, ftp_cpu_setup() + should write the MAC address to mac-address and local-mac-address, if they + exist. + + Signed-off-by: Timur Tabi + Signed-off-by: Jon Loeliger + +commit 7dbdf28b8bd855a8530dc3292e4982575a197060 +Author: Jon Loeliger +Date: Fri Apr 20 14:11:38 2007 -0500 + + mpc86xx: protect memcpy to bad address if a mac-address is missing from dt + + Signed-off-by: Kim Phillips + Signed-off-by: Jon Loeliger + commit 14da5f7675bbb427c469e3f45006e027b6e21db9 Author: Wolfgang Denk Date: Fri Apr 20 17:43:28 2007 +0200 diff --git a/board/ixdp425/config.mk b/board/ixdp425/config.mk index 0436c5b78..ecff8d741 100644 --- a/board/ixdp425/config.mk +++ b/board/ixdp425/config.mk @@ -1 +1,2 @@ +# TEXT_BASE = 0x00f80000 diff --git a/board/prodrive/pdnb3/config.mk b/board/prodrive/pdnb3/config.mk index 2f7cc3b96..51dee86ae 100644 --- a/board/prodrive/pdnb3/config.mk +++ b/board/prodrive/pdnb3/config.mk @@ -1 +1,2 @@ +# TEXT_BASE = 0x01f00000 From 885ec89b648a899a2f32393fd3ffd9f7234c4402 Mon Sep 17 00:00:00 2001 From: Wolfgang Denk Date: Sat, 5 May 2007 18:05:02 +0200 Subject: [PATCH 40/47] Add STX GP3 SSA board to MAKEALL script; update CHANGELOG. Signed-off-by: Wolfgang Denk --- CHANGELOG | 268 ++++++++++++++++++++++++++++++++++++++++++++++++++++++ MAKEALL | 3 +- 2 files changed, 270 insertions(+), 1 deletion(-) diff --git a/CHANGELOG b/CHANGELOG index 66e03e864..0bb6bc5c1 100644 --- a/CHANGELOG +++ b/CHANGELOG @@ -1,3 +1,9 @@ +commit 5499645b3fe17a548af9dfc479ca6e2455f179a2 +Author: Wolfgang Denk +Date: Sat May 5 17:15:50 2007 +0200 + + Make "file" command happy with some config.mk files; update CHANGELOG + commit a79886590593ba1d667c840caa4940c61639f18f Author: Thomas Knobloch Date: Sat May 5 07:04:42 2007 +0200 @@ -53,6 +59,51 @@ Date: Fri Jan 5 09:15:34 2007 +0100 Signed-off-by Dan Malek, +commit ffa621a0d12a1ccd81c936c567f8917a213787a8 +Author: Andy Fleming +Date: Sat Feb 24 01:08:13 2007 -0600 + + Cleaned up some 85xx PCI bugs + + * Cleaned up the CDS PCI Config Tables and added NULL entries to + the end + * Fixed PCIe LAWBAR assignemt to use the cpu-relative address + * Fixed 85xx PCI code to assign powar region sizes based on the + config values (rather than hard-coding them) + * Fixed the 8548 CDS PCI2 IO to once again have 0 as the base address + + Signed-off-by: Andy Fleming + +commit 6743105988fc44d5b0d30388c790607835aae7a6 +Author: Andy Fleming +Date: Mon Apr 23 02:54:25 2007 -0500 + + Add support for the 8568 MDS board + + This included some changes to common files: + * Add 8568 processor SVR to various places + * Add support for setting the qe bus-frequency value in the dts + * Add the 8568MDS target to the Makefile + + Signed-off-by: Andy Fleming + +commit af1c2b84bf27c8565baddc82d1abb93700d10e2e +Author: David Updegraff +Date: Fri Apr 20 14:34:48 2007 -0500 + + Add support for treating unknown PHYs as generic PHYs. + + When bringing up u-boot on new boards, PHY support sometimes gets + neglected. Most PHYs don't really need any special support, + though. By adding a generic entry that always matches if nothing + else does, we can provide support for "unsupported" PHYs for the + tsec. + + The generic PHY driver supports most PHYs, including gigabit. + + Signed-off-by: David Updegraff + Signed-off-by: Andy Fleming + commit a75af9bfd8fff0499efdbb90601cec5a2afef117 Author: James Yang Date: Wed Feb 7 15:28:04 2007 -0600 @@ -73,6 +124,223 @@ Date: Fri Mar 16 13:02:53 2007 -0500 Signed-off-by: James Yang Signed-off-by: Jon Loeliger +commit 66ed6cca3f340f7a8a06d9272ae2ef8e96f0273d +Author: Andy Fleming +Date: Mon Apr 23 02:37:47 2007 -0500 + + Reworked 85xx speed detection code + + Changed the code to read the registers and calculate the clock + rates, rather than using a "switch" statement. + + Idea from Andrew Klossner + + Signed-off-by: Andy Fleming + +commit 81f481ca708ed6a56bf9c410e3191dbad581c565 +Author: Andy Fleming +Date: Mon Apr 23 02:24:28 2007 -0500 + + Enable 8544 support + + * Add support to the Makefile + * Add 8544 configuration support to the tsec driver + * Add 8544 SVR numbers to processor.h + + Signed-off-by: Ed Swarthout + Signed-off-by: Jon Loeliger + +commit 0d8c3a2096eaff8d7de89d45e9af4d4b0d4868fe +Author: Andy Fleming +Date: Fri Feb 23 17:12:25 2007 -0600 + + Support 1G size on 8548 + + e500v2 and newer cores support 1G page sizes. + + Signed-off-by: Ed Swarthout + Signed-off-by: Andy Fleming + +commit 45cef612cc601d2d1c890fbbd7cdc9609a189a46 +Author: Andy Fleming +Date: Fri Feb 23 17:11:16 2007 -0600 + + Changed BOOKE_PAGESZ_nGB to BOOKE_PAGESZ_nG + + The other pagesz constants use one letter to specify order of + magnitude. Also change the one reference to it in mpc8548cds/init.S + + Signed-off-by: Andy Fleming + +commit 1f9a318cea14272edd10d63739e2d326c90f430e +Author: Andy Fleming +Date: Fri Feb 23 16:28:46 2007 -0600 + + Only set ddrioovcr for 8548 rev1. + + Signed-off-by: Ed Swarthout + Signed-off-by: Andy Fleming + +commit 9343dbf85bc03033f2102d8e8543567c2c1ad2d2 +Author: Andy Fleming +Date: Sat Feb 24 01:16:45 2007 -0600 + + Tweak DDR ECC error counter + + Enable single-bit error counter when memory was cleared by ddr controller. + + Signed-off-by: Ed Swarthout + Signed-off-by: Andy Fleming + +commit 85e7c7a45e3dd9c7ce3e722352ba60f8df1a7a4b +Author: Timur Tabi +Date: Mon Feb 12 13:34:55 2007 -0600 + + 85xx: write MAC address to mac-address and local-mac-address + + Some device trees have a mac-address property, some have local-mac-address, + and some have both. To support all of these device trees, ftp_cpu_setup() + should write the MAC address to mac-address and local-mac-address, if they + exist. + + Signed-off-by: Timur Tabi + +commit 03b81b48eec0ad249ec97a4ae16c36fa2e014ff4 +Author: Andy Fleming +Date: Mon Apr 23 01:44:44 2007 -0500 + + Some 85xx cpu cleanups + + * Cleaned up the TSR[WIS] clearing + * Cleaned up DMA initialization + + Signed-off-by: Ed Swarthout + Signed-off-by: Jon Loeliger + Acked-by: Andy Fleming + +commit 151d5d992eab8c497b24c816c73dc1ad8bffb4eb +Author: Andy Fleming +Date: Mon Apr 23 01:32:22 2007 -0500 + + Add cpu support for the 8544 + + Recognize new SVR values, and add a few register definitions + + Signed-off-by: Ed Swarthout + Signed-off-by: Jon Loeliger + Acked-by: Andy Fleming + +commit 25d83d7f4ac65727182d8ddaf7ba42fa74cf65ae +Author: Jon Loeliger +Date: Wed Apr 11 16:51:02 2007 -0500 + + Add MPC8544DS basic port board files. + + Add board port under new board/freescale directory + structure and reuse existing PIXIS FPGA support there. + + Signed-off-by: Ed Swarthout + Signed-off-by: Jon Loeliger + +commit 0cde4b00fc7393b89f379d83a9d436dcb1334bfa +Author: Jon Loeliger +Date: Wed Apr 11 16:50:57 2007 -0500 + + Add MPC8544DS main configuration file. + + Signed-off-by: Ed Swarthout + Signed-off-by: Jon Loeliger + +commit 362dd83077ac04c0296bca3e824ec2fb3d44d9d6 +Author: Sergei Shtylyov +Date: Wed Dec 27 22:07:15 2006 +0300 + + Fix PCI I/O space mapping on Freescale MPC85x0ADS + + The PCI I/O space mapping for Freescale MPC8540ADS board was broken by commit + 52c7a68b8d587ebcf5a6b051b58b3d3ffa377ddc which failed to update the #define's + describing the local address window used for the PCI I/O space accesses -- fix + this and carry over the necessary changes into the MPC8560ADS code since the + PCI I/O space mapping was also broken for this board (by the earlier commit + 087454609e47295443af793a282cddcd91a5f49c). Add the comments clarifying how + the PCI I/O space must be mapped to all the MPC85xx board config. headers. + + Signed-off-by: Sergei Shtylyov + + board/mpc8540ads/init.S | 4 ++-- + board/mpc8560ads/init.S | 4 ++-- + include/configs/MPC8540ADS.h | 5 ++--- + include/configs/MPC8541CDS.h | 2 +- + include/configs/MPC8548CDS.h | 2 +- + include/configs/MPC8560ADS.h | 8 ++++---- + 6 files changed, 12 insertions(+), 13 deletions(-) + +commit 96629cbabdb727d4a5e62542deefc01d498db6dc +Author: Zang Roy-r61911 +Date: Tue Dec 5 16:42:30 2006 +0800 + + u-boot: Fix e500 v2 core reset bug + + The following patch fixes the e500 v2 core reset bug. + For e500 v2 core, a new reset control register is added to reset the + processor. + + Signed-off-by: Roy Zang + +commit 63247a5acd58032e6cf33f525bc3923b467bac88 +Author: Zang Roy-r61911 +Date: Wed Dec 20 11:01:00 2006 +0800 + + u-boot: v2: Remove the fixed TLB and LAW entrynubmer + + Remove the fixed TLB and LAW entry nubmer. Use actually TLB and LAW + entry number to control the loop. This can reduce the potential risk + for the 85xx processor increasing its TLB adn LAW entry number. + + Signed-off-by: Swarthout Edward + Signed-off-by: Roy Zang + +commit 0b1934ba12fd408fcc3b8bd9f4b04864c42a42bf +Author: Zang Roy-r61911 +Date: Mon Dec 18 17:01:04 2006 +0800 + + u-boot: Fix the 85xxcds tsec bug + + Fix the 85xxcds tsec bug. + When enable PCI, tsec.o should be added to u-boot.lds to make tsec work. + + Signed-off-by: Roy Zang + +commit 7337b237ffc4aaf1b9467024fe472a880d852598 +Author: Zang Roy-r61911 +Date: Fri Dec 15 14:43:31 2006 +0800 + + u-boot: Fix CPU2 errata on MPC8548CDS board + + This patch apply workaround of CPU2 errata on MPC8548CDS board. + + Signed-off-by:Ebony Zhu + +commit 39b18c4f3e0b6d0dc00f4e68bad2da3766c85f09 +Author: ebony.zhu@freescale.com +Date: Mon Dec 18 16:25:15 2006 +0800 + + u-boot: Disables MPC8548CDS 2T_TIMING for DDR by default + + This patch disables MPC8548CDS 2T_TIMING for DDR by default. + + Signed-off-by:Ebony Zhu + +commit 41fb7e0f1ec9b91bdae2565bab5f2e3ee15039c7 +Author: Zang Roy-r61911 +Date: Thu Dec 14 14:14:55 2006 +0800 + + u-boot: Enable PCI function and add PEX & rapidio memory map on MPC8548CDS board + + Enable PCI function and add PEX & rapidio memory map on MPC8548CDS + board. + Signed-off-by: Roy Zang + commit 323bfa8f436dc3bc57187c9b1488bc3146ff1522 Author: Stefan Roese Date: Mon Apr 23 12:00:22 2007 +0200 diff --git a/MAKEALL b/MAKEALL index 59aec2867..d7cd8d742 100755 --- a/MAKEALL +++ b/MAKEALL @@ -145,7 +145,8 @@ LIST_85xx=" \ MPC8540ADS MPC8540EVAL MPC8541CDS MPC8544DS \ MPC8548CDS MPC8555CDS MPC8560ADS PM854 \ PM856 sbc8540 sbc8560 stxgp3 \ - TQM8540 TQM8541 TQM8555 TQM8560 \ + stxssa TQM8540 TQM8541 TQM8555 \ + TQM8560 \ " ######################################################################### From 2f15278c2eb911c668b4fe562130b78cf554d139 Mon Sep 17 00:00:00 2001 From: Wolfgang Denk Date: Sat, 5 May 2007 18:23:11 +0200 Subject: [PATCH 41/47] Coding stylke cleanup; update CHANGELOG. Signed-off-by: Wolfgang Denk --- CHANGELOG | 65 +++++++++++++++++++++++++++ board/freescale/mpc8544ds/mpc8544ds.c | 22 ++++----- cpu/mpc85xx/cpu.c | 18 ++++---- cpu/ppc4xx/4xx_enet.c | 4 +- drivers/tsec.c | 2 +- include/configs/MPC8568MDS.h | 2 +- 6 files changed, 87 insertions(+), 26 deletions(-) diff --git a/CHANGELOG b/CHANGELOG index 0bb6bc5c1..184e9418c 100644 --- a/CHANGELOG +++ b/CHANGELOG @@ -1,9 +1,44 @@ +commit 885ec89b648a899a2f32393fd3ffd9f7234c4402 +Author: Wolfgang Denk +Date: Sat May 5 18:05:02 2007 +0200 + + Add STX GP3 SSA board to MAKEALL script; update CHANGELOG. + + Signed-off-by: Wolfgang Denk + commit 5499645b3fe17a548af9dfc479ca6e2455f179a2 Author: Wolfgang Denk Date: Sat May 5 17:15:50 2007 +0200 Make "file" command happy with some config.mk files; update CHANGELOG +commit e3b8c78bc2489c27ae020986ef0eaca684866cef +Author: Jeffrey Mann +Date: Sat May 5 08:32:14 2007 +0200 + + ppc4xx: Detect if the sysclk on Sequoia is 33 or 33.333 MHz + + The AMCC Secquoia board has been changed in a new revision from using a + 33.000 MHz clock to a 33.333 MHz system clock. A bit in the CPLD + indicates the difference. This patch reads that bit and uses the correct + clock speed for the board. This code is backward compatable will all + prior boards. All prior boards will be read as 33.000. + + Signed-off-by: Jeffrey Mann + Signed-off-by: Stefan Roese + +commit f544ff6656fca263ed1ebe39899b6d95da67c8b8 +Author: Stefan Roese +Date: Sat May 5 08:29:01 2007 +0200 + + ppc4xx: Sequoia: Remove cpu/ppc4xx/speed.c from NAND booting + + Using cpu/ppc4xx/speed.c to calculate the bus frequency is too big + for the 4k NAND boot image so define bus_frequency to 133MHz here + which is save for the refresh counter setup. + + Signed-off-by: Stefan Roese + commit a79886590593ba1d667c840caa4940c61639f18f Author: Thomas Knobloch Date: Sat May 5 07:04:42 2007 +0200 @@ -124,6 +159,22 @@ Date: Fri Mar 16 13:02:53 2007 -0500 Signed-off-by: James Yang Signed-off-by: Jon Loeliger +commit 8b39501d28754e72726ce7fb02310e56dbdf116a +Author: Stefan Roese +Date: Sun Apr 29 14:13:01 2007 +0200 + + ppc4xx: Bamboo: Use current NAND driver and *not* the legacy driver + + Signed-off-by: Stefan Roese + +commit 37ed6cdd4159195bfad68d8a237f6adda8f482cb +Author: Matthias Fuchs +Date: Tue Apr 24 14:03:45 2007 +0200 + + ppc4xx: setup 440EPx/GRx ZMII/RGMII bridge depending on PFC register content. + + Signed-off-by: Matthias Fuchs + commit 66ed6cca3f340f7a8a06d9272ae2ef8e96f0273d Author: Andy Fleming Date: Mon Apr 23 02:37:47 2007 -0500 @@ -429,6 +480,20 @@ Date: Thu Apr 19 23:14:39 2007 -0400 Also moved the libfdt.a requirement into the main Makefile. That is The U-Boot Way. +commit d21686263574e95cb3e9e9b0496f968b1b897fdb +Author: Stefan Roese +Date: Thu Apr 19 09:53:52 2007 +0200 + + ppc4xx: Fix chip select timing for SysACE access on AMCC Katmai + + Previous versions used full wait states for the chip select #1 which + is connected to the Xilinix SystemACE controller on the AMCC Katmai + evaluation board. This leads to really slow access and therefore low + performance. This patch now sets up the chip select a lot faster + resulting in much better read/write performance of the Linux driver. + + Signed-off-by: Stefan Roese + commit 37837828d89084879bee2f2b8c7c68d4695940df Author: Wolfgang Denk Date: Wed Apr 18 17:49:29 2007 +0200 diff --git a/board/freescale/mpc8544ds/mpc8544ds.c b/board/freescale/mpc8544ds/mpc8544ds.c index 90599348d..4ff1da930 100644 --- a/board/freescale/mpc8544ds/mpc8544ds.c +++ b/board/freescale/mpc8544ds/mpc8544ds.c @@ -52,7 +52,7 @@ int checkboard (void) volatile immap_t *immap = (immap_t *) CFG_CCSRBAR; volatile ccsr_gur_t *gur = &immap->im_gur; - if ((uint)&gur->porpllsr != 0xe00e0000) { + if ((uint)&gur->porpllsr != 0xe00e0000) { printf("immap size error %x\n",&gur->porpllsr); } printf ("Board: MPC8544DS\n"); @@ -79,7 +79,6 @@ initdram(int board_type) return dram_size; } - #if defined(CFG_DRAM_TEST) int testdram(void) @@ -119,8 +118,6 @@ testdram(void) } #endif - - int last_stage_init(void) { return 0; @@ -190,16 +187,15 @@ get_board_sys_clk(ulong dummy) void ft_board_setup(void *blob, bd_t *bd) { - u32 *p; - int len; + u32 *p; + int len; - ft_cpu_setup(blob, bd); + ft_cpu_setup(blob, bd); - p = ft_get_prop(blob, "/memory/reg", &len); - if (p != NULL) { - *p++ = cpu_to_be32(bd->bi_memstart); - *p = cpu_to_be32(bd->bi_memsize); - } + p = ft_get_prop(blob, "/memory/reg", &len); + if (p != NULL) { + *p++ = cpu_to_be32(bd->bi_memstart); + *p = cpu_to_be32(bd->bi_memsize); + } } #endif - diff --git a/cpu/mpc85xx/cpu.c b/cpu/mpc85xx/cpu.c index 63176d284..7735a52cc 100644 --- a/cpu/mpc85xx/cpu.c +++ b/cpu/mpc85xx/cpu.c @@ -71,14 +71,14 @@ int checkcpu (void) puts("8548_E"); break; case SVR_8544: - puts("8544"); - break; - case SVR_8544_E: - puts("8544_E"); - break; - case SVR_8568_E: - puts("8568_E"); - break; + puts("8544"); + break; + case SVR_8544_E: + puts("8544_E"); + break; + case SVR_8568_E: + puts("8568_E"); + break; default: puts("Unknown"); break; @@ -157,7 +157,7 @@ int do_reset (cmd_tbl_t *cmdtp, bd_t *bd, int flag, int argc, char *argv[]) /* e500 v2 core has reset control register */ volatile unsigned int * rstcr; rstcr = (volatile unsigned int *)(CFG_IMMR + 0xE00B0); - *rstcr = 0x2; /* HRESET_REQ */ + *rstcr = 0x2; /* HRESET_REQ */ }else{ /* * Initiate hard reset in debug control register DBCR0 diff --git a/cpu/ppc4xx/4xx_enet.c b/cpu/ppc4xx/4xx_enet.c index be4e82405..1200d021a 100644 --- a/cpu/ppc4xx/4xx_enet.c +++ b/cpu/ppc4xx/4xx_enet.c @@ -344,7 +344,7 @@ int ppc_4xx_eth_setup_bridge(int devnum, bd_t * bis) mfsdr(sdr_pfc1, pfc1); pfc1 &= SDR0_PFC1_SELECT_MASK; - switch (pfc1) { + switch (pfc1) { case SDR0_PFC1_SELECT_CONFIG_2: /* 1 x GMII port */ out32 (ZMII_FER, 0x00); @@ -361,7 +361,7 @@ int ppc_4xx_eth_setup_bridge(int devnum, bd_t * bis) break; case SDR0_PFC1_SELECT_CONFIG_6: /* 2 x SMII ports */ - out32 (ZMII_FER, + out32 (ZMII_FER, ((ZMII_FER_SMII) << ZMII_FER_V(0)) | ((ZMII_FER_SMII) << ZMII_FER_V(1))); out32 (RGMII_FER, 0x00000000); diff --git a/drivers/tsec.c b/drivers/tsec.c index 25566a733..b4187739c 100644 --- a/drivers/tsec.c +++ b/drivers/tsec.c @@ -67,7 +67,7 @@ struct tsec_info_struct { static struct tsec_info_struct tsec_info[] = { #if defined(CONFIG_MPC85XX_TSEC1) || defined(CONFIG_MPC83XX_TSEC1) #if defined(CONFIG_MPC8544DS) - {TSEC1_PHY_ADDR, TSEC_GIGABIT | TSEC_REDUCED, TSEC1_PHYIDX}, + {TSEC1_PHY_ADDR, TSEC_GIGABIT | TSEC_REDUCED, TSEC1_PHYIDX}, #else {TSEC1_PHY_ADDR, TSEC_GIGABIT, TSEC1_PHYIDX}, #endif diff --git a/include/configs/MPC8568MDS.h b/include/configs/MPC8568MDS.h index 66293c522..3f65644fd 100644 --- a/include/configs/MPC8568MDS.h +++ b/include/configs/MPC8568MDS.h @@ -149,7 +149,7 @@ extern unsigned long get_clock_freq(void); #define CFG_BR1_PRELIM 0xf8000801 #define CFG_OR1_PRELIM 0xffffe9f7 -//#define CFG_FLASH_BANKS_LIST {0xff800000, CFG_FLASH_BASE} +/*#define CFG_FLASH_BANKS_LIST {0xff800000, CFG_FLASH_BASE} */ #define CFG_MAX_FLASH_BANKS 1 /* number of banks */ #define CFG_MAX_FLASH_SECT 512 /* sectors per device */ #undef CFG_FLASH_CHECKSUM From ebd0a0ae05a44769c4e27458ad4e9f3438250443 Mon Sep 17 00:00:00 2001 From: Mike Frysinger Date: Mon, 23 Apr 2007 13:54:24 +0200 Subject: [PATCH 42/47] [patch] use unsigned char in smc91111 driver for mac the v_mac variable in the smc91111 driver is declared as a signed char ... this causes problems when one of the bytes in the MAC is "signed" like 0xE0 because when it gets printed out, you get a display like: 0xFFFFFFE0 and that's no good Signed-off-by: Mike Frysinger --- drivers/smc91111.c | 8 ++++---- 1 file changed, 4 insertions(+), 4 deletions(-) diff --git a/drivers/smc91111.c b/drivers/smc91111.c index f91e4b984..8061f1297 100644 --- a/drivers/smc91111.c +++ b/drivers/smc91111.c @@ -1538,9 +1538,9 @@ int eth_send(volatile void *packet, int length) { int smc_get_ethaddr (bd_t * bd) { int env_size, rom_valid, env_present = 0, reg; - char *s = NULL, *e, *v_mac, es[] = "11:22:33:44:55:66"; + char *s = NULL, *e, es[] = "11:22:33:44:55:66"; char s_env_mac[64]; - uchar v_env_mac[6], v_rom_mac[6]; + uchar v_env_mac[6], v_rom_mac[6], *v_mac; env_size = getenv_r ("ethaddr", s_env_mac, sizeof (s_env_mac)); if ((env_size > 0) && (env_size < sizeof (es))) { /* exit if env is bad */ @@ -1563,7 +1563,7 @@ int smc_get_ethaddr (bd_t * bd) if (!env_present) { /* if NO env */ if (rom_valid) { /* but ROM is valid */ - v_mac = (char *)v_rom_mac; + v_mac = v_rom_mac; sprintf (s_env_mac, "%02X:%02X:%02X:%02X:%02X:%02X", v_mac[0], v_mac[1], v_mac[2], v_mac[3], v_mac[4], v_mac[5]); @@ -1573,7 +1573,7 @@ int smc_get_ethaddr (bd_t * bd) return (-1); } } else { /* good env, don't care ROM */ - v_mac = (char *)v_env_mac; /* always use a good env over a ROM */ + v_mac = v_env_mac; /* always use a good env over a ROM */ } if (env_present && rom_valid) { /* if both env and ROM are good */ From 9ffd451afeb08e5be7ddae680487ec962b2bca25 Mon Sep 17 00:00:00 2001 From: Jeffrey Mann Date: Mon, 23 Apr 2007 14:00:11 +0200 Subject: [PATCH 43/47] [patch] setenv(...) can delete environmentalvariables update setenv() function so that entering a NULL value for the variable's value will delete the environmental variable Signed-off-by: Jeffrey Mann Acked-by: Stefan Roese --- common/cmd_nvedit.c | 5 ++++- 1 file changed, 4 insertions(+), 1 deletion(-) diff --git a/common/cmd_nvedit.c b/common/cmd_nvedit.c index 9834ba65b..977ec5bae 100644 --- a/common/cmd_nvedit.c +++ b/common/cmd_nvedit.c @@ -391,7 +391,10 @@ int _do_setenv (int flag, int argc, char *argv[]) void setenv (char *varname, char *varvalue) { char *argv[4] = { "setenv", varname, varvalue, NULL }; - _do_setenv (0, 3, argv); + if (varvalue == NULL) + _do_setenv (0, 2, argv); + else + _do_setenv (0, 3, argv); } int do_setenv ( cmd_tbl_t *cmdtp, int flag, int argc, char *argv[]) From b7598a43f2b421a713d8135e98a42c37d9eb9df0 Mon Sep 17 00:00:00 2001 From: Sergei Shtylyov Date: Mon, 23 Apr 2007 15:30:39 +0200 Subject: [PATCH 44/47] [PATCH] Avoid assigning PCI resources from zero address If a PCI IDE card happens to get a zero address assigned to it, the Linux IDE core complains and IDE drivers fails to work. Also, assigning zero to a BAR was illegal according to PCI 2.1 (the later revisions seem to have excluded the sentence about "0" being considered an invalid address) -- so, use a reasonable starting value of 0x1000 (that's what the most Linux archs are using). Alternatively, one might have fixed the calls to pci_set_region() individually (some code even seems to have taken care of this issue) but that would have been a lot more work. :-) Signed-off-by: Sergei Shtylyov Acked-by: Stefan Roese --- drivers/pci_auto.c | 7 ++++++- 1 file changed, 6 insertions(+), 1 deletion(-) diff --git a/drivers/pci_auto.c b/drivers/pci_auto.c index 969167555..f170c2db8 100644 --- a/drivers/pci_auto.c +++ b/drivers/pci_auto.c @@ -34,7 +34,12 @@ void pciauto_region_init(struct pci_region* res) { - res->bus_lower = res->bus_start; + /* + * Avoid allocating PCI resources from address 0 -- this is illegal + * according to PCI 2.1 and moreover, this is known to cause Linux IDE + * drivers to fail. Use a reasonable starting value of 0x1000 instead. + */ + res->bus_lower = res->bus_start ? res->bus_start : 0x1000; } void pciauto_region_align(struct pci_region *res, unsigned long size) From 4ec5bd55ed1ffa91a774af298769621f4fbb18c1 Mon Sep 17 00:00:00 2001 From: Ladislav Michl Date: Wed, 25 Apr 2007 16:01:26 +0200 Subject: [PATCH 45/47] [PATCH] simplify silent console Signed-off-by: Ladislav Michl Acked-by: Stefan Roese --- common/console.c | 8 +------- common/main.c | 38 +++++--------------------------------- 2 files changed, 6 insertions(+), 40 deletions(-) diff --git a/common/console.c b/common/console.c index e9f23bec1..d8a0cb6c7 100644 --- a/common/console.c +++ b/common/console.c @@ -494,13 +494,7 @@ int console_init_r (void) /* suppress all output if splash screen is enabled and we have a bmp to display */ if (getenv("splashimage") != NULL) - outputdev = search_device (DEV_FLAGS_OUTPUT, "nulldev"); -#endif - -#ifdef CONFIG_SILENT_CONSOLE - /* Suppress all output if "silent" mode requested */ - if (gd->flags & GD_FLG_SILENT) - outputdev = search_device (DEV_FLAGS_OUTPUT, "nulldev"); + gd->flags |= GD_FLG_SILENT; #endif /* Scan devices looking for input and output devices */ diff --git a/common/main.c b/common/main.c index cc4b50f61..d8c005495 100644 --- a/common/main.c +++ b/common/main.c @@ -112,14 +112,6 @@ static __inline__ int abortboot(int bootdelay) u_int presskey_max = 0; u_int i; -#ifdef CONFIG_SILENT_CONSOLE - if (gd->flags & GD_FLG_SILENT) { - /* Restore serial console */ - console_assign (stdout, "serial"); - console_assign (stderr, "serial"); - } -#endif - # ifdef CONFIG_AUTOBOOT_PROMPT printf (CONFIG_AUTOBOOT_PROMPT, bootdelay); # endif @@ -199,14 +191,8 @@ static __inline__ int abortboot(int bootdelay) # endif #ifdef CONFIG_SILENT_CONSOLE - if (abort) { - /* permanently enable normal console output */ - gd->flags &= ~(GD_FLG_SILENT); - } else if (gd->flags & GD_FLG_SILENT) { - /* Restore silent console */ - console_assign (stdout, "nulldev"); - console_assign (stderr, "nulldev"); - } + if (abort) + gd->flags &= ~GD_FLG_SILENT; #endif return abort; @@ -222,14 +208,6 @@ static __inline__ int abortboot(int bootdelay) { int abort = 0; -#ifdef CONFIG_SILENT_CONSOLE - if (gd->flags & GD_FLG_SILENT) { - /* Restore serial console */ - console_assign (stdout, "serial"); - console_assign (stderr, "serial"); - } -#endif - #ifdef CONFIG_MENUPROMPT printf(CONFIG_MENUPROMPT, bootdelay); #else @@ -245,7 +223,7 @@ static __inline__ int abortboot(int bootdelay) if (tstc()) { /* we got a key press */ (void) getc(); /* consume input */ puts ("\b\b\b 0"); - abort = 1; /* don't auto boot */ + abort = 1; /* don't auto boot */ } } #endif @@ -275,14 +253,8 @@ static __inline__ int abortboot(int bootdelay) putc ('\n'); #ifdef CONFIG_SILENT_CONSOLE - if (abort) { - /* permanently enable normal console output */ - gd->flags &= ~(GD_FLG_SILENT); - } else if (gd->flags & GD_FLG_SILENT) { - /* Restore silent console */ - console_assign (stdout, "nulldev"); - console_assign (stderr, "nulldev"); - } + if (abort) + gd->flags &= ~GD_FLG_SILENT; #endif return abort; From a9d87e2707dcb249f6bb7f7ff7e00acd8cda9fd2 Mon Sep 17 00:00:00 2001 From: Grzegorz Wianecki Date: Sun, 29 Apr 2007 14:01:54 +0200 Subject: [PATCH 46/47] [PATCH] Use PVR to distinguish MPC5200B from MPC5200 in boot message MPC5200B systems are incorrectly reported as MPC5200 in U-Boot start-up message. Use PVR to distinguish between the two variants, and print proper CPU information. Signed-off-by: Grzegorz Wianecki Signed-off-by: Bartlomiej Sieka Signed-off-by: Grant Likely --- cpu/mpc5xxx/cpu.c | 12 ++++++++---- include/asm-ppc/processor.h | 8 ++++++-- 2 files changed, 14 insertions(+), 6 deletions(-) diff --git a/cpu/mpc5xxx/cpu.c b/cpu/mpc5xxx/cpu.c index 813aa7935..73b166d99 100644 --- a/cpu/mpc5xxx/cpu.c +++ b/cpu/mpc5xxx/cpu.c @@ -53,12 +53,16 @@ int checkcpu (void) #else svr = get_svr(); pvr = get_pvr(); - switch (SVR_VER (svr)) { - case SVR_MPC5200: - printf ("MPC5200"); + + switch (pvr) { + case PVR_5200: + printf("MPC5200"); + break; + case PVR_5200B: + printf("MPC5200B"); break; default: - printf ("MPC52?? (SVR %08x)", svr); + printf("Unknown MPC5xxx"); break; } diff --git a/include/asm-ppc/processor.h b/include/asm-ppc/processor.h index e9361c517..5efc3ee2c 100644 --- a/include/asm-ppc/processor.h +++ b/include/asm-ppc/processor.h @@ -706,8 +706,6 @@ #define SVR_MJREV(svr) (((svr) >> 4) & 0x0F) /* Major SOC design revision indicator */ #define SVR_MNREV(svr) (((svr) >> 0) & 0x0F) /* Minor SOC design revision indicator */ -/* System-On-Chip Version Numbers (version field only) */ -#define SVR_MPC5200 0x8011 /* Processor Version Register */ @@ -818,6 +816,12 @@ #define PVR_8260_HIP7R1 0x80822013 #define PVR_8260_HIP7RA 0x80822014 +/* + * MPC 52xx + */ +#define PVR_5200 0x80822011 +#define PVR_5200B 0x80822014 + /* * System Version Register From ac4cd59d59c9bf3f89cb7a344abf8184d678f562 Mon Sep 17 00:00:00 2001 From: Timur Tabi Date: Sat, 5 May 2007 08:12:30 +0200 Subject: [PATCH 47/47] 5xxx: write MAC address to mac-address and local-mac-address Some device trees have a mac-address property, some have local-mac-address, and some have both. To support all of these device trees, ftp_cpu_setup() should write the MAC address to mac-address and local-mac-address, if they exist. Signed-off-by: Timur Tabi Acked-by: Grant Likely --- cpu/mpc5xxx/cpu.c | 4 ++++ 1 file changed, 4 insertions(+) diff --git a/cpu/mpc5xxx/cpu.c b/cpu/mpc5xxx/cpu.c index 73b166d99..1eac2bbfb 100644 --- a/cpu/mpc5xxx/cpu.c +++ b/cpu/mpc5xxx/cpu.c @@ -131,5 +131,9 @@ ft_cpu_setup(void *blob, bd_t *bd) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@3000/mac-address", &len); if (p != NULL) memcpy(p, bd->bi_enetaddr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@3000/local-mac-address", &len); + if (p != NULL) + memcpy(p, bd->bi_enetaddr, 6); } #endif